CompoundList
Sign in
Molecular formula

C15H10ClFN4O2S

6 compounds have this formula on CompoundList.

Molar mass
364.78g/mol
Monoisotopic mass
364.0197Da
Atoms
34
Elements
7
Rings plus double bonds
12

The formula C15H10ClFN4O2S describes a molecule made of 15 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 4 nitrogen atoms, 2 oxygen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1549.39%
    12.011 × 15 = 180.165 g/mol
  • H Hydrogen × 102.76%
    1.008 × 10 = 10.080 g/mol
  • Cl Chlorine × 19.72%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 15.21%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 415.36%
    14.007 × 4 = 56.028 g/mol
  • O Oxygen × 28.77%
    15.999 × 2 = 31.998 g/mol
  • S Sulfur × 18.79%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C15H10ClFN4O2S

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 6 of 6 compounds

2-Chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoic acid chemical structure, C15H10ClFN4O2S, CAS 634166-41-9
2-Chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoic acid
CAS 634166-41-9C15H10ClFN4O2S
N-(3-Chloro-4-fluorophenyl)-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide chemical structure, C15H10ClFN4O2S, CAS 905502-60-5
N-(3-Chloro-4-fluorophenyl)-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide
CAS 905502-60-5C15H10ClFN4O2S
N-(3-Chloro-4-fluorophenyl)-2-{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide chemical structure, C15H10ClFN4O2S, CAS 905499-55-0
N-(3-Chloro-4-fluorophenyl)-2-{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide
CAS 905499-55-0C15H10ClFN4O2S
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide chemical structure, C15H10ClFN4O2S, CAS 896324-86-0
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(2-fluorophenyl)acetamide
CAS 896324-86-0C15H10ClFN4O2S
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(3-fluorophenyl)acetamide chemical structure, C15H10ClFN4O2S, CAS 896324-92-8
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(3-fluorophenyl)acetamide
CAS 896324-92-8C15H10ClFN4O2S
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(4-fluorophenyl)acetamide chemical structure, C15H10ClFN4O2S, CAS 896324-99-5
2-(7-Chloro-4-oxopyrido[1,2-a][1,3,5]triazin-2-yl)sulfanyl-N-(4-fluorophenyl)acetamide
CAS 896324-99-5C15H10ClFN4O2S

Frequently asked questions

What is the molar mass of C15H10ClFN4O2S?

The molar mass of C15H10ClFN4O2S is 364.78 g/mol, calculated from standard atomic weights for 15 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 4 nitrogen atoms, 2 oxygen atoms and 1 sulfur atom. The monoisotopic mass is 364.0197 Da.

How many compounds have the formula C15H10ClFN4O2S?

CompoundList lists 6 compounds with the molecular formula C15H10ClFN4O2S, including 2-Chloro-5-[5-[(2-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzoic acid, N-(3-Chloro-4-fluorophenyl)-2-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide, N-(3-Chloro-4-fluorophenyl)-2-{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C15H10ClFN4O2S?

C15H10ClFN4O2S has a degree of unsaturation of 12. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.