CompoundList
Sign in
Molecular formula

C20H20ClFN4OS

6 compounds have this formula on CompoundList.

Molar mass
418.92g/mol
Monoisotopic mass
418.1030Da
Atoms
48
Elements
7
Rings plus double bonds
12

The formula C20H20ClFN4OS describes a molecule made of 20 carbon atoms, 20 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 4 nitrogen atoms, 1 oxygen atom and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 2057.34%
    12.011 × 20 = 240.220 g/mol
  • H Hydrogen × 204.81%
    1.008 × 20 = 20.160 g/mol
  • Cl Chlorine × 18.46%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 14.54%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 413.37%
    14.007 × 4 = 56.028 g/mol
  • O Oxygen × 13.82%
    15.999 × 1 = 15.999 g/mol
  • S Sulfur × 17.65%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C20H20ClFN4OS

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 6 of 6 compounds

N-(2-Chloro-4-fluorophenyl)-1-{5,6-dimethylthieno[2,3-D]pyrimidin-4-YL}piperidine-4-carboxamide chemical structure, C20H20ClFN4OS, CAS 1090916-04-3
N-(2-Chloro-4-fluorophenyl)-1-{5,6-dimethylthieno[2,3-D]pyrimidin-4-YL}piperidine-4-carboxamide
CAS 1090916-04-3C20H20ClFN4OS
(2-Fluorophenyl)(4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)piperazin-1-yl)methanone hydrochloride chemical structure, C20H20ClFN4OS, CAS 1351590-14-1
(2-Fluorophenyl)(4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)piperazin-1-yl)methanone hydrochloride
CAS 1351590-14-1C20H20ClFN4OS
2-Chloro-6-fluoro-N-((5-(propylthio)-4-(m-tolyl)-4H-1,2,4-triazol-3-yl)methyl)benzamide chemical structure, C20H20ClFN4OS, CAS 391933-49-6
2-Chloro-6-fluoro-N-((5-(propylthio)-4-(m-tolyl)-4H-1,2,4-triazol-3-yl)methyl)benzamide
CAS 391933-49-6C20H20ClFN4OS
N-[[5-Butylsulfanyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl]-2-fluorobenzamide chemical structure, C20H20ClFN4OS, CAS 391898-28-5
N-[[5-Butylsulfanyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl]-2-fluorobenzamide
CAS 391898-28-5C20H20ClFN4OS
N-[[5-Butylsulfanyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide chemical structure, C20H20ClFN4OS, CAS 391914-58-2
N-[[5-Butylsulfanyl-4-(3-chlorophenyl)-1,2,4-triazol-3-yl]methyl]-3-fluorobenzamide
CAS 391914-58-2C20H20ClFN4OS
4-Cyano-N-(3-(dimethylamino)propyl)-N-(4-fluorobenzo[d]thiazol-2-yl)benzamide hydrochloride chemical structure, C20H20ClFN4OS, CAS 1215346-65-8
4-Cyano-N-(3-(dimethylamino)propyl)-N-(4-fluorobenzo[d]thiazol-2-yl)benzamide hydrochloride
CAS 1215346-65-8C20H20ClFN4OS

Frequently asked questions

What is the molar mass of C20H20ClFN4OS?

The molar mass of C20H20ClFN4OS is 418.92 g/mol, calculated from standard atomic weights for 20 carbon atoms, 20 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 4 nitrogen atoms, 1 oxygen atom and 1 sulfur atom. The monoisotopic mass is 418.1030 Da.

How many compounds have the formula C20H20ClFN4OS?

CompoundList lists 6 compounds with the molecular formula C20H20ClFN4OS, including N-(2-Chloro-4-fluorophenyl)-1-{5,6-dimethylthieno[2,3-D]pyrimidin-4-YL}piperidine-4-carboxamide, (2-Fluorophenyl)(4-(5-phenyl-6H-1,3,4-thiadiazin-2-yl)piperazin-1-yl)methanone hydrochloride, 2-Chloro-6-fluoro-N-((5-(propylthio)-4-(m-tolyl)-4H-1,2,4-triazol-3-yl)methyl)benzamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C20H20ClFN4OS?

C20H20ClFN4OS has a degree of unsaturation of 12. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.