CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 19 atoms

19 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
19
Chemicals
19
With full pages
7
Scaffold SMILES

O=C1CCC2C(=CCC3C4CCCC4CC(=O)C23)C1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C1CCC2C(=CCC3C4CCCC4CC(=O)C23)C1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 19 of 19 chemicals

Dihydroelatericin A chemical structure, C30H46O7, CAS 990-83-0
Dihydroelatericin A
CAS 990-83-0C30H46O7
Cucurbitacin R chemical structure, C30H46O7, CAS 55903-92-9
Cucurbitacin R
CAS 55903-92-9C30H46O7
Dihydrocucurbitacin B chemical structure, C32H48O8, CAS 13201-14-4
Dihydrocucurbitacin B
CAS 13201-14-4C32H48O8
Cucurbitacin H chemical structure, C30H46O8, CAS 751-96-2
Cucurbitacin H
CAS 751-96-2C30H46O8
2,16-Dihydroxy-4,4,9,13,14-pentamethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione chemical structure, C30H46O8, CAS 751-95-1
2,16-Dihydroxy-4,4,9,13,14-pentamethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-2,7,8,10,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,11-dione
CAS 751-95-1C30H46O8
Cucurbitacin A chemical structure, C32H46O9, CAS 6040-19-3
Cucurbitacin A
CAS 6040-19-3C32H46O9
(+)-Cucurbitacin B chemical structure, C32H46O8, CAS 6199-67-3
(+)-Cucurbitacin B
CAS 6199-67-3C32H46O8
Cucurbitacin D chemical structure, C30H44O7, CAS 3877-86-9
Cucurbitacin D
CAS 3877-86-9C30H44O7
Fabacein chemical structure, C34H48O9, CAS 37710-13-7
Fabacein
CAS 37710-13-7C34H48O9
22-Deoxocucurbitacin D chemical structure, C30H46O6, CAS 15371-78-5
22-Deoxocucurbitacin D
CAS 15371-78-5C30H46O6
Cucurbitacin BE chemical structure, C64H90O16, CAS 100014-94-6
Cucurbitacin BE
CAS 100014-94-6C64H90O16
Diacetyl-2,16 cucurbitacine (D) chemical structure, C34H48O9, CAS 3520-11-4
Diacetyl-2,16 cucurbitacine (D)
CAS 3520-11-4C34H48O9
Cucurbitacin B 2-sulfate chemical structure, C32H46O11S, CAS 923262-06-0
Cucurbitacin B 2-sulfate
CAS 923262-06-0C32H46O11S
16-Deoxycucurbitacin B chemical structure, C32H46O7, CAS 918955-89-2
16-Deoxycucurbitacin B
CAS 918955-89-2C32H46O7
2-Deoxycucurbitacin D chemical structure, C30H44O6, CAS 639069-21-9
2-Deoxycucurbitacin D
CAS 639069-21-9C30H44O6
25-Deacetylcucurbitacin A chemical structure, C30H44O8, CAS 1135141-77-3
25-Deacetylcucurbitacin A
CAS 1135141-77-3C30H44O8
7beta-hydroxycucurbitacin B chemical structure, C32H46O9, CAS 1135141-79-5
7beta-hydroxycucurbitacin B
CAS 1135141-79-5C32H46O9
Hexanorcucurbitacin D chemical structure, C24H34O5, CAS 29065-05-2
Hexanorcucurbitacin D
CAS 29065-05-2C24H34O5
2-Epicucurbitacin B chemical structure, C32H46O8, CAS 59015-72-4
2-Epicucurbitacin B
CAS 59015-72-4C32H46O8