CompoundList
Sign in
Molecular formula

C8H4ClF4NO

21 compounds have this formula on CompoundList.

Molar mass
241.57g/mol
Monoisotopic mass
240.9918Da
Atoms
19
Elements
6
Rings plus double bonds
5

The formula C8H4ClF4NO describes a molecule made of 8 carbon atoms, 4 hydrogen atoms, 1 chlorine atom, 4 fluorine atoms, 1 nitrogen atom and 1 oxygen atom. It is written in Hill notation: carbon first, then hydrogen, then the other elements in alphabetical order. The formula tells you which atoms are present, not how they are connected, which is why several different chemicals can share it.

Elemental composition

  • C Carbon × 839.78%
    12.011 × 8 = 96.088 g/mol
  • H Hydrogen × 41.67%
    1.008 × 4 = 4.032 g/mol
  • Cl Chlorine × 114.67%
    35.45 × 1 = 35.450 g/mol
  • F Fluorine × 431.46%
    18.998 × 4 = 75.992 g/mol
  • N Nitrogen × 15.80%
    14.007 × 1 = 14.007 g/mol
  • O Oxygen × 16.62%
    15.999 × 1 = 15.999 g/mol
Look up another formula

Compounds with the formula C8H4ClF4NO

Isomers we list, best known first. Open one to see its structure, properties, safety data and suppliers.

Showing 1 to 21 of 21 compounds

3-Chloro-2-fluoro-6-(trifluoromethyl)benzamide chemical structure, C8H4ClF4NO, CAS 186517-42-0
3-Chloro-2-fluoro-6-(trifluoromethyl)benzamide
CAS 186517-42-0C8H4ClF4NO
3-Fluoro-N-hydroxy-5-(trifluoromethyl)benzene-1-carbonimidoyl chloride chemical structure, C8H4ClF4NO, CAS 1704235-40-4
3-Fluoro-N-hydroxy-5-(trifluoromethyl)benzene-1-carbonimidoyl chloride
CAS 1704235-40-4C8H4ClF4NO
3-Chloro-2-fluoro-5-(trifluoromethyl)benzamide chemical structure, C8H4ClF4NO, CAS 129931-46-0
3-Chloro-2-fluoro-5-(trifluoromethyl)benzamide
CAS 129931-46-0C8H4ClF4NO
N-(4-Chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide chemical structure, C8H4ClF4NO, CAS 1094106-61-2
N-(4-Chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide
CAS 1094106-61-2C8H4ClF4NO
2-Chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide chemical structure, C8H4ClF4NO, CAS 832675-11-3
2-Chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide
CAS 832675-11-3C8H4ClF4NO
1-(6-Amino-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone chemical structure, C8H4ClF4NO, CAS 277301-95-8
1-(6-Amino-3-chloro-2-fluorophenyl)-2,2,2-trifluoroethanone
CAS 277301-95-8C8H4ClF4NO
2-Fluoro-5-trifluoromethyl-N-hydroxybenzenecarboximidoyl chloride chemical structure, C8H4ClF4NO, CAS 880084-06-0
2-Fluoro-5-trifluoromethyl-N-hydroxybenzenecarboximidoyl chloride
CAS 880084-06-0C8H4ClF4NO
N-(4-Chlorophenyl)-N-(trifluoromethyl)carbamoyl fluoride chemical structure, C8H4ClF4NO, CAS 2088941-66-4
N-(4-Chlorophenyl)-N-(trifluoromethyl)carbamoyl fluoride
CAS 2088941-66-4C8H4ClF4NO
N1-(2,4-difluorophenyl)-2-chloro-2,2-difluoroacetamide chemical structure, C8H4ClF4NO, CAS 284664-78-4
N1-(2,4-difluorophenyl)-2-chloro-2,2-difluoroacetamide
CAS 284664-78-4C8H4ClF4NO
N-(4-Chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide chemical structure, C8H4ClF4NO, CAS 546063-96-1
N-(4-Chloro-2-fluorophenyl)-2,2,2-trifluoroacetamide
CAS 546063-96-1C8H4ClF4NO
1-(6-Amino-2-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone chemical structure, C8H4ClF4NO, CAS 277301-94-7
1-(6-Amino-2-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone
CAS 277301-94-7C8H4ClF4NO
2-Fluoro-N-hydroxy-6-(trifluoromethyl)benzimidoyl Chloride chemical structure, C8H4ClF4NO, CAS 667932-35-6
2-Fluoro-N-hydroxy-6-(trifluoromethyl)benzimidoyl Chloride
CAS 667932-35-6C8H4ClF4NO
N-(3-Chloro-5-fluorophenyl)-2,2,2-trifluoroacetamide chemical structure, C8H4ClF4NO, CAS 1422955-37-0
N-(3-Chloro-5-fluorophenyl)-2,2,2-trifluoroacetamide
CAS 1422955-37-0C8H4ClF4NO
3-Fluoro-N-hydroxy-4-(trifluoromethyl)benzimidoyl chloride chemical structure, C8H4ClF4NO, CAS 1239576-25-0
3-Fluoro-N-hydroxy-4-(trifluoromethyl)benzimidoyl chloride
CAS 1239576-25-0C8H4ClF4NO
5-Chloro-2-fluoro-4-(trifluoromethyl)benzamide chemical structure, C8H4ClF4NO, CAS 2384811-45-2
5-Chloro-2-fluoro-4-(trifluoromethyl)benzamide
CAS 2384811-45-2C8H4ClF4NO
4-Fluoro-N-hydroxy-3-(trifluoromethyl)benzimidoyl Chloride chemical structure, C8H4ClF4NO, CAS 1704231-52-6
4-Fluoro-N-hydroxy-3-(trifluoromethyl)benzimidoyl Chloride
CAS 1704231-52-6C8H4ClF4NO
3-(5-Chloro-2-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one chemical structure, C8H4ClF4NO, CAS 2228705-19-7
3-(5-Chloro-2-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one
CAS 2228705-19-7C8H4ClF4NO
3-(4-Chloro-2-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one chemical structure, C8H4ClF4NO, CAS 2228209-64-9
3-(4-Chloro-2-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one
CAS 2228209-64-9C8H4ClF4NO
3-(2-Chloro-5-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one chemical structure, C8H4ClF4NO, CAS 2228339-82-8
3-(2-Chloro-5-fluoropyridin-3-yl)-1,1,1-trifluoropropan-2-one
CAS 2228339-82-8C8H4ClF4NO
2-Fluoro-N-hydroxy-4-(trifluoromethyl)benzimidoyl Chloride chemical structure, C8H4ClF4NO, CAS 159693-03-5
2-Fluoro-N-hydroxy-4-(trifluoromethyl)benzimidoyl Chloride
CAS 159693-03-5C8H4ClF4NO
2-Chloro-3-fluoro-4-(trifluoromethyl)benzamide chemical structure, C8H4ClF4NO, CAS 2384325-99-7
2-Chloro-3-fluoro-4-(trifluoromethyl)benzamide
CAS 2384325-99-7C8H4ClF4NO

Frequently asked questions

What is the molar mass of C8H4ClF4NO?

The molar mass of C8H4ClF4NO is 241.57 g/mol, calculated from standard atomic weights for 8 carbon atoms, 4 hydrogen atoms, 1 chlorine atom, 4 fluorine atoms, 1 nitrogen atom and 1 oxygen atom. The monoisotopic mass is 240.9918 Da.

How many compounds have the formula C8H4ClF4NO?

CompoundList lists 21 compounds with the molecular formula C8H4ClF4NO, including 3-Chloro-2-fluoro-6-(trifluoromethyl)benzamide, 3-Fluoro-N-hydroxy-5-(trifluoromethyl)benzene-1-carbonimidoyl chloride, 3-Chloro-2-fluoro-5-(trifluoromethyl)benzamide. Compounds that share a formula are isomers. They contain the same atoms arranged differently, so their properties, uses and prices can be very different.

What is the degree of unsaturation of C8H4ClF4NO?

C8H4ClF4NO has a degree of unsaturation of 5. That is the total number of rings and pi bonds (a double bond counts as one, a triple bond as two) in any structure with this formula.