CompoundList
Sign in
Molecular formula

C7H8ClN3S

32 compounds have this formula on CompoundList.

Molar mass
201.67g/mol
Monoisotopic mass
201.0127Da
Atoms
20
Elements
5
Rings plus double bonds
5

The formula C7H8ClN3S describes a molecule made of 7 carbon atoms, 8 hydrogen atoms, 1 chlorine atom, 3 nitrogen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 741.69%
    12.011 × 7 = 84.077 g/mol
  • H Hydrogen × 84.00%
    1.008 × 8 = 8.064 g/mol
  • Cl Chlorine × 117.58%
    35.45 × 1 = 35.450 g/mol
  • N Nitrogen × 320.84%
    14.007 × 3 = 42.021 g/mol
  • S Sulfur × 115.90%
    32.06 × 1 = 32.060 g/mol
Look up another formula

Compounds with the formula C7H8ClN3S

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 32 of 32 compounds

N-(2-Chlorophenyl)hydrazinecarbothioamide chemical structure, C7H8ClN3S, CAS 42135-75-1
N-(2-Chlorophenyl)hydrazinecarbothioamide
CAS 42135-75-1C7H8ClN3S
4-(4-Chlorophenyl)-3-thiosemicarbazide chemical structure, C7H8ClN3S, CAS 22814-92-2
4-(4-Chlorophenyl)-3-thiosemicarbazide
CAS 22814-92-2C7H8ClN3S
4-(3-Chlorophenyl)thiosemicarbazide chemical structure, C7H8ClN3S, CAS 42135-76-2
4-(3-Chlorophenyl)thiosemicarbazide
CAS 42135-76-2C7H8ClN3S
((3-Chlorophenyl)amino)thiourea chemical structure, C7H8ClN3S, CAS 828-11-5
((3-Chlorophenyl)amino)thiourea
CAS 828-11-5C7H8ClN3S
(2,1,3-Benzothiadiazol-4-yl)methanamine hydrochloride chemical structure, C7H8ClN3S, CAS 830330-21-7
(2,1,3-Benzothiadiazol-4-yl)methanamine hydrochloride
CAS 830330-21-7C7H8ClN3S
(2,1,3-Benzothiadiazol-5-yl)methanamine hydrochloride chemical structure, C7H8ClN3S, CAS 74375-65-8
(2,1,3-Benzothiadiazol-5-yl)methanamine hydrochloride
CAS 74375-65-8C7H8ClN3S
4-Thiocyanatophenylhydrazine hydrochloride chemical structure, C7H8ClN3S, CAS 74411-22-6
4-Thiocyanatophenylhydrazine hydrochloride
CAS 74411-22-6C7H8ClN3S
4H,5H,6H,7H-[1,3]Thiazolo[5,4-c]pyridine-2-carbonitrile hydrochloride chemical structure, C7H8ClN3S, CAS 1864015-71-3
4H,5H,6H,7H-[1,3]Thiazolo[5,4-c]pyridine-2-carbonitrile hydrochloride
CAS 1864015-71-3C7H8ClN3S
2-(4-Chlorophenyl)-1-hydrazinecarbothioamide chemical structure, C7H8ClN3S, CAS 7382-41-4
2-(4-Chlorophenyl)-1-hydrazinecarbothioamide
CAS 7382-41-4C7H8ClN3S
2-(2-Chlorophenyl)-1-hydrazinecarbothioamide chemical structure, C7H8ClN3S, CAS 877-52-1
2-(2-Chlorophenyl)-1-hydrazinecarbothioamide
CAS 877-52-1C7H8ClN3S
Benzothiazole-2-ylhydrazine, chloride chemical structure, C7H8ClN3S, CAS 153853-94-2
Benzothiazole-2-ylhydrazine, chloride
CAS 153853-94-2C7H8ClN3S
1-(2-Chloropyridin-3-yl)-3-methylthiourea chemical structure, C7H8ClN3S, CAS 452325-37-0
1-(2-Chloropyridin-3-yl)-3-methylthiourea
CAS 452325-37-0C7H8ClN3S
4-Chloro-6,7-dihydro-2-(methylthio)-5H-pyrrolo(2,3-d)pyrimidine chemical structure, C7H8ClN3S, CAS 1417287-45-6
4-Chloro-6,7-dihydro-2-(methylthio)-5H-pyrrolo(2,3-d)pyrimidine
CAS 1417287-45-6C7H8ClN3S
1-(6-Chloropyridin-3-yl)-3-methylthiourea chemical structure, C7H8ClN3S, CAS 131748-90-8
1-(6-Chloropyridin-3-yl)-3-methylthiourea
CAS 131748-90-8C7H8ClN3S
({6-Chloroimidazo[2,1-b][1,3]thiazol-5-yl}methyl)(methyl)amine chemical structure, C7H8ClN3S, CAS 1000930-88-0
({6-Chloroimidazo[2,1-b][1,3]thiazol-5-yl}methyl)(methyl)amine
CAS 1000930-88-0C7H8ClN3S
[1,2,4]Thiadiazolo[2,3-a]pyridin-4-ium, 2-(methylamino)-, chloride chemical structure, C7H8ClN3S, CAS 188830-69-5
[1,2,4]Thiadiazolo[2,3-a]pyridin-4-ium, 2-(methylamino)-, chloride
CAS 188830-69-5C7H8ClN3S
N-(5-Chloropyridin-2-yl)-N'-methylthiourea chemical structure, C7H8ClN3S, CAS 59180-93-7
N-(5-Chloropyridin-2-yl)-N'-methylthiourea
CAS 59180-93-7C7H8ClN3S
1,3-Benzothiazole-6,7-diamine hydrochloride chemical structure, C7H8ClN3S, CAS 2193064-32-1
1,3-Benzothiazole-6,7-diamine hydrochloride
CAS 2193064-32-1C7H8ClN3S
Pyrimidine, 4-(1-aziridinyl)-6-chloro-2-(methylthio)- chemical structure, C7H8ClN3S, CAS 98280-50-3
Pyrimidine, 4-(1-aziridinyl)-6-chloro-2-(methylthio)-
CAS 98280-50-3C7H8ClN3S
5-Chloro-N,N-dimethyl-1H-thieno[2,3-c]pyrazol-3-amine chemical structure, C7H8ClN3S, CAS 2231673-64-4
5-Chloro-N,N-dimethyl-1H-thieno[2,3-c]pyrazol-3-amine
CAS 2231673-64-4C7H8ClN3S
1-(4-Chlorophenyl)hydrazine-1-carbothioamide chemical structure, C7H8ClN3S, CAS 89521-94-8
1-(4-Chlorophenyl)hydrazine-1-carbothioamide
CAS 89521-94-8C7H8ClN3S
3-(4-Chloro-1,2,5-thiadiazol-3-yl)-1,2,5,6-tetrahydropyridine chemical structure, C7H8ClN3S, CAS 168121-53-7
3-(4-Chloro-1,2,5-thiadiazol-3-yl)-1,2,5,6-tetrahydropyridine
CAS 168121-53-7C7H8ClN3S
1,3-Benzothiazole-2,6-diamine hydrochloride chemical structure, C7H8ClN3S, CAS 1955560-72-1
1,3-Benzothiazole-2,6-diamine hydrochloride
CAS 1955560-72-1C7H8ClN3S
N-(3-Chloro-5-methyl-2-pyridinyl)thiourea chemical structure, C7H8ClN3S, CAS 31430-43-0
N-(3-Chloro-5-methyl-2-pyridinyl)thiourea
CAS 31430-43-0C7H8ClN3S

Frequently asked questions

What is the molar mass of C7H8ClN3S?

The molar mass of C7H8ClN3S is 201.67 g/mol, calculated from standard atomic weights for 7 carbon atoms, 8 hydrogen atoms, 1 chlorine atom, 3 nitrogen atoms and 1 sulfur atom. The monoisotopic mass is 201.0127 Da.

How many compounds have the formula C7H8ClN3S?

CompoundList lists 32 compounds with the molecular formula C7H8ClN3S, including N-(2-Chlorophenyl)hydrazinecarbothioamide, 4-(4-Chlorophenyl)-3-thiosemicarbazide, 4-(3-Chlorophenyl)thiosemicarbazide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C7H8ClN3S?

C7H8ClN3S has a degree of unsaturation of 5. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.