CompoundList
Sign in
Molecular formula

C13H7ClF3NO

26 compounds have this formula on CompoundList.

Molar mass
285.65g/mol
Monoisotopic mass
285.0168Da
Atoms
26
Elements
6
Rings plus double bonds
9

The formula C13H7ClF3NO describes a molecule made of 13 carbon atoms, 7 hydrogen atoms, 1 chlorine atom, 3 fluorine atoms, 1 nitrogen atom and 1 oxygen atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1354.66%
    12.011 × 13 = 156.143 g/mol
  • H Hydrogen × 72.47%
    1.008 × 7 = 7.056 g/mol
  • Cl Chlorine × 112.41%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 319.95%
    18.998 × 3 = 56.994 g/mol
  • N Nitrogen × 14.90%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 15.60%
    15.999 × 1 = 15.999 g/mol
Look up another formula

Compounds with the formula C13H7ClF3NO

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 26 of 26 compounds

2-Benzoyl-3-chloro-5-(trifluoromethyl)pyridine chemical structure, C13H7ClF3NO, CAS 339010-42-3
2-Benzoyl-3-chloro-5-(trifluoromethyl)pyridine
CAS 339010-42-3C13H7ClF3NO
2-Chloro-5-(3-trifluoromethylbenzoyl)pyridine chemical structure, C13H7ClF3NO, CAS 1187168-00-8
2-Chloro-5-(3-trifluoromethylbenzoyl)pyridine
CAS 1187168-00-8C13H7ClF3NO
2-Chloro-5-(4-trifluoromethylbenzoyl)pyridine chemical structure, C13H7ClF3NO, CAS 875700-47-3
2-Chloro-5-(4-trifluoromethylbenzoyl)pyridine
CAS 875700-47-3C13H7ClF3NO
4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]benzaldehyde chemical structure, C13H7ClF3NO, CAS 952182-72-8
4-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]benzaldehyde
CAS 952182-72-8C13H7ClF3NO
4-(6-Chloro-4-trifluoromethyl-pyridin-2-yl)-benzaldehyde chemical structure, C13H7ClF3NO, CAS 1299607-45-6
4-(6-Chloro-4-trifluoromethyl-pyridin-2-yl)-benzaldehyde
CAS 1299607-45-6C13H7ClF3NO
2-Chloro-5-(2-trifluoromethylbenzoyl)pyridine chemical structure, C13H7ClF3NO, CAS 1187165-74-7
2-Chloro-5-(2-trifluoromethylbenzoyl)pyridine
CAS 1187165-74-7C13H7ClF3NO
4-(5-Trifluoromethyl-pyridin-2-yl)-benzoyl chloride chemical structure, C13H7ClF3NO, CAS 223128-27-6
4-(5-Trifluoromethyl-pyridin-2-yl)-benzoyl chloride
CAS 223128-27-6C13H7ClF3NO
(2-Chloro-4-pyridinyl)[3-(trifluoromethyl)phenyl]methanone chemical structure, C13H7ClF3NO, CAS 1514556-20-7
(2-Chloro-4-pyridinyl)[3-(trifluoromethyl)phenyl]methanone
CAS 1514556-20-7C13H7ClF3NO
2-Chloro-N-(2,3,4-trifluorophenyl)benzamide chemical structure, C13H7ClF3NO, CAS 950252-58-1
2-Chloro-N-(2,3,4-trifluorophenyl)benzamide
CAS 950252-58-1C13H7ClF3NO
Benzamide, 2,3,4-trifluoro-N-(4-chlorophenyl)- chemical structure, C13H7ClF3NO, CAS 948711-35-1
Benzamide, 2,3,4-trifluoro-N-(4-chlorophenyl)-
CAS 948711-35-1C13H7ClF3NO
4-(Pyridin-3-yl)-3-(trifluoromethyl)benzoyl chloride chemical structure, C13H7ClF3NO, CAS 1214352-01-8
4-(Pyridin-3-yl)-3-(trifluoromethyl)benzoyl chloride
CAS 1214352-01-8C13H7ClF3NO
4-(Pyridin-4-yl)-3-(trifluoromethyl)benzoyl chloride chemical structure, C13H7ClF3NO, CAS 1214336-95-4
4-(Pyridin-4-yl)-3-(trifluoromethyl)benzoyl chloride
CAS 1214336-95-4C13H7ClF3NO
2-Chloro-6-(4-(trifluoromethyl)phenyl)nicotinaldehyde chemical structure, C13H7ClF3NO, CAS 1013647-47-6
2-Chloro-6-(4-(trifluoromethyl)phenyl)nicotinaldehyde
CAS 1013647-47-6C13H7ClF3NO
2-Chloro-6-(3-(trifluoromethyl)phenyl)nicotinaldehyde chemical structure, C13H7ClF3NO, CAS 1013647-48-7
2-Chloro-6-(3-(trifluoromethyl)phenyl)nicotinaldehyde
CAS 1013647-48-7C13H7ClF3NO
2-Chloro-5-[2-(trifluoromethyl)phenyl]pyridine-4-carbaldehyde chemical structure, C13H7ClF3NO, CAS 1261801-70-0
2-Chloro-5-[2-(trifluoromethyl)phenyl]pyridine-4-carbaldehyde
CAS 1261801-70-0C13H7ClF3NO
(2-Chloro-5-(trifluoromethyl)phenyl)(pyridin-3-yl)methanone chemical structure, C13H7ClF3NO, CAS 1261486-41-2
(2-Chloro-5-(trifluoromethyl)phenyl)(pyridin-3-yl)methanone
CAS 1261486-41-2C13H7ClF3NO
[3-Chloro-2-(trifluoromethyl)phenyl](pyridin-3-yl)methanone chemical structure, C13H7ClF3NO, CAS 1261728-31-7
[3-Chloro-2-(trifluoromethyl)phenyl](pyridin-3-yl)methanone
CAS 1261728-31-7C13H7ClF3NO
2-Pyridinecarboxaldehyde, 3-chloro-5-[3-(trifluoromethyl)phenyl]- chemical structure, C13H7ClF3NO, CAS 1261869-26-4
2-Pyridinecarboxaldehyde, 3-chloro-5-[3-(trifluoromethyl)phenyl]-
CAS 1261869-26-4C13H7ClF3NO
5-Chloro-6-[2-(trifluoromethyl)phenyl]pyridine-2-carbaldehyde chemical structure, C13H7ClF3NO, CAS 1261845-16-2
5-Chloro-6-[2-(trifluoromethyl)phenyl]pyridine-2-carbaldehyde
CAS 1261845-16-2C13H7ClF3NO
2-(2-Chloro-5-(trifluoromethyl)benzoyl)pyridine chemical structure, C13H7ClF3NO, CAS 1694-62-8
2-(2-Chloro-5-(trifluoromethyl)benzoyl)pyridine
CAS 1694-62-8C13H7ClF3NO
4-[2-Chloro-5-(trifluoromethyl)pyridin-3-yl]benzaldehyde chemical structure, C13H7ClF3NO, CAS 2137659-47-1
4-[2-Chloro-5-(trifluoromethyl)pyridin-3-yl]benzaldehyde
CAS 2137659-47-1C13H7ClF3NO
(2-Chloro-5-(trifluoromethyl)phenyl)(pyridin-4-yl)methanone chemical structure, C13H7ClF3NO, CAS 1261843-35-9
(2-Chloro-5-(trifluoromethyl)phenyl)(pyridin-4-yl)methanone
CAS 1261843-35-9C13H7ClF3NO
N-(3-Chloro-4-fluorophenyl)-2,6-difluorobenzamide chemical structure, C13H7ClF3NO, CAS 1001992-55-7
N-(3-Chloro-4-fluorophenyl)-2,6-difluorobenzamide
CAS 1001992-55-7C13H7ClF3NO
2-(2-Chloro-3-(trifluoromethyl)benzoyl)pyridine chemical structure, C13H7ClF3NO, CAS 92960-96-8
2-(2-Chloro-3-(trifluoromethyl)benzoyl)pyridine
CAS 92960-96-8C13H7ClF3NO

Frequently asked questions

What is the molar mass of C13H7ClF3NO?

The molar mass of C13H7ClF3NO is 285.65 g/mol, calculated from standard atomic weights for 13 carbon atoms, 7 hydrogen atoms, 1 chlorine atom, 3 fluorine atoms, 1 nitrogen atom and 1 oxygen atom. The monoisotopic mass is 285.0168 Da.

How many compounds have the formula C13H7ClF3NO?

CompoundList lists 26 compounds with the molecular formula C13H7ClF3NO, including 2-Benzoyl-3-chloro-5-(trifluoromethyl)pyridine, 2-Chloro-5-(3-trifluoromethylbenzoyl)pyridine, 2-Chloro-5-(4-trifluoromethylbenzoyl)pyridine. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C13H7ClF3NO?

C13H7ClF3NO has a degree of unsaturation of 9. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.