CompoundList
Sign in
Molecular formula

C18H18ClFN2O3

16 compounds have this formula on CompoundList.

Molar mass
364.80g/mol
Monoisotopic mass
364.0990Da
Atoms
43
Elements
6
Rings plus double bonds
10

The formula C18H18ClFN2O3 describes a molecule made of 18 carbon atoms, 18 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 1859.26%
    12.011 × 18 = 216.198 g/mol
  • H Hydrogen × 184.97%
    1.008 × 18 = 18.144 g/mol
  • Cl Chlorine × 19.72%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 15.21%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 27.68%
    14.007 × 2 = 28.014 g/mol
  • O Oxygen × 313.16%
    15.999 × 3 = 47.997 g/mol
Look up another formula

Compounds with the formula C18H18ClFN2O3

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 16 of 16 compounds

5-[(2-Chloro-6-fluorobenzyl)amino]-2-(4-morpholinyl)benzoic acid chemical structure, C18H18ClFN2O3, CAS 765933-61-7
5-[(2-Chloro-6-fluorobenzyl)amino]-2-(4-morpholinyl)benzoic acid
CAS 765933-61-7C18H18ClFN2O3
2-(3-Chloro-4-fluorophenoxy)-N-(4-morpholin-4-ylphenyl)acetamide chemical structure, C18H18ClFN2O3, CAS 851271-80-2
2-(3-Chloro-4-fluorophenoxy)-N-(4-morpholin-4-ylphenyl)acetamide
CAS 851271-80-2C18H18ClFN2O3
N-(3-Chloro-4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-1,2,3,4,5,6,7,8-octahydroquinoline-4-carboxamide chemical structure, C18H18ClFN2O3, CAS 727392-08-7
N-(3-Chloro-4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-1,2,3,4,5,6,7,8-octahydroquinoline-4-carboxamide
CAS 727392-08-7C18H18ClFN2O3
ALDH2 modulator 1 chemical structure, C18H18ClFN2O3, CAS 1629615-99-1
ALDH2 modulator 1
CAS 1629615-99-1C18H18ClFN2O3
2-Chloro-6-fluoro-N-{[1-(furan-3-carbonyl)piperidin-4-yl]methyl}benzamide chemical structure, C18H18ClFN2O3, CAS 1396868-02-2
2-Chloro-6-fluoro-N-{[1-(furan-3-carbonyl)piperidin-4-yl]methyl}benzamide
CAS 1396868-02-2C18H18ClFN2O3
2-Chloro-6-fluoro-N-(4-{[(2-methoxyethyl)carbamoyl]methyl}phenyl)benzamide chemical structure, C18H18ClFN2O3, CAS 1060361-95-6
2-Chloro-6-fluoro-N-(4-{[(2-methoxyethyl)carbamoyl]methyl}phenyl)benzamide
CAS 1060361-95-6C18H18ClFN2O3
1-(4-((3-Chloropyridin-2-yl)oxy)piperidin-1-yl)-2-(2-fluorophenoxy)ethanone chemical structure, C18H18ClFN2O3, CAS 1448133-95-6
1-(4-((3-Chloropyridin-2-yl)oxy)piperidin-1-yl)-2-(2-fluorophenoxy)ethanone
CAS 1448133-95-6C18H18ClFN2O3
(4-Chloro-benzyl)-(6-fluoro-5-formyl-pyridin-2-yl)-carbamic acid tert-butyl ester chemical structure, C18H18ClFN2O3, CAS 923562-70-3
(4-Chloro-benzyl)-(6-fluoro-5-formyl-pyridin-2-yl)-carbamic acid tert-butyl ester
CAS 923562-70-3C18H18ClFN2O3
N1-(3-chloro-4-fluorophenyl)-N2-(2-methoxy-2-(o-tolyl)ethyl)oxalamide chemical structure, C18H18ClFN2O3, CAS 1797893-11-8
N1-(3-chloro-4-fluorophenyl)-N2-(2-methoxy-2-(o-tolyl)ethyl)oxalamide
CAS 1797893-11-8C18H18ClFN2O3
N1-(3-chloro-2-methylphenyl)-N2-(2-(3-fluorophenyl)-2-methoxyethyl)oxalamide chemical structure, C18H18ClFN2O3, CAS 1797892-08-0
N1-(3-chloro-2-methylphenyl)-N2-(2-(3-fluorophenyl)-2-methoxyethyl)oxalamide
CAS 1797892-08-0C18H18ClFN2O3
N-(3-Chloro-4-fluorophenyl)-6-((tetrahydro-2H-pyran-4-yl)methoxy)nicotinamide chemical structure, C18H18ClFN2O3, CAS 2034616-50-5
N-(3-Chloro-4-fluorophenyl)-6-((tetrahydro-2H-pyran-4-yl)methoxy)nicotinamide
CAS 2034616-50-5C18H18ClFN2O3
N-(3-Chloro-4-fluorophenyl)-2-((tetrahydro-2H-pyran-4-yl)methoxy)isonicotinamide chemical structure, C18H18ClFN2O3, CAS 2034296-62-1
N-(3-Chloro-4-fluorophenyl)-2-((tetrahydro-2H-pyran-4-yl)methoxy)isonicotinamide
CAS 2034296-62-1C18H18ClFN2O3
1-(4-((3-Chloropyridin-4-yl)oxy)piperidin-1-yl)-2-(4-fluorophenoxy)ethanone chemical structure, C18H18ClFN2O3, CAS 2034330-31-7
1-(4-((3-Chloropyridin-4-yl)oxy)piperidin-1-yl)-2-(4-fluorophenoxy)ethanone
CAS 2034330-31-7C18H18ClFN2O3
(4-((3-Chloropyridin-4-yl)oxy)piperidin-1-yl)(3-fluoro-4-methoxyphenyl)methanone chemical structure, C18H18ClFN2O3, CAS 2034524-74-6
(4-((3-Chloropyridin-4-yl)oxy)piperidin-1-yl)(3-fluoro-4-methoxyphenyl)methanone
CAS 2034524-74-6C18H18ClFN2O3
tert-Butyl 3-(3-chloro-4-fluorophenylcarbamoyl)phenylcarbamate chemical structure, C18H18ClFN2O3, CAS 1002673-81-5
tert-Butyl 3-(3-chloro-4-fluorophenylcarbamoyl)phenylcarbamate
CAS 1002673-81-5C18H18ClFN2O3
tert-Butyl N-{5-chloro-3-[2-(3-fluorophenyl)acetyl]pyridin-2-yl}carbamate chemical structure, C18H18ClFN2O3, CAS 2680844-40-8
tert-Butyl N-{5-chloro-3-[2-(3-fluorophenyl)acetyl]pyridin-2-yl}carbamate
CAS 2680844-40-8C18H18ClFN2O3

Frequently asked questions

What is the molar mass of C18H18ClFN2O3?

The molar mass of C18H18ClFN2O3 is 364.80 g/mol, calculated from standard atomic weights for 18 carbon atoms, 18 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. The monoisotopic mass is 364.0990 Da.

How many compounds have the formula C18H18ClFN2O3?

CompoundList lists 16 compounds with the molecular formula C18H18ClFN2O3, including 5-[(2-Chloro-6-fluorobenzyl)amino]-2-(4-morpholinyl)benzoic acid, 2-(3-Chloro-4-fluorophenoxy)-N-(4-morpholin-4-ylphenyl)acetamide, N-(3-Chloro-4-fluorophenyl)-7,7-dimethyl-2,5-dioxo-1,2,3,4,5,6,7,8-octahydroquinoline-4-carboxamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C18H18ClFN2O3?

C18H18ClFN2O3 has a degree of unsaturation of 10. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.