CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 46 atoms

25 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
46
Chemicals
25
With full pages
4
Scaffold SMILES

O=C(CNC(=O)C1CCCN1C(=O)CNC(=O)C1CCCN1)NCC(=O)NC(Cc1ccccc1)C(=O)NCCc1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C(CNC(=O)C1CCCN1C(=O)CNC(=O)C1CCCN1)NCC(=O)NC(Cc1ccccc1)C(=O)NCCc1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 25 of 25 chemicals

Substance P chemical structure, C63H98N18O13S, CAS 33507-63-0
Substance P
CAS 33507-63-0C63H98N18O13S
Substance P, methyl ester- chemical structure, C63H97N17O14S, CAS 76260-78-1
Substance P, methyl ester-
CAS 76260-78-1C63H97N17O14S
Substance P, gly(12)- chemical structure, C65H100N18O15S, CAS 98093-85-7
Substance P, gly(12)-
CAS 98093-85-7C65H100N18O15S
Substance P, Sar(9)-Met(O2)(11)- chemical structure, C64H100N18O15S, CAS 110880-55-2
Substance P, Sar(9)-Met(O2)(11)-
CAS 110880-55-2C64H100N18O15S
Substance P (1-9) chemical structure, C52H77N15O12, CAS 57468-17-4
Substance P (1-9)
CAS 57468-17-4C52H77N15O12
Substance P, phe(7)- chemical structure, C63H98N18O13S, CAS 70533-68-5
Substance P, phe(7)-
CAS 70533-68-5C63H98N18O13S
Ranatachykinin A chemical structure, C60H92N16O15S, CAS 135690-47-0
Ranatachykinin A
CAS 135690-47-0C60H92N16O15S
Ranakinin chemical structure, C62H95N17O15S, CAS 139446-71-2
Ranakinin
CAS 139446-71-2C62H95N17O15S
Substance P, N-spermine-Gln(5)- chemical structure, C73H121N21O13S, CAS 141231-59-6
Substance P, N-spermine-Gln(5)-
CAS 141231-59-6C73H121N21O13S
Arg-pro-lys-pro-gln-gln-P-chloro-phe-P-chloro-phe-gly-leu-met-NH2 chemical structure, C63H96Cl2N18O13S, CAS 73646-81-8
Arg-pro-lys-pro-gln-gln-P-chloro-phe-P-chloro-phe-gly-leu-met-NH2
CAS 73646-81-8C63H96Cl2N18O13S
Substance P (human, bovine, rat, mouse) chemical structure, C63H98N18O13S, CAS 11035-08-8
Substance P (human, bovine, rat, mouse)
CAS 11035-08-8C63H98N18O13S
[Nle11]-SUBSTANCE P chemical structure, C64H100N18O13, CAS 57462-42-7
[Nle11]-SUBSTANCE P
CAS 57462-42-7C64H100N18O13
(Met-OH11)-substance P chemical structure, C63H97N17O14S, CAS 71977-09-8
(Met-OH11)-substance P
CAS 71977-09-8C63H97N17O14S
Arg-Pro-Lys-Pro-Gln-Gln-Phe-Phe-Sar-Leu-Met-NH2 chemical structure, C64H100N18O13S, CAS 77128-75-7
Arg-Pro-Lys-Pro-Gln-Gln-Phe-Phe-Sar-Leu-Met-NH2
CAS 77128-75-7C64H100N18O13S
Substance P, tyr(8)- chemical structure, C63H98N18O14S, CAS 55614-10-3
Substance P, tyr(8)-
CAS 55614-10-3C63H98N18O14S
Substance P, sulfoxide- chemical structure, C63H98N18O14S, CAS 66013-34-1
Substance P, sulfoxide-
CAS 66013-34-1C63H98N18O14S
Substance P (2-11) chemical structure, C57H86N14O12S, CAS 53749-61-4
Substance P (2-11)
CAS 53749-61-4C57H86N14O12S
Substance P (alligator) chemical structure, C63H98N20O13S, CAS 113516-47-5
Substance P (alligator)
CAS 113516-47-5C63H98N20O13S
Substance P TFA chemical structure, C65H99F3N18O15S, CAS 148470-19-3
Substance P TFA
CAS 148470-19-3C65H99F3N18O15S
Substance P acetate salt hydrate, biochemika chemical structure, C65H102N18O15S
Substance P acetate salt hydrate, biochemika
C65H102N18O15S
Substance P acetate chemical structure, C65H102N18O15S, CAS 137348-11-9
Substance P acetate
CAS 137348-11-9C65H102N18O15S
[Sar9,Met(O2)11]-Substance P TFA chemical structure, C66H101F3N18O17S, CAS 2828433-10-7
[Sar9,Met(O2)11]-Substance P TFA
CAS 2828433-10-7C66H101F3N18O17S
H-Arg-Pro-Lys-Pro-Gln-Gln-Phe-Phe-Gly-Leu-Met-Gly-Lys-Arg-OH chemical structure, C77H124N24O17S, CAS 123148-51-6
H-Arg-Pro-Lys-Pro-Gln-Gln-Phe-Phe-Gly-Leu-Met-Gly-Lys-Arg-OH
CAS 123148-51-6C77H124N24O17S
H-Arg-Pro-Lys-Pro-Gln-Gln-Phe-N(Me)Phe-Sar-Leu-Met-NH2 chemical structure, C65H102N18O13S, CAS 77128-76-8
H-Arg-Pro-Lys-Pro-Gln-Gln-Phe-N(Me)Phe-Sar-Leu-Met-NH2
CAS 77128-76-8C65H102N18O13S