CompoundList
Sign in
Murcko scaffold

Benzoic anhydride scaffold

57 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
17
Chemicals
57
With full pages
24
Scaffold SMILES

O=C(OC(=O)c1ccccc1)c1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Benzoic anhydride page
Murcko scaffold O=C(OC(=O)c1ccccc1)c1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 48 of 57 chemicals

Benzoic anhydride chemical structure, C14H10O3, CAS 93-97-0
Benzoic anhydride
CAS 93-97-0C14H10O3
Acetylsalicylic anhydride chemical structure, C18H14O7, CAS 1466-82-6
Acetylsalicylic anhydride
CAS 1466-82-6C18H14O7
Bis(4-chlorobenzoic) anhydride chemical structure, C14H8Cl2O3, CAS 790-41-0
Bis(4-chlorobenzoic) anhydride
CAS 790-41-0C14H8Cl2O3
p-Anisic anhydride chemical structure, C16H14O5, CAS 794-94-5
p-Anisic anhydride
CAS 794-94-5C16H14O5
3,3',4,4',5,5'-Hexamethoxybenzoic anhydride chemical structure, C20H22O9, CAS 1719-88-6
3,3',4,4',5,5'-Hexamethoxybenzoic anhydride
CAS 1719-88-6C20H22O9
Bis(2,6-dichlorobenzoic) anhydride chemical structure, C14H6Cl4O3, CAS 16442-10-7
Bis(2,6-dichlorobenzoic) anhydride
CAS 16442-10-7C14H6Cl4O3
2-Methylbenzoic anhydride chemical structure, C16H14O3, CAS 607-86-3
2-Methylbenzoic anhydride
CAS 607-86-3C16H14O3
4-Methylbenzoic acid anhydride chemical structure, C16H14O3, CAS 13222-85-0
4-Methylbenzoic acid anhydride
CAS 13222-85-0C16H14O3
Pentafluorobenzoic anhydride chemical structure, C14F10O3, CAS 15989-99-8
Pentafluorobenzoic anhydride
CAS 15989-99-8C14F10O3
(3-Bromobenzoyl) 3-bromobenzoate chemical structure, C14H8Br2O3, CAS 6268-21-9
(3-Bromobenzoyl) 3-bromobenzoate
CAS 6268-21-9C14H8Br2O3
m-Toluic anhydride chemical structure, C16H14O3, CAS 21436-44-2
m-Toluic anhydride
CAS 21436-44-2C16H14O3
4-Nitrobenzoic anhydride chemical structure, C14H8N2O7, CAS 902-47-6
4-Nitrobenzoic anhydride
CAS 902-47-6C14H8N2O7
(3-Ethyl-2-iodobenzoyl) 3-ethyl-2-iodobenzoate chemical structure, C18H16I2O3, CAS 28455-64-3
(3-Ethyl-2-iodobenzoyl) 3-ethyl-2-iodobenzoate
CAS 28455-64-3C18H16I2O3
2,4,6-Trimethylbenzoic anhydride chemical structure, C20H22O3, CAS 5745-51-7
2,4,6-Trimethylbenzoic anhydride
CAS 5745-51-7C20H22O3
(4-(Dimethylamino)benzoyl) 4-(dimethylamino)benzoate chemical structure, C18H20N2O3, CAS 7474-31-9
(4-(Dimethylamino)benzoyl) 4-(dimethylamino)benzoate
CAS 7474-31-9C18H20N2O3
o-Nitrobenzoic anhydride chemical structure, C14H8N2O7, CAS 49619-45-6
o-Nitrobenzoic anhydride
CAS 49619-45-6C14H8N2O7
2-Fluorobenzoic anhydride chemical structure, C14H8F2O3, CAS 64508-63-0
2-Fluorobenzoic anhydride
CAS 64508-63-0C14H8F2O3
4-Fluorobenzoic acid, anhydride chemical structure, C14H8F2O3, CAS 25569-77-1
4-Fluorobenzoic acid, anhydride
CAS 25569-77-1C14H8F2O3
(3-Chlorobenzoyl) 3-chlorobenzoate chemical structure, C14H8Cl2O3, CAS 30070-63-4
(3-Chlorobenzoyl) 3-chlorobenzoate
CAS 30070-63-4C14H8Cl2O3
2-Chlorobenzoic anhydride chemical structure, C14H8Cl2O3, CAS 49619-43-4
2-Chlorobenzoic anhydride
CAS 49619-43-4C14H8Cl2O3
3-Trifluoromethylbenzoic anhydride chemical structure, C16H8F6O3, CAS 25753-15-5
3-Trifluoromethylbenzoic anhydride
CAS 25753-15-5C16H8F6O3
3,4-Dichlorobenzoic anhydride chemical structure, C14H6Cl4O3, CAS 86866-14-0
3,4-Dichlorobenzoic anhydride
CAS 86866-14-0C14H6Cl4O3
Benzoic acid, 4-bromo-, anhydride with 4-bromobenzoic acid chemical structure, C14H8Br2O3, CAS 1633-33-6
Benzoic acid, 4-bromo-, anhydride with 4-bromobenzoic acid
CAS 1633-33-6C14H8Br2O3
4-Trifluoromethylbenzoic anhydride chemical structure, C16H8F6O3, CAS 25753-16-6
4-Trifluoromethylbenzoic anhydride
CAS 25753-16-6C16H8F6O3