CompoundList
Sign in
Molecular formula

C20H19ClFN3OS

10 compounds have this formula on CompoundList.

Molar mass
403.90g/mol
Monoisotopic mass
403.0921Da
Atoms
46
Elements
7
Rings plus double bonds
12

The formula C20H19ClFN3OS describes a molecule made of 20 carbon atoms, 19 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 3 nitrogen atoms, 1 oxygen atom and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 2059.48%
    12.011 × 20 = 240.220 g/mol
  • H Hydrogen × 194.74%
    1.008 × 19 = 19.152 g/mol
  • Cl Chlorine × 18.78%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 14.70%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 310.40%
    14.007 × 3 = 42.021 g/mol
  • O Oxygen × 13.96%
    15.999 × 1 = 15.999 g/mol
  • S Sulfur × 17.94%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C20H19ClFN3OS

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 10 of 10 compounds

N-(1-Benzothiophen-2-yl)-4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carboxamide chemical structure, C20H19ClFN3OS, CAS 690626-60-9
N-(1-Benzothiophen-2-yl)-4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carboxamide
CAS 690626-60-9C20H19ClFN3OS
3-Amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide chemical structure, C20H19ClFN3OS, CAS 445269-00-1
3-Amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
CAS 445269-00-1C20H19ClFN3OS
3-Amino-N-(4-chloro-2-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide chemical structure, C20H19ClFN3OS, CAS 627056-91-1
3-Amino-N-(4-chloro-2-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
CAS 627056-91-1C20H19ClFN3OS
3-Amino-N-(2-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide chemical structure, C20H19ClFN3OS, CAS 625370-22-1
3-Amino-N-(2-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide
CAS 625370-22-1C20H19ClFN3OS
N-(4-((3,4-Dihydroisoquinolin-2(1H)-yl)methyl)thiazol-2-yl)-2-fluorobenzamide hydrochloride chemical structure, C20H19ClFN3OS, CAS 1216503-93-3
N-(4-((3,4-Dihydroisoquinolin-2(1H)-yl)methyl)thiazol-2-yl)-2-fluorobenzamide hydrochloride
CAS 1216503-93-3C20H19ClFN3OS
N-{[1-(1,3-Benzothiazol-2-yl)piperidin-4-yl]methyl}-2-chloro-6-fluorobenzamide chemical structure, C20H19ClFN3OS, CAS 1797725-46-2
N-{[1-(1,3-Benzothiazol-2-yl)piperidin-4-yl]methyl}-2-chloro-6-fluorobenzamide
CAS 1797725-46-2C20H19ClFN3OS
N-(3-Chloro-4-fluorophenyl)-2-{[2,2-dimethyl-5-(4-methylphenyl)-2H-imidazol-4-yl]sulfanyl}acetamide chemical structure, C20H19ClFN3OS, CAS 899932-82-2
N-(3-Chloro-4-fluorophenyl)-2-{[2,2-dimethyl-5-(4-methylphenyl)-2H-imidazol-4-yl]sulfanyl}acetamide
CAS 899932-82-2C20H19ClFN3OS
N-(4-((3,4-Dihydroisoquinolin-2(1H)-yl)methyl)thiazol-2-yl)-4-fluorobenzamide hydrochloride chemical structure, C20H19ClFN3OS, CAS 1216920-93-2
N-(4-((3,4-Dihydroisoquinolin-2(1H)-yl)methyl)thiazol-2-yl)-4-fluorobenzamide hydrochloride
CAS 1216920-93-2C20H19ClFN3OS
N-(3-Chloro-4-fluorophenyl)-2-[(2-ethyl-2-methyl-5-phenyl-2H-imidazol-4-yl)sulfanyl]acetamide chemical structure, C20H19ClFN3OS, CAS 899935-08-1
N-(3-Chloro-4-fluorophenyl)-2-[(2-ethyl-2-methyl-5-phenyl-2H-imidazol-4-yl)sulfanyl]acetamide
CAS 899935-08-1C20H19ClFN3OS
N-(5-Benzyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-3-fluorobenzamide hydrochloride chemical structure, C20H19ClFN3OS, CAS 1189867-77-3
N-(5-Benzyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)-3-fluorobenzamide hydrochloride
CAS 1189867-77-3C20H19ClFN3OS

Frequently asked questions

What is the molar mass of C20H19ClFN3OS?

The molar mass of C20H19ClFN3OS is 403.90 g/mol, calculated from standard atomic weights for 20 carbon atoms, 19 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 3 nitrogen atoms, 1 oxygen atom and 1 sulfur atom. The monoisotopic mass is 403.0921 Da.

How many compounds have the formula C20H19ClFN3OS?

CompoundList lists 10 compounds with the molecular formula C20H19ClFN3OS, including N-(1-Benzothiophen-2-yl)-4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carboxamide, 3-Amino-N-(3-chloro-4-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide, 3-Amino-N-(4-chloro-2-fluorophenyl)-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carboxamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C20H19ClFN3OS?

C20H19ClFN3OS has a degree of unsaturation of 12. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.