CompoundList
Sign in
Molecular formula

C14H9ClN2O2S

30 compounds have this formula on CompoundList.

Molar mass
304.75g/mol
Monoisotopic mass
304.0073Da
Atoms
29
Elements
6
Rings plus double bonds
11

The formula C14H9ClN2O2S describes a molecule made of 14 carbon atoms, 9 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms, 2 oxygen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1455.18%
    12.011 × 14 = 168.154 g/mol
  • H Hydrogen × 92.98%
    1.008 × 9 = 9.072 g/mol
  • Cl Chlorine × 111.63%
    35.45 × 1 = 35.450 g/mol
  • N Nitrogen × 29.19%
    14.007 × 2 = 28.014 g/mol
  • O Oxygen × 210.50%
    15.999 × 2 = 31.998 g/mol
  • S Sulfur × 110.52%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C14H9ClN2O2S

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 30 of 30 compounds

1-(3-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid chemical structure, C14H9ClN2O2S, CAS 618382-83-5
1-(3-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid
CAS 618382-83-5C14H9ClN2O2S
2-(4-Chlorophenyl)sulfonylquinoxaline chemical structure, C14H9ClN2O2S, CAS 338394-53-9
2-(4-Chlorophenyl)sulfonylquinoxaline
CAS 338394-53-9C14H9ClN2O2S
5-(4-Chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide chemical structure, C14H9ClN2O2S, CAS 213911-09-2
5-(4-Chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide
CAS 213911-09-2C14H9ClN2O2S
5-(2-Chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide chemical structure, C14H9ClN2O2S, CAS 199459-00-2
5-(2-Chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide
CAS 199459-00-2C14H9ClN2O2S
(5Z)-4-(4-Chloroanilino)-5-(furan-2-ylmethylidene)-1,3-thiazol-2-one chemical structure, C14H9ClN2O2S, CAS 1164518-97-1
(5Z)-4-(4-Chloroanilino)-5-(furan-2-ylmethylidene)-1,3-thiazol-2-one
CAS 1164518-97-1C14H9ClN2O2S
4-(6-Amino-5-chloro-benzothiazol-2-yl)-benzoic acid chemical structure, C14H9ClN2O2S, CAS 331424-62-5
4-(6-Amino-5-chloro-benzothiazol-2-yl)-benzoic acid
CAS 331424-62-5C14H9ClN2O2S
1-(4-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid chemical structure, C14H9ClN2O2S, CAS 618382-79-9
1-(4-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid
CAS 618382-79-9C14H9ClN2O2S
1-(2-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid chemical structure, C14H9ClN2O2S, CAS 618382-88-0
1-(2-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid
CAS 618382-88-0C14H9ClN2O2S
4-[(4-Chlorophenyl)thio]-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione chemical structure, C14H9ClN2O2S, CAS 227459-19-0
4-[(4-Chlorophenyl)thio]-6-methyl-1H-pyrrolo[3,4-c]pyridine-1,3(2H)-dione
CAS 227459-19-0C14H9ClN2O2S
5-(4-Chlorophenyl)-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid chemical structure, C14H9ClN2O2S, CAS 1623080-69-2
5-(4-Chlorophenyl)-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxylic acid
CAS 1623080-69-2C14H9ClN2O2S
N-(3-Chlorophenyl)-2-nitro-1-benzothiophen-3-amine chemical structure, C14H9ClN2O2S, CAS 149338-08-9
N-(3-Chlorophenyl)-2-nitro-1-benzothiophen-3-amine
CAS 149338-08-9C14H9ClN2O2S
Benzo(b)thiophen-3-amine, N-(4-chlorophenyl)-2-nitro- chemical structure, C14H9ClN2O2S, CAS 149338-07-8
Benzo(b)thiophen-3-amine, N-(4-chlorophenyl)-2-nitro-
CAS 149338-07-8C14H9ClN2O2S
3-(5-Chlorothiophen-2-yl)-1-phenyl-1H-pyrazole-4-carboxylic acid chemical structure, C14H9ClN2O2S, CAS 882228-95-7
3-(5-Chlorothiophen-2-yl)-1-phenyl-1H-pyrazole-4-carboxylic acid
CAS 882228-95-7C14H9ClN2O2S
2-((6-(4-Chlorophenyl)-3-cyanopyridin-2-yl)thio)acetic acid chemical structure, C14H9ClN2O2S, CAS 326915-38-2
2-((6-(4-Chlorophenyl)-3-cyanopyridin-2-yl)thio)acetic acid
CAS 326915-38-2C14H9ClN2O2S
(E)-N-(6-Chloro-1,3-benzothiazol-2-yl)-3-(furan-2-yl)prop-2-enamide chemical structure, C14H9ClN2O2S, CAS 544449-84-5
(E)-N-(6-Chloro-1,3-benzothiazol-2-yl)-3-(furan-2-yl)prop-2-enamide
CAS 544449-84-5C14H9ClN2O2S
(5E)-5-[(5-Chlorothiophen-2-yl)methylidene]-3-phenylimidazolidine-2,4-dione chemical structure, C14H9ClN2O2S, CAS 444781-94-6
(5E)-5-[(5-Chlorothiophen-2-yl)methylidene]-3-phenylimidazolidine-2,4-dione
CAS 444781-94-6C14H9ClN2O2S
2-Chloro-3-(phenylsulfonyl)quinoxaline chemical structure, C14H9ClN2O2S, CAS 174192-76-8
2-Chloro-3-(phenylsulfonyl)quinoxaline
CAS 174192-76-8C14H9ClN2O2S
2-{[(6-Chloro-2H-1,3-benzodioxol-5-yl)methyl]sulfanyl}pyridine-3-carbonitrile chemical structure, C14H9ClN2O2S, CAS 1129406-37-6
2-{[(6-Chloro-2H-1,3-benzodioxol-5-yl)methyl]sulfanyl}pyridine-3-carbonitrile
CAS 1129406-37-6C14H9ClN2O2S
N-(1,3-Benzothiazol-2-yl)-5-chloro-2-hydroxybenzamide chemical structure, C14H9ClN2O2S, CAS 677729-40-7
N-(1,3-Benzothiazol-2-yl)-5-chloro-2-hydroxybenzamide
CAS 677729-40-7C14H9ClN2O2S
6-(4-Chlorobenzylthio)-5-cyanopicolinic acid chemical structure, C14H9ClN2O2S, CAS 1198296-57-9
6-(4-Chlorobenzylthio)-5-cyanopicolinic acid
CAS 1198296-57-9C14H9ClN2O2S
(5E)-3-(3-Chlorophenyl)-5-(thiophen-3-ylmethylidene)imidazolidine-2,4-dione chemical structure, C14H9ClN2O2S, CAS 677303-40-1
(5E)-3-(3-Chlorophenyl)-5-(thiophen-3-ylmethylidene)imidazolidine-2,4-dione
CAS 677303-40-1C14H9ClN2O2S
4-[[5-(2-Chlorophenyl)-1,3,4-thiadiazol-2-yl]oxy]phenol chemical structure, C14H9ClN2O2S, CAS 138426-30-9
4-[[5-(2-Chlorophenyl)-1,3,4-thiadiazol-2-yl]oxy]phenol
CAS 138426-30-9C14H9ClN2O2S
Methyl 4-chloro-2-(3-quinolinyl)-5-thiazolecarboxylate chemical structure, C14H9ClN2O2S, CAS 1500393-25-8
Methyl 4-chloro-2-(3-quinolinyl)-5-thiazolecarboxylate
CAS 1500393-25-8C14H9ClN2O2S
2-(2-Chloro-4-nitrobenzyl)benzothiazole chemical structure, C14H9ClN2O2S, CAS 315228-06-9
2-(2-Chloro-4-nitrobenzyl)benzothiazole
CAS 315228-06-9C14H9ClN2O2S

Frequently asked questions

What is the molar mass of C14H9ClN2O2S?

The molar mass of C14H9ClN2O2S is 304.75 g/mol, calculated from standard atomic weights for 14 carbon atoms, 9 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms, 2 oxygen atoms and 1 sulfur atom. The monoisotopic mass is 304.0073 Da.

How many compounds have the formula C14H9ClN2O2S?

CompoundList lists 30 compounds with the molecular formula C14H9ClN2O2S, including 1-(3-Chlorophenyl)-3-(2-thienyl)-1H-pyrazole-5-carboxylic acid, 2-(4-Chlorophenyl)sulfonylquinoxaline, 5-(4-Chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C14H9ClN2O2S?

C14H9ClN2O2S has a degree of unsaturation of 11. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.