CompoundList
Sign in
Molecular formula

C15H11ClN2O5

20 compounds have this formula on CompoundList.

Molar mass
334.71g/mol
Monoisotopic mass
334.0356Da
Atoms
34
Elements
5
Rings plus double bonds
11

The formula C15H11ClN2O5 describes a molecule made of 15 carbon atoms, 11 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms and 5 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1553.83%
    12.011 × 15 = 180.165 g/mol
  • H Hydrogen × 113.31%
    1.008 × 11 = 11.088 g/mol
  • Cl Chlorine × 110.59%
    35.45 × 1 = 35.450 g/mol
  • N Nitrogen × 28.37%
    14.007 × 2 = 28.014 g/mol
  • O Oxygen × 523.90%
    15.999 × 5 = 79.995 g/mol
Look up another formula

Compounds with the formula C15H11ClN2O5

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 20 of 20 compounds

Methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate chemical structure, C15H11ClN2O5, CAS 329940-62-7
Methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate
CAS 329940-62-7C15H11ClN2O5
4-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide chemical structure, C15H11ClN2O5, CAS 349608-79-3
4-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide
CAS 349608-79-3C15H11ClN2O5
[2-(1,3-Benzodioxol-5-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate chemical structure, C15H11ClN2O5, CAS 389811-44-3
[2-(1,3-Benzodioxol-5-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate
CAS 389811-44-3C15H11ClN2O5
[(1,3-Dioxaindan-5-yl)carbamoyl]methyl 6-chloropyridine-3-carboxylate chemical structure, C15H11ClN2O5, CAS 386279-27-2
[(1,3-Dioxaindan-5-yl)carbamoyl]methyl 6-chloropyridine-3-carboxylate
CAS 386279-27-2C15H11ClN2O5
4-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrobenzamide chemical structure, C15H11ClN2O5, CAS 544424-23-9
4-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-nitrobenzamide
CAS 544424-23-9C15H11ClN2O5
N-(4-Chloro-2-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-2-carboxamide chemical structure, C15H11ClN2O5, CAS 838871-29-7
N-(4-Chloro-2-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-2-carboxamide
CAS 838871-29-7C15H11ClN2O5
5-Chloro-3-(2-methoxy-5-nitrobenzyl)-1,3-benzoxazol-2(3H)-one chemical structure, C15H11ClN2O5, CAS 898796-77-5
5-Chloro-3-(2-methoxy-5-nitrobenzyl)-1,3-benzoxazol-2(3H)-one
CAS 898796-77-5C15H11ClN2O5
Methyl 4-[(4-chloro-2-nitrobenzoyl)amino]benzoate chemical structure, C15H11ClN2O5, CAS 333346-91-1
Methyl 4-[(4-chloro-2-nitrobenzoyl)amino]benzoate
CAS 333346-91-1C15H11ClN2O5
5-Chloro-3-(4-methoxy-3-nitrobenzyl)-1,3-benzoxazol-2(3H)-one chemical structure, C15H11ClN2O5, CAS 904005-18-1
5-Chloro-3-(4-methoxy-3-nitrobenzyl)-1,3-benzoxazol-2(3H)-one
CAS 904005-18-1C15H11ClN2O5
2-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-nitrobenzamide chemical structure, C15H11ClN2O5, CAS 289494-20-8
2-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-nitrobenzamide
CAS 289494-20-8C15H11ClN2O5
Methyl 4-({5-chloro-2-nitrobenzoyl}amino)benzoate chemical structure, C15H11ClN2O5, CAS 551908-15-7
Methyl 4-({5-chloro-2-nitrobenzoyl}amino)benzoate
CAS 551908-15-7C15H11ClN2O5
N-(1,3-Benzodioxol-5-ylmethyl)-5-chloro-2-nitrobenzamide chemical structure, C15H11ClN2O5, CAS 169044-89-7
N-(1,3-Benzodioxol-5-ylmethyl)-5-chloro-2-nitrobenzamide
CAS 169044-89-7C15H11ClN2O5
Methyl 3-[(4-chloro-3-nitrobenzoyl)amino]benzoate chemical structure, C15H11ClN2O5, CAS 304890-72-0
Methyl 3-[(4-chloro-3-nitrobenzoyl)amino]benzoate
CAS 304890-72-0C15H11ClN2O5
N-(2-Chloro-4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-2-carboxamide chemical structure, C15H11ClN2O5, CAS 879577-18-1
N-(2-Chloro-4-nitrophenyl)-2,3-dihydro-1,4-benzodioxine-2-carboxamide
CAS 879577-18-1C15H11ClN2O5
3-{[(2-Chloro-5-nitrophenyl)carbonyl]amino}-2-methylbenzoic acid chemical structure, C15H11ClN2O5, CAS 420107-19-3
3-{[(2-Chloro-5-nitrophenyl)carbonyl]amino}-2-methylbenzoic acid
CAS 420107-19-3C15H11ClN2O5
Methyl 4-chloro-3-[(3-nitrobenzoyl)amino]benzoate chemical structure, C15H11ClN2O5, CAS 1027819-05-1
Methyl 4-chloro-3-[(3-nitrobenzoyl)amino]benzoate
CAS 1027819-05-1C15H11ClN2O5
1,3-Propanedione, 1-(4-aminophenyl)-3-(5-chloro-2-hydroxy-3-nitrophenyl)- chemical structure, C15H11ClN2O5, CAS 357166-58-6
1,3-Propanedione, 1-(4-aminophenyl)-3-(5-chloro-2-hydroxy-3-nitrophenyl)-
CAS 357166-58-6C15H11ClN2O5
2-Methoxy-N-[(4-nitrobenzoyl)oxy]benzene-1-carboximidoyl chloride chemical structure, C15H11ClN2O5, CAS 89109-67-1
2-Methoxy-N-[(4-nitrobenzoyl)oxy]benzene-1-carboximidoyl chloride
CAS 89109-67-1C15H11ClN2O5
1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(5-chloro-3-methyl-1,2-oxazol-4-yl)propanoate chemical structure, C15H11ClN2O5, CAS 2248268-90-6
1,3-Dioxo-2,3-dihydro-1H-isoindol-2-yl 3-(5-chloro-3-methyl-1,2-oxazol-4-yl)propanoate
CAS 2248268-90-6C15H11ClN2O5
(2-Acetyl-4-chloro-6-nitrophenyl) 4-aminobenzoate chemical structure, C15H11ClN2O5, CAS 357166-51-9
(2-Acetyl-4-chloro-6-nitrophenyl) 4-aminobenzoate
CAS 357166-51-9C15H11ClN2O5

Frequently asked questions

What is the molar mass of C15H11ClN2O5?

The molar mass of C15H11ClN2O5 is 334.71 g/mol, calculated from standard atomic weights for 15 carbon atoms, 11 hydrogen atoms, 1 chlorine atom, 2 nitrogen atoms and 5 oxygen atoms. The monoisotopic mass is 334.0356 Da.

How many compounds have the formula C15H11ClN2O5?

CompoundList lists 20 compounds with the molecular formula C15H11ClN2O5, including Methyl 2-[(2-chloro-4-nitrobenzoyl)amino]benzoate, 4-Chloro-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide, [2-(1,3-Benzodioxol-5-ylamino)-2-oxoethyl] 2-chloropyridine-3-carboxylate. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C15H11ClN2O5?

C15H11ClN2O5 has a degree of unsaturation of 11. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.