CompoundList
Sign in
Molecular formula

C15H15ClFNO2S

16 compounds have this formula on CompoundList.

Molar mass
327.80g/mol
Monoisotopic mass
327.0496Da
Atoms
36
Elements
7
Rings plus double bonds
8

The formula C15H15ClFNO2S describes a molecule made of 15 carbon atoms, 15 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom, 2 oxygen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1554.96%
    12.011 × 15 = 180.165 g/mol
  • H Hydrogen × 154.61%
    1.008 × 15 = 15.120 g/mol
  • Cl Chlorine × 110.81%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 15.80%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 14.27%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 29.76%
    15.999 × 2 = 31.998 g/mol
  • S Sulfur × 19.78%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C15H15ClFNO2S

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 16 of 16 compounds

1-(2-Chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]methanesulfonamide chemical structure, C15H15ClFNO2S, CAS 838881-34-8
1-(2-Chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]methanesulfonamide
CAS 838881-34-8C15H15ClFNO2S
(3-Chloro-4-fluoro-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone chemical structure, C15H15ClFNO2S, CAS 588674-15-1
(3-Chloro-4-fluoro-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone
CAS 588674-15-1C15H15ClFNO2S
2,6-Dimethylmorpholin-4-yl 3-chloro-6-fluorobenzo[b]thiophen-2-yl ketone chemical structure, C15H15ClFNO2S, CAS 1015849-29-2
2,6-Dimethylmorpholin-4-yl 3-chloro-6-fluorobenzo[b]thiophen-2-yl ketone
CAS 1015849-29-2C15H15ClFNO2S
N-(2-Chloro-6-fluorobenzyl)-N-(2-methylphenyl)methanesulfonamide chemical structure, C15H15ClFNO2S, CAS 714207-15-5
N-(2-Chloro-6-fluorobenzyl)-N-(2-methylphenyl)methanesulfonamide
CAS 714207-15-5C15H15ClFNO2S
2-(2-Chloro-6-fluorophenyl)-N-[2-methoxy-2-(thiophen-3-yl)ethyl]acetamide chemical structure, C15H15ClFNO2S, CAS 1796962-30-5
2-(2-Chloro-6-fluorophenyl)-N-[2-methoxy-2-(thiophen-3-yl)ethyl]acetamide
CAS 1796962-30-5C15H15ClFNO2S
N-(3-Chloro-4-fluorophenyl)-2,4,6-trimethylbenzenesulfonamide chemical structure, C15H15ClFNO2S, CAS 330468-58-1
N-(3-Chloro-4-fluorophenyl)-2,4,6-trimethylbenzenesulfonamide
CAS 330468-58-1C15H15ClFNO2S
3-Chloro-6-fluoro-N-(4-hydroxycyclohexyl)benzo[b]thiophene-2-carboxamide chemical structure, C15H15ClFNO2S, CAS 1090385-95-7
3-Chloro-6-fluoro-N-(4-hydroxycyclohexyl)benzo[b]thiophene-2-carboxamide
CAS 1090385-95-7C15H15ClFNO2S
2-Chloro-6-fluoro-N-(2-methoxyethyl)-N-(thiophen-3-ylmethyl)benzamide chemical structure, C15H15ClFNO2S, CAS 1219906-57-6
2-Chloro-6-fluoro-N-(2-methoxyethyl)-N-(thiophen-3-ylmethyl)benzamide
CAS 1219906-57-6C15H15ClFNO2S
1-(2-Chloro-6-fluorophenyl)-N-(3-methylbenzyl)methanesulfonamide chemical structure, C15H15ClFNO2S, CAS 928924-64-5
1-(2-Chloro-6-fluorophenyl)-N-(3-methylbenzyl)methanesulfonamide
CAS 928924-64-5C15H15ClFNO2S
5-Chloro-N-[2-(2-fluorophenyl)-2-methoxypropyl]thiophene-2-carboxamide chemical structure, C15H15ClFNO2S, CAS 1797183-99-3
5-Chloro-N-[2-(2-fluorophenyl)-2-methoxypropyl]thiophene-2-carboxamide
CAS 1797183-99-3C15H15ClFNO2S
2-(2-Chloro-6-fluorophenyl)-N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]acetamide chemical structure, C15H15ClFNO2S, CAS 1795487-74-9
2-(2-Chloro-6-fluorophenyl)-N-[2-hydroxy-2-(3-methylthiophen-2-yl)ethyl]acetamide
CAS 1795487-74-9C15H15ClFNO2S
2-Chloro-4-fluoro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]benzamide chemical structure, C15H15ClFNO2S, CAS 1705169-39-6
2-Chloro-4-fluoro-N-[2-methoxy-2-(5-methylthiophen-2-yl)ethyl]benzamide
CAS 1705169-39-6C15H15ClFNO2S
N-[2-(5-Chlorothiophen-2-yl)-2-methoxyethyl]-2-(4-fluorophenyl)acetamide chemical structure, C15H15ClFNO2S, CAS 2034411-97-5
N-[2-(5-Chlorothiophen-2-yl)-2-methoxyethyl]-2-(4-fluorophenyl)acetamide
CAS 2034411-97-5C15H15ClFNO2S
2-Chloro-6-fluoro-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}benzamide chemical structure, C15H15ClFNO2S, CAS 2097867-34-8
2-Chloro-6-fluoro-N-{2-hydroxy-2-[(thiophen-3-yl)methyl]propyl}benzamide
CAS 2097867-34-8C15H15ClFNO2S
2-Chloro-6-fluoro-N-{2-[5-(1-hydroxyethyl)thiophen-2-yl]ethyl}benzamide chemical structure, C15H15ClFNO2S, CAS 2097935-37-8
2-Chloro-6-fluoro-N-{2-[5-(1-hydroxyethyl)thiophen-2-yl]ethyl}benzamide
CAS 2097935-37-8C15H15ClFNO2S
1-(2-Chloro-6-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide chemical structure, C15H15ClFNO2S, CAS 950238-01-4
1-(2-Chloro-6-fluorophenyl)-N-(2-phenylethyl)methanesulfonamide
CAS 950238-01-4C15H15ClFNO2S

Frequently asked questions

What is the molar mass of C15H15ClFNO2S?

The molar mass of C15H15ClFNO2S is 327.80 g/mol, calculated from standard atomic weights for 15 carbon atoms, 15 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom, 2 oxygen atoms and 1 sulfur atom. The monoisotopic mass is 327.0496 Da.

How many compounds have the formula C15H15ClFNO2S?

CompoundList lists 16 compounds with the molecular formula C15H15ClFNO2S, including 1-(2-Chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]methanesulfonamide, (3-Chloro-4-fluoro-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone, 2,6-Dimethylmorpholin-4-yl 3-chloro-6-fluorobenzo[b]thiophen-2-yl ketone. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C15H15ClFNO2S?

C15H15ClFNO2S has a degree of unsaturation of 8. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.