C13H9ClN2O4
51 compounds have this formula on CompoundList.
- Molar mass
- 292.68g/mol
- Monoisotopic mass
- 292.0251Da
- Atoms
- 29
- Elements
- 5
- Rings plus double bonds
- 10
The formula C13H9ClN2O4 describes a molecule made of 13 carbon atoms, 9 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms and 4 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.
Elemental composition
- C Carbon × 1353.35%12.011 × 13 = 156.143 g/mol
- H Hydrogen × 93.10%1.008 × 9 = 9.072 g/mol
- Cl Chlorine × 112.11%35.45 × 1 = 35.450 g/mol
- N Nitrogen × 29.57%14.007 × 2 = 28.014 g/mol
- O Oxygen × 421.87%15.999 × 4 = 63.996 g/mol
Compounds with the formula C13H9ClN2O4
Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.
Showing 1 to 51 of 51 compounds
![3-Acetyl-5-(4-chlorophenyl)-3aH-pyrrolo[3,4-d]isoxazole-4,6(5H,6aH)-dione chemical structure, C13H9ClN2O4, CAS 454473-68-8](/s/KYYUJNMQJNPSNO-UHFFFAOYSA-N.svg)
- Benzamide, N-(5-chloro-2-hydroxy-4-nitrophenyl)-5099-06-9C13H9ClN2O4
- Carbamic acid, N-(4-chlorophenyl)-, 4-nitrophenyl ester3848-41-7C13H9ClN2O4
- 2-Chloro-N-(3-hydroxyphenyl)-5-nitrobenzamide313250-62-3C13H9ClN2O4
- (4-Nitrophenyl)methyl 2-chloropyridine-3-carboxylate437617-07-7C13H9ClN2O4
- 2-Nitrophenyl (4-chlorophenyl)carbamate304453-27-8C13H9ClN2O4
- 2-[(2-Chlorophenyl)amino]-3-nitrobenzoic Acid38120-54-6C13H9ClN2O4
- 5-(3-Carbamoyl-4-chlorophenyl)-2-hydroxynicotinic acid1261906-35-7C13H9ClN2O4
- 5-(3-Carbamoyl-4-chlorophenyl)-2-hydroxyisonicotinic acid1261912-96-2C13H9ClN2O4
- 5-(3-Carbamoyl-4-chlorophenyl)-6-hydroxynicotinic acid1261936-61-1C13H9ClN2O4
- N-p-(Chlorophenyl)-m-nitrobenzohydroxamic acid36016-30-5C13H9ClN2O4
- Benzoic acid, 2-[(4-chlorophenyl)amino]-5-nitro-61767-78-0C13H9ClN2O4
- 2-Anilino-6-chloro-3-nitrobenzoic acid55776-07-3C13H9ClN2O4
- 4-(3-Carbamoyl-4-chlorophenyl)-2-nitrophenol1261924-34-8C13H9ClN2O4
- 2-Amino-5-(3-carboxy-4-chlorophenyl)pyridine-4-carboxylic acid1261932-95-9C13H9ClN2O4
- 2-Amino-5-(3-carboxy-4-chlorophenyl)pyridine-3-carboxylic acid1261933-30-5C13H9ClN2O4
- 6-Amino-3-(3-carboxy-4-chlorophenyl)picolinic acid1261905-35-4C13H9ClN2O4
- Benzamide, 2-chloro-N-(2-hydroxy-4-nitrophenyl)-38880-98-7C13H9ClN2O4
- 6-(4-Carbamoylphenoxy)-5-chloropyridine-3-carboxylic acid1016770-90-3C13H9ClN2O4
- Methyl 2-chloro-5-(4-nitrophenyl)nicotinate908581-30-6C13H9ClN2O4
- 4-(5-Chloro-2-nitroanilino)benzoic acid860597-18-8C13H9ClN2O4
- 5-Chloro-2-[(3-hydroxypyridine-2-carbonyl)amino]benzoic acid1183772-39-5C13H9ClN2O4
- 5-Chloro-2-(4-nitroanilino)benzoic acid18626-95-4C13H9ClN2O4
- N-(2-Chloro-4-nitrophenyl)-4-hydroxybenzamide62639-24-1C13H9ClN2O4
- 2-((5-Chloro-2-nitrophenyl)amino)benzoic acid40385-05-5C13H9ClN2O4
- N-(4-Chloro-3-nitrophenyl)-2-hydroxybenzamide109598-78-9C13H9ClN2O4
- 5-[(2E)-3-(4-Chlorophenyl)prop-2-enoyl]-6-hydroxy-1,2,3,4-tetrahydropyrimidine-2,4-dione1072069-70-5C13H9ClN2O4
- 4-(1,3-Benzodioxol-5-yl)-5-chloro-2-nitroaniline1224841-08-0C13H9ClN2O4
Frequently asked questions
What is the molar mass of C13H9ClN2O4?
The molar mass of C13H9ClN2O4 is 292.68 g/mol, calculated from standard atomic weights for 13 carbon atoms, 9 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms and 4 oxygen atoms. The monoisotopic mass is 292.0251 Da.
How many compounds have the formula C13H9ClN2O4?
CompoundList lists 51 compounds with the molecular formula C13H9ClN2O4, including N-(2-Chloro-4-nitrophenyl)-2 hydroxybenzamide, 5-Chloro-2-hydroxy-N-(4-nitrophenyl)benzamide, (3-Nitrophenyl)methyl 2-chloropyridine-3-carboxylate. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.
What is the degree of unsaturation of C13H9ClN2O4?
C13H9ClN2O4 has a degree of unsaturation of 10. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.