CompoundList
Sign in
Molecular formula

C13H14ClNOS

40 compounds have this formula on CompoundList.

Molar mass
267.77g/mol
Monoisotopic mass
267.0485Da
Atoms
31
Elements
6
Rings plus double bonds
7

The formula C13H14ClNOS describes a molecule made of 13 carbon atoms, 14 hydrogen atoms, 1 chlorine atom, 1 nitrogen atom, 1 oxygen atom and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1358.31%
    12.011 × 13 = 156.143 g/mol
  • H Hydrogen × 145.27%
    1.008 × 14 = 14.112 g/mol
  • Cl Chlorine × 113.24%
    35.45 × 1 = 35.450 g/mol
  • N Nitrogen × 15.23%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 15.97%
    15.999 × 1 = 15.999 g/mol
  • S Sulfur × 111.97%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C13H14ClNOS

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 40 of 40 compounds

Alagebrium chloride chemical structure, C13H14ClNOS, CAS 341028-37-3
Alagebrium chloride
CAS 341028-37-3C13H14ClNOS
4-Chlorobenzyl (3,5-dimethyl-4-isoxazolyl)methyl sulfide chemical structure, C13H14ClNOS, CAS 303985-15-1
4-Chlorobenzyl (3,5-dimethyl-4-isoxazolyl)methyl sulfide
CAS 303985-15-1C13H14ClNOS
N-Butyl-3-chloro-1-benzothiophene-2-carboxamide chemical structure, C13H14ClNOS, CAS 62524-15-6
N-Butyl-3-chloro-1-benzothiophene-2-carboxamide
CAS 62524-15-6C13H14ClNOS
N-tert-Butyl-3-chloro-1-benzothiophene-2-carboxamide chemical structure, C13H14ClNOS, CAS 313960-52-0
N-tert-Butyl-3-chloro-1-benzothiophene-2-carboxamide
CAS 313960-52-0C13H14ClNOS
2-Chloro-1-(2,5-dimethyl-1-thiophen-2-ylmethyl-1H-pyrrol-3-yl)-ethanone chemical structure, C13H14ClNOS, CAS 554405-85-5
2-Chloro-1-(2,5-dimethyl-1-thiophen-2-ylmethyl-1H-pyrrol-3-yl)-ethanone
CAS 554405-85-5C13H14ClNOS
2-Chloro-N-(2,5-dihydrothiophen-3-ylmethyl)-N-phenylacetamide chemical structure, C13H14ClNOS, CAS 851116-07-9
2-Chloro-N-(2,5-dihydrothiophen-3-ylmethyl)-N-phenylacetamide
CAS 851116-07-9C13H14ClNOS
4-Chloro-2-({[2-(2-thienyl)ethyl]amino}methyl)phenol chemical structure, C13H14ClNOS, CAS 1019486-44-2
4-Chloro-2-({[2-(2-thienyl)ethyl]amino}methyl)phenol
CAS 1019486-44-2C13H14ClNOS
3-Chloro-4-methoxy-N-[(5-methylthiophen-2-yl)methyl]aniline chemical structure, C13H14ClNOS, CAS 445410-84-4
3-Chloro-4-methoxy-N-[(5-methylthiophen-2-yl)methyl]aniline
CAS 445410-84-4C13H14ClNOS
N-(3-Chloro-4-methoxybenzyl)-N-(2-thienylmethyl)amine chemical structure, C13H14ClNOS, CAS 1092310-82-1
N-(3-Chloro-4-methoxybenzyl)-N-(2-thienylmethyl)amine
CAS 1092310-82-1C13H14ClNOS
Spiro(benzo(c)thiophene-1(3H),2'-pyrrolidin)-3-one, 5-chloro-1'-ethyl- chemical structure, C13H14ClNOS, CAS 83982-99-4
Spiro(benzo(c)thiophene-1(3H),2'-pyrrolidin)-3-one, 5-chloro-1'-ethyl-
CAS 83982-99-4C13H14ClNOS
Phenol, 2-((2-(aminomethyl)phenyl)thio)-, hydrochloride chemical structure, C13H14ClNOS, CAS 127906-49-4
Phenol, 2-((2-(aminomethyl)phenyl)thio)-, hydrochloride
CAS 127906-49-4C13H14ClNOS
1-(2-Thia-5-azabicyclo[2.2.1]heptan-5-yl)-2-(2-chlorophenyl)ethanone chemical structure, C13H14ClNOS, CAS 2034309-83-4
1-(2-Thia-5-azabicyclo[2.2.1]heptan-5-yl)-2-(2-chlorophenyl)ethanone
CAS 2034309-83-4C13H14ClNOS
2-Chloro-5-[(4-propylphenoxy)methyl]-1,3-thiazole chemical structure, C13H14ClNOS, CAS 478032-32-5
2-Chloro-5-[(4-propylphenoxy)methyl]-1,3-thiazole
CAS 478032-32-5C13H14ClNOS
3-Chloro-6-methyl-N-(propan-2-yl)-1-benzothiophene-2-carboxamide chemical structure, C13H14ClNOS, CAS 543686-66-4
3-Chloro-6-methyl-N-(propan-2-yl)-1-benzothiophene-2-carboxamide
CAS 543686-66-4C13H14ClNOS
1H-1-Benzazepine, 1-(chloroacetyl)-4,5-dihydro-2-(methylthio)- chemical structure, C13H14ClNOS, CAS 192816-24-3
1H-1-Benzazepine, 1-(chloroacetyl)-4,5-dihydro-2-(methylthio)-
CAS 192816-24-3C13H14ClNOS
(5-Chlorothiophen-2-yl)(4-cyclopropylidenepiperidin-1-yl)methanone chemical structure, C13H14ClNOS, CAS 2097922-33-1
(5-Chlorothiophen-2-yl)(4-cyclopropylidenepiperidin-1-yl)methanone
CAS 2097922-33-1C13H14ClNOS
2-(((2-Methoxyphenyl)thio)methyl)pyridine, hydrochloride chemical structure, C13H14ClNOS, CAS 81851-20-9
2-(((2-Methoxyphenyl)thio)methyl)pyridine, hydrochloride
CAS 81851-20-9C13H14ClNOS
2-Chloro-1-(3-thiophen-2-yl-8-azabicyclo[3.2.1]oct-2-en-8-yl)ethanone chemical structure, C13H14ClNOS, CAS 2411236-43-4
2-Chloro-1-(3-thiophen-2-yl-8-azabicyclo[3.2.1]oct-2-en-8-yl)ethanone
CAS 2411236-43-4C13H14ClNOS
Cyclohexanecarbothioamide, N-(4-chlorophenyl)-2-oxo- chemical structure, C13H14ClNOS, CAS 114964-24-8
Cyclohexanecarbothioamide, N-(4-chlorophenyl)-2-oxo-
CAS 114964-24-8C13H14ClNOS
Thiazole, 5-(chloromethyl)-2-(4-ethoxyphenyl)-4-methyl- chemical structure, C13H14ClNOS, CAS 61292-00-0
Thiazole, 5-(chloromethyl)-2-(4-ethoxyphenyl)-4-methyl-
CAS 61292-00-0C13H14ClNOS
4-[(3-Chlorobenzo[b]thien-2-yl)methyl]morpholine chemical structure, C13H14ClNOS, CAS 132740-22-8
4-[(3-Chlorobenzo[b]thien-2-yl)methyl]morpholine
CAS 132740-22-8C13H14ClNOS
2-Amino-4-[(4-methylphenyl)sulfanyl]phenol--hydrogen chloride (1/1) chemical structure, C13H14ClNOS, CAS 87660-25-1
2-Amino-4-[(4-methylphenyl)sulfanyl]phenol--hydrogen chloride (1/1)
CAS 87660-25-1C13H14ClNOS
Thiazole, 4-(chloromethyl)-2-[(3-ethylphenoxy)methyl]- chemical structure, C13H14ClNOS, CAS 1082871-28-0
Thiazole, 4-(chloromethyl)-2-[(3-ethylphenoxy)methyl]-
CAS 1082871-28-0C13H14ClNOS
[2-[2-(4-Chlorophenyl)propan-2-yl]-1,3-thiazol-4-yl]methanol chemical structure, C13H14ClNOS, CAS 1478721-01-5
[2-[2-(4-Chlorophenyl)propan-2-yl]-1,3-thiazol-4-yl]methanol
CAS 1478721-01-5C13H14ClNOS

Frequently asked questions

What is the molar mass of C13H14ClNOS?

The molar mass of C13H14ClNOS is 267.77 g/mol, calculated from standard atomic weights for 13 carbon atoms, 14 hydrogen atoms, 1 chlorine atom, 1 nitrogen atom, 1 oxygen atom and 1 sulfur atom. The monoisotopic mass is 267.0485 Da.

How many compounds have the formula C13H14ClNOS?

CompoundList lists 40 compounds with the molecular formula C13H14ClNOS, including Alagebrium chloride, 4-Chlorobenzyl (3,5-dimethyl-4-isoxazolyl)methyl sulfide, N-Butyl-3-chloro-1-benzothiophene-2-carboxamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C13H14ClNOS?

C13H14ClNOS has a degree of unsaturation of 7. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.