CompoundList
Sign in
Molecular formula

C16H14ClFN2O3

16 compounds have this formula on CompoundList.

Molar mass
336.75g/mol
Monoisotopic mass
336.0677Da
Atoms
37
Elements
6
Rings plus double bonds
10

The formula C16H14ClFN2O3 describes a molecule made of 16 carbon atoms, 14 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1657.07%
    12.011 × 16 = 192.176 g/mol
  • H Hydrogen × 144.19%
    1.008 × 14 = 14.112 g/mol
  • Cl Chlorine × 110.53%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 15.64%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 28.32%
    14.007 × 2 = 28.014 g/mol
  • O Oxygen × 314.25%
    15.999 × 3 = 47.997 g/mol
Look up another formula

Compounds with the formula C16H14ClFN2O3

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 16 of 16 compounds

{[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 2-chloropyridine-3-carboxylate chemical structure, C16H14ClFN2O3, CAS 522624-93-7
{[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 2-chloropyridine-3-carboxylate
CAS 522624-93-7C16H14ClFN2O3
{[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 6-chloropyridine-3-carboxylate chemical structure, C16H14ClFN2O3, CAS 437749-27-4
{[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 6-chloropyridine-3-carboxylate
CAS 437749-27-4C16H14ClFN2O3
N1-(3-chloro-4-fluorophenyl)-N2-(2-methoxybenzyl)oxalamide chemical structure, C16H14ClFN2O3, CAS 899748-83-5
N1-(3-chloro-4-fluorophenyl)-N2-(2-methoxybenzyl)oxalamide
CAS 899748-83-5C16H14ClFN2O3
N-(3-Chloro-4-fluorophenyl)-2,5-dioxo-1,2,3,4,5,6,7,8-octahydroquinoline-4-carboxamide chemical structure, C16H14ClFN2O3, CAS 727392-07-6
N-(3-Chloro-4-fluorophenyl)-2,5-dioxo-1,2,3,4,5,6,7,8-octahydroquinoline-4-carboxamide
CAS 727392-07-6C16H14ClFN2O3
N1-(3-chloro-4-fluorophenyl)-N2-(3-methoxybenzyl)oxalamide chemical structure, C16H14ClFN2O3, CAS 900001-11-8
N1-(3-chloro-4-fluorophenyl)-N2-(3-methoxybenzyl)oxalamide
CAS 900001-11-8C16H14ClFN2O3
N1-(2-chlorophenyl)-N2-(2-(4-fluorophenoxy)ethyl)oxalamide chemical structure, C16H14ClFN2O3, CAS 1207032-62-9
N1-(2-chlorophenyl)-N2-(2-(4-fluorophenoxy)ethyl)oxalamide
CAS 1207032-62-9C16H14ClFN2O3
Ethyl 6-amino-2-(chloromethyl)-5-cyano-4-(2-fluorophenyl)-4H-pyran-3-carboxylate chemical structure, C16H14ClFN2O3, CAS 309926-80-5
Ethyl 6-amino-2-(chloromethyl)-5-cyano-4-(2-fluorophenyl)-4H-pyran-3-carboxylate
CAS 309926-80-5C16H14ClFN2O3
Ethyl 6-amino-2-(chloromethyl)-5-cyano-4-(4-fluorophenyl)-4H-pyran-3-carboxylate chemical structure, C16H14ClFN2O3, CAS 339158-75-7
Ethyl 6-amino-2-(chloromethyl)-5-cyano-4-(4-fluorophenyl)-4H-pyran-3-carboxylate
CAS 339158-75-7C16H14ClFN2O3
Propyl 4-(6-chloro-3-fluoropyridine-2-amido)benzoate chemical structure, C16H14ClFN2O3, CAS 1445689-19-9
Propyl 4-(6-chloro-3-fluoropyridine-2-amido)benzoate
CAS 1445689-19-9C16H14ClFN2O3
Ethyl 2-amino-6-(chloromethyl)-5-cyano-4-(4-fluorophenyl)-4H-pyran-3-carboxylate chemical structure, C16H14ClFN2O3, CAS 362494-67-5
Ethyl 2-amino-6-(chloromethyl)-5-cyano-4-(4-fluorophenyl)-4H-pyran-3-carboxylate
CAS 362494-67-5C16H14ClFN2O3
N-(3-Chloro-4-fluorophenyl)-6-((tetrahydrofuran-3-yl)oxy)nicotinamide chemical structure, C16H14ClFN2O3, CAS 2034270-86-3
N-(3-Chloro-4-fluorophenyl)-6-((tetrahydrofuran-3-yl)oxy)nicotinamide
CAS 2034270-86-3C16H14ClFN2O3
N-(3-Chloro-4-fluorophenyl)-2-((tetrahydrofuran-3-yl)oxy)isonicotinamide chemical structure, C16H14ClFN2O3, CAS 1904081-39-5
N-(3-Chloro-4-fluorophenyl)-2-((tetrahydrofuran-3-yl)oxy)isonicotinamide
CAS 1904081-39-5C16H14ClFN2O3
N-(4-Chloro-2-fluorophenyl)-7-methoxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxamide chemical structure, C16H14ClFN2O3, CAS 2034375-61-4
N-(4-Chloro-2-fluorophenyl)-7-methoxy-5-oxo-1,2,3,5-tetrahydroindolizine-8-carboxamide
CAS 2034375-61-4C16H14ClFN2O3
5-Chloro-N-(2-fluorophenyl)-6-(oxolan-3-yloxy)pyridine-3-carboxamide chemical structure, C16H14ClFN2O3, CAS 1903237-65-9
5-Chloro-N-(2-fluorophenyl)-6-(oxolan-3-yloxy)pyridine-3-carboxamide
CAS 1903237-65-9C16H14ClFN2O3
5-Chloro-N-(3-fluorophenyl)-6-(oxolan-3-yloxy)pyridine-3-carboxamide chemical structure, C16H14ClFN2O3, CAS 1903654-77-2
5-Chloro-N-(3-fluorophenyl)-6-(oxolan-3-yloxy)pyridine-3-carboxamide
CAS 1903654-77-2C16H14ClFN2O3
3-[(2-Chloro-5-fluoropyridin-4-yl)formamido]-2-methyl-2-phenylpropanoic acid chemical structure, C16H14ClFN2O3, CAS 2411279-06-4
3-[(2-Chloro-5-fluoropyridin-4-yl)formamido]-2-methyl-2-phenylpropanoic acid
CAS 2411279-06-4C16H14ClFN2O3

Frequently asked questions

What is the molar mass of C16H14ClFN2O3?

The molar mass of C16H14ClFN2O3 is 336.75 g/mol, calculated from standard atomic weights for 16 carbon atoms, 14 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. The monoisotopic mass is 336.0677 Da.

How many compounds have the formula C16H14ClFN2O3?

CompoundList lists 16 compounds with the molecular formula C16H14ClFN2O3, including {[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 2-chloropyridine-3-carboxylate, {[2-(4-Fluorophenyl)ethyl]carbamoyl}methyl 6-chloropyridine-3-carboxylate, N1-(3-chloro-4-fluorophenyl)-N2-(2-methoxybenzyl)oxalamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C16H14ClFN2O3?

C16H14ClFN2O3 has a degree of unsaturation of 10. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.