CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 18 atoms

21 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
18
Chemicals
21
With full pages
10
Scaffold SMILES

O=c1oc2cccc3c(=O)oc4cccc1c4c23

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=c1oc2cccc3c(=O)oc4cccc1c4c23

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 21 of 21 chemicals

2,7-Dinitro-5,10-dioxo-4,9-dioxapyrene chemical structure, C14H4N2O8, CAS 62925-34-2
2,7-Dinitro-5,10-dioxo-4,9-dioxapyrene
CAS 62925-34-2C14H4N2O8
Thaspine hydrochloride chemical structure, C20H20ClNO6, CAS 35115-50-5
Thaspine hydrochloride
CAS 35115-50-5C20H20ClNO6
Taspine chemical structure, C20H19NO6, CAS 602-07-3
Taspine
CAS 602-07-3C20H19NO6
Thaspine, acetate chemical structure, C22H23NO8, CAS 74578-01-1
Thaspine, acetate
CAS 74578-01-1C22H23NO8
Ellagic acid chemical structure, C14H6O8, CAS 476-66-4
Ellagic acid
CAS 476-66-4C14H6O8
3,3',4-Tri-O-methylellagic acid chemical structure, C17H12O8, CAS 1617-49-8
3,3',4-Tri-O-methylellagic acid
CAS 1617-49-8C17H12O8
3,4-di-O-Methylellagic acid chemical structure, C16H10O8, CAS 52600-48-3
3,4-di-O-Methylellagic acid
CAS 52600-48-3C16H10O8
Flavellagic acid chemical structure, C14H6O9, CAS 741-67-3
Flavellagic acid
CAS 741-67-3C14H6O9
3-O-Decylellagic acid chemical structure, C24H26O8, CAS 110007-19-7
3-O-Decylellagic acid
CAS 110007-19-7C24H26O8
3,3'-di-O-Methylellagic acid chemical structure, C16H10O8, CAS 2239-88-5
3,3'-di-O-Methylellagic acid
CAS 2239-88-5C16H10O8
2,8-Dihydroxy-3,7-dimethoxy(1)benzopyrano(5,4,3-cde)(1)benzopyran-5,10-dione chemical structure, C16H10O8, CAS 57499-59-9
2,8-Dihydroxy-3,7-dimethoxy(1)benzopyrano(5,4,3-cde)(1)benzopyran-5,10-dione
CAS 57499-59-9C16H10O8
Agn-PC-0N8V9K chemical structure, C19H14O6, CAS 216374-59-3
Agn-PC-0N8V9K
CAS 216374-59-3C19H14O6
5,10-Dihydro-3,8-dimethoxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-acetaldehyde chemical structure, C18H12O7, CAS 216374-60-6
5,10-Dihydro-3,8-dimethoxy-5,10-dioxo[1]benzopyrano[5,4,3-cde][1]benzopyran-1-acetaldehyde
CAS 216374-60-6C18H12O7
4,4'-Di-O-methylellagic acid chemical structure, C16H10O8, CAS 3374-77-4
4,4'-Di-O-methylellagic acid
CAS 3374-77-4C16H10O8
3,3',4'-Tri-O-methylellagic acid chemical structure, C17H12O8, CAS 5145-53-9
3,3',4'-Tri-O-methylellagic acid
CAS 5145-53-9C17H12O8
3-O-Methylellagic acid chemical structure, C15H8O8, CAS 51768-38-8
3-O-Methylellagic acid
CAS 51768-38-8C15H8O8
3,3',4-Tri-O-methylflavellagic acid chemical structure, C17H12O9, CAS 13756-49-5
3,3',4-Tri-O-methylflavellagic acid
CAS 13756-49-5C17H12O9
Ellagic acid tetraacetate chemical structure, C22H14O12, CAS 4274-26-4
Ellagic acid tetraacetate
CAS 4274-26-4C22H14O12
Ellagic acid hydrate chemical structure, C14H8O9, CAS 314041-08-2
Ellagic acid hydrate
CAS 314041-08-2C14H8O9
Ellagic acid dihydrate chemical structure, C14H10O10, CAS 133039-73-3
Ellagic acid dihydrate
CAS 133039-73-3C14H10O10
5,6,7,12,13,14-Hexamethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione chemical structure, C20H18O10, CAS 72463-75-3
5,6,7,12,13,14-Hexamethoxy-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaene-3,10-dione
CAS 72463-75-3C20H18O10