CompoundList
Sign in
Molecular formula

C10H10ClFN2S

13 compounds have this formula on CompoundList.

Molar mass
244.71g/mol
Monoisotopic mass
244.0237Da
Atoms
25
Elements
6
Rings plus double bonds
6

The formula C10H10ClFN2S describes a molecule made of 10 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1049.08%
    12.011 × 10 = 120.110 g/mol
  • H Hydrogen × 104.12%
    1.008 × 10 = 10.080 g/mol
  • Cl Chlorine × 114.49%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 17.76%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 211.45%
    14.007 × 2 = 28.014 g/mol
  • S Sulfur × 113.10%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C10H10ClFN2S

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 13 of 13 compounds

5-((4-Fluorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride chemical structure, C10H10ClFN2S, CAS 1181458-45-6
5-((4-Fluorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride
CAS 1181458-45-6C10H10ClFN2S
3-[(2-Fluorophenyl)methyl]-2,3-dihydro-1,3-thiazol-2-imine hydrochloride chemical structure, C10H10ClFN2S, CAS 1052551-96-8
3-[(2-Fluorophenyl)methyl]-2,3-dihydro-1,3-thiazol-2-imine hydrochloride
CAS 1052551-96-8C10H10ClFN2S
1-(3-Chloro-4-fluorophenyl)-3-cyclopropylthiourea chemical structure, C10H10ClFN2S, CAS 708993-34-4
1-(3-Chloro-4-fluorophenyl)-3-cyclopropylthiourea
CAS 708993-34-4C10H10ClFN2S
2-{[(2-Chloro-6-fluorophenyl)methyl]sulfanyl}-4,5-dihydro-1H-imidazole chemical structure, C10H10ClFN2S, CAS 913689-07-3
2-{[(2-Chloro-6-fluorophenyl)methyl]sulfanyl}-4,5-dihydro-1H-imidazole
CAS 913689-07-3C10H10ClFN2S
(2-(3-Fluorophenyl)thiazol-4-yl)methanamine hydrochloride chemical structure, C10H10ClFN2S, CAS 1187928-33-1
(2-(3-Fluorophenyl)thiazol-4-yl)methanamine hydrochloride
CAS 1187928-33-1C10H10ClFN2S
(2-(4-Fluorophenyl)thiazol-4-yl)methanamine hydrochloride chemical structure, C10H10ClFN2S, CAS 1187932-83-7
(2-(4-Fluorophenyl)thiazol-4-yl)methanamine hydrochloride
CAS 1187932-83-7C10H10ClFN2S
5-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-3-yl)-1H-pyrazole chemical structure, C10H10ClFN2S, CAS 2090943-89-6
5-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-3-yl)-1H-pyrazole
CAS 2090943-89-6C10H10ClFN2S
4-[(4-Fluorophenyl)methyl]-1,3-thiazol-2-amine hydrochloride chemical structure, C10H10ClFN2S, CAS 2580235-51-2
4-[(4-Fluorophenyl)methyl]-1,3-thiazol-2-amine hydrochloride
CAS 2580235-51-2C10H10ClFN2S
5-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-2-yl)-1H-pyrazole chemical structure, C10H10ClFN2S, CAS 2091620-75-4
5-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-2-yl)-1H-pyrazole
CAS 2091620-75-4C10H10ClFN2S
4-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-2-yl)-1H-pyrazole chemical structure, C10H10ClFN2S, CAS 2092513-36-3
4-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-2-yl)-1H-pyrazole
CAS 2092513-36-3C10H10ClFN2S
4-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-3-yl)-1H-pyrazole chemical structure, C10H10ClFN2S, CAS 2092513-46-5
4-(Chloromethyl)-1-(2-fluoroethyl)-3-(thiophen-3-yl)-1H-pyrazole
CAS 2092513-46-5C10H10ClFN2S
N-(2-Chloroprop-2-en-1-yl)-N'-(4-fluorophenyl)thiourea chemical structure, C10H10ClFN2S, CAS 35941-80-1
N-(2-Chloroprop-2-en-1-yl)-N'-(4-fluorophenyl)thiourea
CAS 35941-80-1C10H10ClFN2S
3-{5-Chlorothieno[3,2-b]pyridin-2-yl}-3-fluoropropan-1-amine chemical structure, C10H10ClFN2S, CAS 2228369-25-1
3-{5-Chlorothieno[3,2-b]pyridin-2-yl}-3-fluoropropan-1-amine
CAS 2228369-25-1C10H10ClFN2S

Frequently asked questions

What is the molar mass of C10H10ClFN2S?

The molar mass of C10H10ClFN2S is 244.71 g/mol, calculated from standard atomic weights for 10 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 1 sulfur atom. The monoisotopic mass is 244.0237 Da.

How many compounds have the formula C10H10ClFN2S?

CompoundList lists 13 compounds with the molecular formula C10H10ClFN2S, including 5-((4-Fluorophenyl)methyl)-1,3-thiazol-2-amine hydrochloride, 3-[(2-Fluorophenyl)methyl]-2,3-dihydro-1,3-thiazol-2-imine hydrochloride, 1-(3-Chloro-4-fluorophenyl)-3-cyclopropylthiourea. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C10H10ClFN2S?

C10H10ClFN2S has a degree of unsaturation of 6. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.