CompoundList
Sign in
Molecular formula

C15H13ClFNO3

19 compounds have this formula on CompoundList.

Molar mass
309.72g/mol
Monoisotopic mass
309.0568Da
Atoms
34
Elements
6
Rings plus double bonds
9

The formula C15H13ClFNO3 describes a molecule made of 15 carbon atoms, 13 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom and 3 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1558.17%
    12.011 × 15 = 180.165 g/mol
  • H Hydrogen × 134.23%
    1.008 × 13 = 13.104 g/mol
  • Cl Chlorine × 111.45%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 16.13%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 14.52%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 315.50%
    15.999 × 3 = 47.997 g/mol
Look up another formula

Compounds with the formula C15H13ClFNO3

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 19 of 19 compounds

N-(5-Chloro-2,4-dimethoxyphenyl)-2-fluorobenzamide chemical structure, C15H13ClFNO3, CAS 692771-68-9
N-(5-Chloro-2,4-dimethoxyphenyl)-2-fluorobenzamide
CAS 692771-68-9C15H13ClFNO3
2-[2-Chloro-4-(hydroxymethyl)phenoxy]-N-(4-fluorophenyl)acetamide chemical structure, C15H13ClFNO3, CAS 693815-65-5
2-[2-Chloro-4-(hydroxymethyl)phenoxy]-N-(4-fluorophenyl)acetamide
CAS 693815-65-5C15H13ClFNO3
(2-Chloro-6-fluorophenyl)methyl 2-ethoxypyridine-3-carboxylate chemical structure, C15H13ClFNO3, CAS 474388-44-8
(2-Chloro-6-fluorophenyl)methyl 2-ethoxypyridine-3-carboxylate
CAS 474388-44-8C15H13ClFNO3
N-(4-Chloro-2,5-dimethoxyphenyl)-2-fluorobenzamide chemical structure, C15H13ClFNO3, CAS 326902-10-7
N-(4-Chloro-2,5-dimethoxyphenyl)-2-fluorobenzamide
CAS 326902-10-7C15H13ClFNO3
N-(3-Chloro-4-fluorophenyl)-3,4-dimethoxybenzamide chemical structure, C15H13ClFNO3, CAS 333347-77-6
N-(3-Chloro-4-fluorophenyl)-3,4-dimethoxybenzamide
CAS 333347-77-6C15H13ClFNO3
N-(3-Chloro-4-fluorophenyl)-3,5-dimethoxybenzamide chemical structure, C15H13ClFNO3, CAS 346724-43-4
N-(3-Chloro-4-fluorophenyl)-3,5-dimethoxybenzamide
CAS 346724-43-4C15H13ClFNO3
Ethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate chemical structure, C15H13ClFNO3, CAS 86483-54-7
Ethyl 7-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate
CAS 86483-54-7C15H13ClFNO3
N-(3-Chloro-4-fluorophenyl)-2-(4-methoxyphenoxy)acetamide chemical structure, C15H13ClFNO3, CAS 303971-55-3
N-(3-Chloro-4-fluorophenyl)-2-(4-methoxyphenoxy)acetamide
CAS 303971-55-3C15H13ClFNO3
4-[(2-Chloro-4-fluorobenzyl)oxy]-3-methoxybenzamide chemical structure, C15H13ClFNO3, CAS 1706463-09-3
4-[(2-Chloro-4-fluorobenzyl)oxy]-3-methoxybenzamide
CAS 1706463-09-3C15H13ClFNO3
4'-Hydroxy-lumiracoxib chemical structure, C15H13ClFNO3, CAS 220991-37-7
4'-Hydroxy-lumiracoxib
CAS 220991-37-7C15H13ClFNO3
5-Hydroxymethyl lumiracoxib chemical structure, C15H13ClFNO3, CAS 697287-16-4
5-Hydroxymethyl lumiracoxib
CAS 697287-16-4C15H13ClFNO3
N-(4-Chloro-2-fluoro-5-hydroxymethylphenyl)-3,4,5,6-tetrahydrophthalimide chemical structure, C15H13ClFNO3, CAS 101329-83-3
N-(4-Chloro-2-fluoro-5-hydroxymethylphenyl)-3,4,5,6-tetrahydrophthalimide
CAS 101329-83-3C15H13ClFNO3
(Z)-({3-[(2-Chloro-6-fluorophenyl)methyl]-2,4-dihydroxyphenyl}methylidene)(methyl)oxidoazanium chemical structure, C15H13ClFNO3, CAS 478257-95-3
(Z)-({3-[(2-Chloro-6-fluorophenyl)methyl]-2,4-dihydroxyphenyl}methylidene)(methyl)oxidoazanium
CAS 478257-95-3C15H13ClFNO3
1H-Isoindole-1,3(2H)-dione, 2-(4-chloro-2-fluoro-5-methoxyphenyl)-4,5,6,7-tetrahydro- chemical structure, C15H13ClFNO3, CAS 84478-44-4
1H-Isoindole-1,3(2H)-dione, 2-(4-chloro-2-fluoro-5-methoxyphenyl)-4,5,6,7-tetrahydro-
CAS 84478-44-4C15H13ClFNO3
Methyl 2-chloro-6-(2-fluoro-3-methoxyphenyl)-4-methyl-3-pyridinecarboxylate chemical structure, C15H13ClFNO3, CAS 1013648-05-9
Methyl 2-chloro-6-(2-fluoro-3-methoxyphenyl)-4-methyl-3-pyridinecarboxylate
CAS 1013648-05-9C15H13ClFNO3
3-Chloro-N-(3-fluorophenyl)-4,5-dimethoxybenzamide chemical structure, C15H13ClFNO3, CAS 838879-61-1
3-Chloro-N-(3-fluorophenyl)-4,5-dimethoxybenzamide
CAS 838879-61-1C15H13ClFNO3
Ethyl 2-(4-amino-3-chlorophenoxy)-4-fluorobenzoate chemical structure, C15H13ClFNO3, CAS 1228943-38-1
Ethyl 2-(4-amino-3-chlorophenoxy)-4-fluorobenzoate
CAS 1228943-38-1C15H13ClFNO3
Benzyl N-[3-chloro-6-fluoro-2-(hydroxymethyl)phenyl]carbamate chemical structure, C15H13ClFNO3, CAS 2680836-46-6
Benzyl N-[3-chloro-6-fluoro-2-(hydroxymethyl)phenyl]carbamate
CAS 2680836-46-6C15H13ClFNO3
Benzyl N-(3-chloro-6-fluoro-2-hydroxy-5-methylphenyl)carbamate chemical structure, C15H13ClFNO3, CAS 2763997-97-1
Benzyl N-(3-chloro-6-fluoro-2-hydroxy-5-methylphenyl)carbamate
CAS 2763997-97-1C15H13ClFNO3

Frequently asked questions

What is the molar mass of C15H13ClFNO3?

The molar mass of C15H13ClFNO3 is 309.72 g/mol, calculated from standard atomic weights for 15 carbon atoms, 13 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom and 3 oxygen atoms. The monoisotopic mass is 309.0568 Da.

How many compounds have the formula C15H13ClFNO3?

CompoundList lists 19 compounds with the molecular formula C15H13ClFNO3, including N-(5-Chloro-2,4-dimethoxyphenyl)-2-fluorobenzamide, 2-[2-Chloro-4-(hydroxymethyl)phenoxy]-N-(4-fluorophenyl)acetamide, (2-Chloro-6-fluorophenyl)methyl 2-ethoxypyridine-3-carboxylate. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C15H13ClFNO3?

C15H13ClFNO3 has a degree of unsaturation of 9. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.