CompoundList
Sign in
Molecular formula

C11H15BrClO3PS

5 compounds have this formula on CompoundList.

Molar mass
373.63g/mol
Monoisotopic mass
378.9791Da
Atoms
33
Elements
7
Rings plus double bonds
4

The formula C11H15BrClO3PS describes a molecule made of 11 carbon atoms, 15 hydrogen atoms, 1 bromine atom, 1 chlorine atom, 3 oxygen atoms, 1 phosphorus atom and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1135.36%
    12.011 × 11 = 132.121 g/mol
  • H Hydrogen × 154.05%
    1.008 × 15 = 15.120 g/mol
  • Br Bromine × 121.39%
    79.904 × 1 = 79.904 g/mol
  • Cl Chlorine × 19.49%
    35.45 × 1 = 35.450 g/mol
  • O Oxygen × 312.85%
    15.999 × 3 = 47.997 g/mol
  • P Phosphorus × 18.29%
    30.974 × 1 = 30.974 g/mol
  • S Sulfur × 18.58%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C11H15BrClO3PS

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 5 of 5 compounds

Profenofos chemical structure, C11H15BrClO3PS, CAS 41198-08-7
Profenofos
CAS 41198-08-7C11H15BrClO3PS
O-(4-Bromo-2-chlorophenyl) O-ethyl S-(~2~H_7_)propyl phosphorothioate chemical structure, C11H15BrClO3PS, CAS 1346603-72-2
O-(4-Bromo-2-chlorophenyl) O-ethyl S-(~2~H_7_)propyl phosphorothioate
CAS 1346603-72-2C11H15BrClO3PS
Profenofos-D3 chemical structure, C11H15BrClO3PS, CAS 2140327-42-8
Profenofos-D3
CAS 2140327-42-8C11H15BrClO3PS
(S)-Profenofos chemical structure, C11H15BrClO3PS, CAS 81123-19-5
(S)-Profenofos
CAS 81123-19-5C11H15BrClO3PS
(R)-Profenofos chemical structure, C11H15BrClO3PS, CAS 81116-98-5
(R)-Profenofos
CAS 81116-98-5C11H15BrClO3PS

Frequently asked questions

What is the molar mass of C11H15BrClO3PS?

The molar mass of C11H15BrClO3PS is 373.63 g/mol, calculated from standard atomic weights for 11 carbon atoms, 15 hydrogen atoms, 1 bromine atom, 1 chlorine atom, 3 oxygen atoms, 1 phosphorus atom and 1 sulfur atom. The monoisotopic mass is 378.9791 Da.

How many compounds have the formula C11H15BrClO3PS?

CompoundList lists 5 compounds with the molecular formula C11H15BrClO3PS, including Profenofos, O-(4-Bromo-2-chlorophenyl) O-ethyl S-(~2~H_7_)propyl phosphorothioate, Profenofos-D3. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C11H15BrClO3PS?

C11H15BrClO3PS has a degree of unsaturation of 4. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.