CompoundList
Sign in
Molecular formula

C15H11ClFNO3

21 compounds have this formula on CompoundList.

Molar mass
307.70g/mol
Monoisotopic mass
307.0411Da
Atoms
32
Elements
6
Rings plus double bonds
10

The formula C15H11ClFNO3 describes a molecule made of 15 carbon atoms, 11 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom and 3 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1558.55%
    12.011 × 15 = 180.165 g/mol
  • H Hydrogen × 113.60%
    1.008 × 11 = 11.088 g/mol
  • Cl Chlorine × 111.52%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 16.17%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 14.55%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 315.60%
    15.999 × 3 = 47.997 g/mol
Look up another formula

Compounds with the formula C15H11ClFNO3

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 21 of 21 compounds

Ethyl 7-chloro-6-fluoro-4-oxo-1-(2-propynyl)-1,4-dihydro-3-quinolinecarboxylate chemical structure, C15H11ClFNO3, CAS 134478-70-9
Ethyl 7-chloro-6-fluoro-4-oxo-1-(2-propynyl)-1,4-dihydro-3-quinolinecarboxylate
CAS 134478-70-9C15H11ClFNO3
N-(3-Chloro-4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide chemical structure, C15H11ClFNO3, CAS 1333905-67-1
N-(3-Chloro-4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide
CAS 1333905-67-1C15H11ClFNO3
2-(3-Chloro-4-fluorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione chemical structure, C15H11ClFNO3, CAS 473803-51-9
2-(3-Chloro-4-fluorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione
CAS 473803-51-9C15H11ClFNO3
Methyl 4-chloro-2-(2-fluorobenzamido)benzoate chemical structure, C15H11ClFNO3, CAS 934830-83-8
Methyl 4-chloro-2-(2-fluorobenzamido)benzoate
CAS 934830-83-8C15H11ClFNO3
2-Chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid chemical structure, C15H11ClFNO3, CAS 168080-49-7
2-Chloro-4-(5-fluoro-2-methylbenzamido)benzoic acid
CAS 168080-49-7C15H11ClFNO3
2-(4-Chloro-2-formylphenoxy)-N-(4-fluorophenyl)acetamide chemical structure, C15H11ClFNO3, CAS 712294-40-1
2-(4-Chloro-2-formylphenoxy)-N-(4-fluorophenyl)acetamide
CAS 712294-40-1C15H11ClFNO3
2-(2-Chloro-4-formylphenoxy)-N-(4-fluorophenyl)acetamide chemical structure, C15H11ClFNO3, CAS 864714-33-0
2-(2-Chloro-4-formylphenoxy)-N-(4-fluorophenyl)acetamide
CAS 864714-33-0C15H11ClFNO3
N-(1,3-Benzodioxol-5-yl)-2-(2-chloro-6-fluorophenyl)acetamide chemical structure, C15H11ClFNO3, CAS 710989-49-4
N-(1,3-Benzodioxol-5-yl)-2-(2-chloro-6-fluorophenyl)acetamide
CAS 710989-49-4C15H11ClFNO3
2-(4-Chloro-2-formylphenoxy)-N-(2-fluorophenyl)acetamide chemical structure, C15H11ClFNO3, CAS 718600-63-6
2-(4-Chloro-2-formylphenoxy)-N-(2-fluorophenyl)acetamide
CAS 718600-63-6C15H11ClFNO3
Methyl 4-{[(5-chloro-2-hydroxyphenyl)methylidene]-amino}-3-fluorobenzoate chemical structure, C15H11ClFNO3, CAS 1296225-20-1
Methyl 4-{[(5-chloro-2-hydroxyphenyl)methylidene]-amino}-3-fluorobenzoate
CAS 1296225-20-1C15H11ClFNO3
2-(2-Chloro-4-formylphenoxy)-N-(2-fluorophenyl)acetamide chemical structure, C15H11ClFNO3, CAS 717891-68-4
2-(2-Chloro-4-formylphenoxy)-N-(2-fluorophenyl)acetamide
CAS 717891-68-4C15H11ClFNO3
N-(7-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide chemical structure, C15H11ClFNO3, CAS 931621-75-9
N-(7-Chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide
CAS 931621-75-9C15H11ClFNO3
2-(2-Chloro-6-fluorobenzamido)-5-methylbenzoic acid chemical structure, C15H11ClFNO3, CAS 1040341-62-5
2-(2-Chloro-6-fluorobenzamido)-5-methylbenzoic acid
CAS 1040341-62-5C15H11ClFNO3
2-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide chemical structure, C15H11ClFNO3, CAS 886637-17-8
2-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-fluorobenzamide
CAS 886637-17-8C15H11ClFNO3
N-(1,3-Benzodioxol-5-ylmethyl)-2-chloro-4-fluorobenzamide chemical structure, C15H11ClFNO3, CAS 886638-64-8
N-(1,3-Benzodioxol-5-ylmethyl)-2-chloro-4-fluorobenzamide
CAS 886638-64-8C15H11ClFNO3
4-{[(2-Chloro-6-fluorophenyl)formamido]methyl}benzoic acid chemical structure, C15H11ClFNO3, CAS 1036540-24-5
4-{[(2-Chloro-6-fluorophenyl)formamido]methyl}benzoic acid
CAS 1036540-24-5C15H11ClFNO3
4-Chloro-N-[2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]benzamide chemical structure, C15H11ClFNO3, CAS 865284-37-3
4-Chloro-N-[2-(4-fluorophenyl)-1-hydroxy-2-oxoethyl]benzamide
CAS 865284-37-3C15H11ClFNO3
4-((3-Chloro-4-fluorobenzamido)methyl)benzoic acid chemical structure, C15H11ClFNO3, CAS 1545417-64-8
4-((3-Chloro-4-fluorobenzamido)methyl)benzoic acid
CAS 1545417-64-8C15H11ClFNO3
(2-Chloro-benzoylamino)-(4-fluoro-phenyl)-acetic acid chemical structure, C15H11ClFNO3, CAS 672300-85-5
(2-Chloro-benzoylamino)-(4-fluoro-phenyl)-acetic acid
CAS 672300-85-5C15H11ClFNO3
3-[2-(2-Chloro-4-fluorophenoxy)ethyl]-2(3H)-benzoxazolone chemical structure, C15H11ClFNO3, CAS 1225923-57-8
3-[2-(2-Chloro-4-fluorophenoxy)ethyl]-2(3H)-benzoxazolone
CAS 1225923-57-8C15H11ClFNO3
Benzyl N-(3-chloro-6-fluoro-2-formylphenyl)carbamate chemical structure, C15H11ClFNO3, CAS 2680898-24-0
Benzyl N-(3-chloro-6-fluoro-2-formylphenyl)carbamate
CAS 2680898-24-0C15H11ClFNO3

Frequently asked questions

What is the molar mass of C15H11ClFNO3?

The molar mass of C15H11ClFNO3 is 307.70 g/mol, calculated from standard atomic weights for 15 carbon atoms, 11 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 1 nitrogen atom and 3 oxygen atoms. The monoisotopic mass is 307.0411 Da.

How many compounds have the formula C15H11ClFNO3?

CompoundList lists 21 compounds with the molecular formula C15H11ClFNO3, including Ethyl 7-chloro-6-fluoro-4-oxo-1-(2-propynyl)-1,4-dihydro-3-quinolinecarboxylate, N-(3-Chloro-4-fluorophenyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide, 2-(3-Chloro-4-fluorophenyl)-7-methyl-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C15H11ClFNO3?

C15H11ClFNO3 has a degree of unsaturation of 10. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.