C8H10ClN3S
47 compounds have this formula on CompoundList.
- Molar mass
- 215.70g/mol
- Monoisotopic mass
- 215.0284Da
- Atoms
- 23
- Elements
- 5
- Rings plus double bonds
- 5
The formula C8H10ClN3S describes a molecule made of 8 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 3 nitrogen atoms and 1 sulfur atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.
Elemental composition
- C Carbon × 844.55%12.011 × 8 = 96.088 g/mol
- H Hydrogen × 104.67%1.008 × 10 = 10.080 g/mol
- Cl Chlorine × 116.43%35.45 × 1 = 35.450 g/mol
- N Nitrogen × 319.48%14.007 × 3 = 42.021 g/mol
- S Sulfur × 114.86%32.06 × 1 = 32.060 g/mol
Compounds with the formula C8H10ClN3S
Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.
Showing 1 to 47 of 47 compounds
![4-Chloro-5,6,7,8-tetrahydro-2-(methylthio)pyrido[4,3-D]pyrimidine chemical structure, C8H10ClN3S, CAS 944902-03-8](/s/WOKOJJXVQQKKEU-UHFFFAOYSA-N.svg)
![2-Amino-4H,5H,6H,7H-thieno[2,3-c]pyridine-3-carbonitrile hydrochloride chemical structure, C8H10ClN3S, CAS 1177314-67-8](/s/RFULQEOTEDORJY-UHFFFAOYSA-N.svg)
- 1-(2-Chloroethyl)-2,3-dihydroimidazo[1,2-c]pyrimidine-5-thione7151-75-9C8H10ClN3S
- 4-Chloro-2-(methylthio)-1,5,6,7-tetrahydropyrido[2,3-d]pyrimidine1417287-47-8C8H10ClN3S
- [1,2,4]Thiadiazolo[2,3-a]pyridin-4-ium, 2-(ethylamino)-, chloride188830-70-8C8H10ClN3S
- N-(2-Chloro-4-methylphenyl)hydrazinecarbothioamide1037139-12-0C8H10ClN3S
- 4-(3-Chloropyrazin-2-yl)thiomorpholine1247096-43-0C8H10ClN3S
- N'-(5-Chloropyridin-2-yl)-N,N-dimethylthiourea59180-95-9C8H10ClN3S
- 4-(1-Azetidinyl)-6-chloro-2-(methylthio)pyrimidine1637398-83-4C8H10ClN3S
- 4-Chloro-7-methyl-2-methylsulfanyl-5,6-dihydropyrrolo[2,3-d]pyrimidine2768873-35-2C8H10ClN3S
- 4-Chloro-2-methylsulfanyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine1537724-97-2C8H10ClN3S
- 6-Chloro-5-propyl-2-pyrazinecarbothioamide182244-18-4C8H10ClN3S
- N-(5-Chloropyridin-2-yl)-N'-ethylthiourea59180-94-8C8H10ClN3S
- 6-Hydrazinyl-2-methylbenzothiazole hydrochloride116008-80-1C8H10ClN3S
- 4-(5-Chloropyrimidin-2-yl)thiomorpholine1864524-06-0C8H10ClN3S
- 4-(1-Methyl-1H-pyrrol-2-yl)-1,3-thiazol-2-amine hydrochloride136382-22-4C8H10ClN3S
- Methyl 1-(4-chlorophenyl)hydrazine-1-carboximidothioate89522-00-9C8H10ClN3S
- Methyl 1-(3-chlorophenyl)hydrazine-1-carboximidothioate89522-01-0C8H10ClN3S
- 4-Pyridin-4-yl-1,3-dihydroimidazole-2-thione hydrochloride167897-35-0C8H10ClN3S
- 2-(3-Chloro-5,6-dimethylpyridazin-4-yl)ethanethioamide2228514-98-3C8H10ClN3S
- 3-Chloro-5-[(1,2,3-thiadiazol-4-yl)methyl]-1,2,3,6-tetrahydropyridine2138137-05-8C8H10ClN3S
- 1-[4-(1H-Pyrazol-4-yl)thiophen-2-yl]methanamine hydrochloride2870706-55-9C8H10ClN3S
- 3-Chloro-5-[(1,2,5-thiadiazol-3-yl)methyl]-1,2,3,6-tetrahydropyridine2137753-00-3C8H10ClN3S
- (6R)-4-Chloro-6-methyl-2-methylsulfanyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine1417287-39-8C8H10ClN3S
- (6S)-4-Chloro-6-methyl-2-methylsulfanyl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine1417287-42-3C8H10ClN3S
Frequently asked questions
What is the molar mass of C8H10ClN3S?
The molar mass of C8H10ClN3S is 215.70 g/mol, calculated from standard atomic weights for 8 carbon atoms, 10 hydrogen atoms, 1 chlorine atom, 3 nitrogen atoms and 1 sulfur atom. The monoisotopic mass is 215.0284 Da.
How many compounds have the formula C8H10ClN3S?
CompoundList lists 47 compounds with the molecular formula C8H10ClN3S, including Tiamenidine, N-(5-Chloro-2-methylphenyl)hydrazinecarbothioamide, 4-(3-Chloro-ortho-tolyl)-3-thiosemicarbazide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.
What is the degree of unsaturation of C8H10ClN3S?
C8H10ClN3S has a degree of unsaturation of 5. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.