C22H32Cl4N10
4 compounds have this formula on CompoundList.
- Molar mass
- 578.37g/mol
- Monoisotopic mass
- 584.2068Da
- Atoms
- 68
- Elements
- 4
- Rings plus double bonds
- 10
The formula C22H32Cl4N10 describes a molecule made of 22 carbon atoms, 32 hydrogen atoms, 4 chlorine atoms and 10 nitrogen atoms. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.
Elemental composition
- C Carbon × 2245.69%12.011 × 22 = 264.242 g/mol
- H Hydrogen × 325.58%1.008 × 32 = 32.256 g/mol
- Cl Chlorine × 424.52%35.45 × 4 = 141.800 g/mol
- N Nitrogen × 1024.22%14.007 × 10 = 140.070 g/mol
Compounds with the formula C22H32Cl4N10
Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.
Showing 1 to 4 of 4 compounds
Frequently asked questions
What is the molar mass of C22H32Cl4N10?
The molar mass of C22H32Cl4N10 is 578.37 g/mol, calculated from standard atomic weights for 22 carbon atoms, 32 hydrogen atoms, 4 chlorine atoms and 10 nitrogen atoms. The monoisotopic mass is 584.2068 Da.
How many compounds have the formula C22H32Cl4N10?
CompoundList lists 4 compounds with the molecular formula C22H32Cl4N10, including Chlorhexidine hydrochloride, Chlorhexidinedihydrochloride, N1,N14-bis(4-chlorophenyl-d4)-3,12-diimino-2,4,11,13-tetraazatetradecanediimidamide, dihydrochloride. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.
What is the degree of unsaturation of C22H32Cl4N10?
C22H32Cl4N10 has a degree of unsaturation of 10. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.