CompoundList
Sign in
Murcko scaffold

Ring system with 2 rings and 20 atoms

29 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
20
Chemicals
29
With full pages
11
Scaffold SMILES

O=C1CCCOC(=O)C(NC(=O)c2ccccc2)CO1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C1CCCOC(=O)C(NC(=O)c2ccccc2)CO1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 29 of 29 chemicals

Animicin A chemical structure, C28H40N2O9, CAS 642-15-9
Animicin A
CAS 642-15-9C28H40N2O9
Antimycin A chemical structure, C28H40N2O9, CAS 1397-94-0
Antimycin A
CAS 1397-94-0C28H40N2O9
Urauchimycin B chemical structure, C22H30N2O8, CAS 148163-08-0
Urauchimycin B
CAS 148163-08-0C22H30N2O8
Deisovalerylblastmycin chemical structure, C21H28N2O8, CAS 60504-95-2
Deisovalerylblastmycin
CAS 60504-95-2C21H28N2O8
Butanoic acid, 2(or 3)-methyl-, (2R,3S,6S,7R,8R)-3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-butyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester chemical structure, C26H36N2O9, CAS 522-70-3
Butanoic acid, 2(or 3)-methyl-, (2R,3S,6S,7R,8R)-3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-butyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester
CAS 522-70-3C26H36N2O9
O-Methyl antimycin A1 chemical structure, C58H84N4O18, CAS 118890-38-3
O-Methyl antimycin A1
CAS 118890-38-3C58H84N4O18
Antimycin A2a chemical structure, C27H38N2O9, CAS 28068-15-7
Antimycin A2a
CAS 28068-15-7C27H38N2O9
Antimycin A2 chemical structure, C27H38N2O9, CAS 27220-57-1
Antimycin A2
CAS 27220-57-1C27H38N2O9
Antimycin A4 chemical structure, C25H34N2O9, CAS 27220-59-3
Antimycin A4
CAS 27220-59-3C25H34N2O9
Antimycin A3 methyl ether FH-25 chemical structure, C54H76N4O18, CAS 118890-42-9
Antimycin A3 methyl ether FH-25
CAS 118890-42-9C54H76N4O18
Kitamycin A chemical structure, C23H32N2O8, CAS 225939-28-6
Kitamycin A
CAS 225939-28-6C23H32N2O8
Antimycin A7b chemical structure, C26H36N2O9, CAS 197791-89-2
Antimycin A7b
CAS 197791-89-2C26H36N2O9
Antimycin A7a chemical structure, C26H36N2O9, CAS 197791-88-1
Antimycin A7a
CAS 197791-88-1C26H36N2O9
Antimycin A2b chemical structure, C27H38N2O9, CAS 117552-77-9
Antimycin A2b
CAS 117552-77-9C27H38N2O9
Antimycin A8b chemical structure, C27H38N2O9, CAS 197791-91-6
Antimycin A8b
CAS 197791-91-6C27H38N2O9
Antimycin A4a chemical structure, C25H34N2O9, CAS 28068-12-4
Antimycin A4a
CAS 28068-12-4C25H34N2O9
Urauchimycin A chemical structure, C22H30N2O8, CAS 148163-07-9
Urauchimycin A
CAS 148163-07-9C22H30N2O8
Kitamycin B chemical structure, C23H32N2O8, CAS 225939-29-7
Kitamycin B
CAS 225939-29-7C23H32N2O8
Antimycin A4b chemical structure, C25H34N2O9, CAS 117603-45-9
Antimycin A4b
CAS 117603-45-9C25H34N2O9
Antimycin A1a chemical structure, C28H40N2O9, CAS 28068-16-8
Antimycin A1a
CAS 28068-16-8C28H40N2O9
(3-{[7-Butyl-4,9-dimethyl-8-(4-methyl-2-oxopentyl)-2,6-dioxo-1,5-dioxonan-3-yl](methyl)carbamoyl}-2-hydroxyphenyl)methanimidic acid chemical structure, C28H40N2O8, CAS 1362-89-6
(3-{[7-Butyl-4,9-dimethyl-8-(4-methyl-2-oxopentyl)-2,6-dioxo-1,5-dioxonan-3-yl](methyl)carbamoyl}-2-hydroxyphenyl)methanimidic acid
CAS 1362-89-6C28H40N2O8
O-Methyl antimycin A2 chemical structure, C56H80N4O18, CAS 118890-40-7
O-Methyl antimycin A2
CAS 118890-40-7C56H80N4O18
(+)-Antimycin A3a chemical structure, C26H36N2O9, CAS 28068-14-6
(+)-Antimycin A3a
CAS 28068-14-6C26H36N2O9
Antimycin A5b chemical structure, C24H32N2O9, CAS 27220-60-6
Antimycin A5b
CAS 27220-60-6C24H32N2O9