CompoundList
Sign in
Molecular formula

C20H20ClFN2O3

17 compounds have this formula on CompoundList.

Molar mass
390.84g/mol
Monoisotopic mass
390.1146Da
Atoms
47
Elements
6
Rings plus double bonds
11

The formula C20H20ClFN2O3 describes a molecule made of 20 carbon atoms, 20 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 2061.46%
    12.011 × 20 = 240.220 g/mol
  • H Hydrogen × 205.16%
    1.008 × 20 = 20.160 g/mol
  • Cl Chlorine × 19.07%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 14.86%
    18.998 × 1 = 18.998 g/mol
  • N Nitrogen × 27.17%
    14.007 × 2 = 28.014 g/mol
  • O Oxygen × 312.28%
    15.999 × 3 = 47.997 g/mol
Look up another formula

Compounds with the formula C20H20ClFN2O3

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 17 of 17 compounds

[2-Oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(2-chloro-6-fluorophenyl)acetate chemical structure, C20H20ClFN2O3, CAS 562845-73-2
[2-Oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(2-chloro-6-fluorophenyl)acetate
CAS 562845-73-2C20H20ClFN2O3
N-(3-Chloro-4-fluorophenyl)-1-(4-methoxybenzoyl)piperidine-4-carboxamide chemical structure, C20H20ClFN2O3, CAS 700847-77-4
N-(3-Chloro-4-fluorophenyl)-1-(4-methoxybenzoyl)piperidine-4-carboxamide
CAS 700847-77-4C20H20ClFN2O3
N-(5-Chloro-2-methoxyphenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide chemical structure, C20H20ClFN2O3, CAS 433689-44-2
N-(5-Chloro-2-methoxyphenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide
CAS 433689-44-2C20H20ClFN2O3
1-[4-(1,3-Benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone chemical structure, C20H20ClFN2O3, CAS 825597-37-3
1-[4-(1,3-Benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone
CAS 825597-37-3C20H20ClFN2O3
2-[4-(2-Fluorophenyl)piperazin-1-yl]-2-oxoethyl 2-(4-chlorophenyl)acetate chemical structure, C20H20ClFN2O3, CAS 1794798-16-5
2-[4-(2-Fluorophenyl)piperazin-1-yl]-2-oxoethyl 2-(4-chlorophenyl)acetate
CAS 1794798-16-5C20H20ClFN2O3
3-(2-Chloro-6-fluorobenzamido)cyclohexyl phenylcarbamate chemical structure, C20H20ClFN2O3, CAS 1351590-30-1
3-(2-Chloro-6-fluorobenzamido)cyclohexyl phenylcarbamate
CAS 1351590-30-1C20H20ClFN2O3
2-[4-(3-Chlorophenyl)piperazin-1-yl]-4-(4-fluorophenyl)-4-oxobutanoic acid chemical structure, C20H20ClFN2O3, CAS 301194-46-7
2-[4-(3-Chlorophenyl)piperazin-1-yl]-4-(4-fluorophenyl)-4-oxobutanoic acid
CAS 301194-46-7C20H20ClFN2O3
N-(3-Chloro-4-fluorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]ethanediamide chemical structure, C20H20ClFN2O3, CAS 1091035-69-6
N-(3-Chloro-4-fluorophenyl)-N'-[(4-phenyloxan-4-yl)methyl]ethanediamide
CAS 1091035-69-6C20H20ClFN2O3
Phenyl 4-((2-chloro-6-fluorobenzamido)methyl)piperidine-1-carboxylate chemical structure, C20H20ClFN2O3, CAS 1234880-92-2
Phenyl 4-((2-chloro-6-fluorobenzamido)methyl)piperidine-1-carboxylate
CAS 1234880-92-2C20H20ClFN2O3
(E)-2-Chloro-6-fluoro-N-((1-(3-(furan-2-yl)acryloyl)piperidin-4-yl)methyl)benzamide chemical structure, C20H20ClFN2O3, CAS 1235690-57-9
(E)-2-Chloro-6-fluoro-N-((1-(3-(furan-2-yl)acryloyl)piperidin-4-yl)methyl)benzamide
CAS 1235690-57-9C20H20ClFN2O3
4-((1-(2-(2-Chloro-6-fluorophenyl)acetyl)azetidin-3-yl)oxy)-1-cyclopropyl-6-methylpyridin-2(1H)-one chemical structure, C20H20ClFN2O3, CAS 2034312-19-9
4-((1-(2-(2-Chloro-6-fluorophenyl)acetyl)azetidin-3-yl)oxy)-1-cyclopropyl-6-methylpyridin-2(1H)-one
CAS 2034312-19-9C20H20ClFN2O3
3-(3-Chlorophenyl)-N-(2-(7-fluoro-3-oxo-2,3-dihydrobenzo[f][1,4]oxazepin-4(5H)-yl)ethyl)propanamide chemical structure, C20H20ClFN2O3, CAS 2034503-24-5
3-(3-Chlorophenyl)-N-(2-(7-fluoro-3-oxo-2,3-dihydrobenzo[f][1,4]oxazepin-4(5H)-yl)ethyl)propanamide
CAS 2034503-24-5C20H20ClFN2O3
[4-[(2-Chloro-4-fluorophenyl)methyl]-1-piperazinyl](2,3-dihydro-1,4-benzodioxin-2-yl)methanone chemical structure, C20H20ClFN2O3, CAS 1060811-67-7
[4-[(2-Chloro-4-fluorophenyl)methyl]-1-piperazinyl](2,3-dihydro-1,4-benzodioxin-2-yl)methanone
CAS 1060811-67-7C20H20ClFN2O3
2-Chloro-N-(5-ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-7-yl)-6-fluorobenzamide chemical structure, C20H20ClFN2O3, CAS 921789-74-4
2-Chloro-N-(5-ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-7-yl)-6-fluorobenzamide
CAS 921789-74-4C20H20ClFN2O3
2-Chloro-N-(5-ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)-6-fluorobenzamide chemical structure, C20H20ClFN2O3, CAS 921793-47-7
2-Chloro-N-(5-ethyl-3,3-dimethyl-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]oxazepin-8-yl)-6-fluorobenzamide
CAS 921793-47-7C20H20ClFN2O3
Des(trifluoroacetyl)mk-0686 chemical structure, C20H20ClFN2O3, CAS 756473-92-4
Des(trifluoroacetyl)mk-0686
CAS 756473-92-4C20H20ClFN2O3
N-[(3S,4R)-1-(2-Chloroacetyl)-4-phenylpyrrolidin-3-yl]-3-fluoro-4-methoxybenzamide chemical structure, C20H20ClFN2O3, CAS 2418594-05-3
N-[(3S,4R)-1-(2-Chloroacetyl)-4-phenylpyrrolidin-3-yl]-3-fluoro-4-methoxybenzamide
CAS 2418594-05-3C20H20ClFN2O3

Frequently asked questions

What is the molar mass of C20H20ClFN2O3?

The molar mass of C20H20ClFN2O3 is 390.84 g/mol, calculated from standard atomic weights for 20 carbon atoms, 20 hydrogen atoms, 1 chlorine atom, 1 fluorine atom, 2 nitrogen atoms and 3 oxygen atoms. The monoisotopic mass is 390.1146 Da.

How many compounds have the formula C20H20ClFN2O3?

CompoundList lists 17 compounds with the molecular formula C20H20ClFN2O3, including [2-Oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(2-chloro-6-fluorophenyl)acetate, N-(3-Chloro-4-fluorophenyl)-1-(4-methoxybenzoyl)piperidine-4-carboxamide, N-(5-Chloro-2-methoxyphenyl)-1-(4-fluorobenzoyl)piperidine-4-carboxamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C20H20ClFN2O3?

C20H20ClFN2O3 has a degree of unsaturation of 11. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.