CompoundList
Sign in
Murcko scaffold

9,10-Ergolene scaffold

146 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
16
Chemicals
146
With full pages
35
Scaffold SMILES

C1=C2c3cccc4[nH]cc(c34)CC2NCC1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the 9,10-Ergolene page
Murcko scaffold C1=C2c3cccc4[nH]cc(c34)CC2NCC1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 48 of 146 chemicals

S-(-)-Lisuride chemical structure, C20H26N4O, CAS 860177-23-7
S-(-)-Lisuride
CAS 860177-23-7C20H26N4O
Isomethergine chemical structure, C20H25N3O2, CAS 54808-91-2
Isomethergine
CAS 54808-91-2C20H25N3O2
(+)-Lysergic acid diethylamide chemical structure, C20H25N3O, CAS 50-37-3
(+)-Lysergic acid diethylamide
CAS 50-37-3C20H25N3O
Lysergic acid chemical structure, C16H16N2O2, CAS 82-58-6
Lysergic acid
CAS 82-58-6C16H16N2O2
Methylergometrine chemical structure, C20H25N3O2, CAS 113-42-8
Methylergometrine
CAS 113-42-8C20H25N3O2
Methysergide chemical structure, C21H27N3O2, CAS 361-37-5
Methysergide
CAS 361-37-5C21H27N3O2
Bromolysergide chemical structure, C20H24BrN3O, CAS 478-84-2
Bromolysergide
CAS 478-84-2C20H24BrN3O
Lysergol chemical structure, C16H18N2O, CAS 602-85-7
Lysergol
CAS 602-85-7C16H18N2O
Lisuride chemical structure, C20H26N4O, CAS 18016-80-3
Lisuride
CAS 18016-80-3C20H26N4O
Bromerguride chemical structure, C20H25BrN4O, CAS 83455-48-5
Bromerguride
CAS 83455-48-5C20H25BrN4O
N-(1-Hydroxybutan-2-yl)-6-methyl-9,10-didehydroergoline-8beta-carboximidic acid chemical structure, C20H25N3O2, CAS 20313-98-8
N-(1-Hydroxybutan-2-yl)-6-methyl-9,10-didehydroergoline-8beta-carboximidic acid
CAS 20313-98-8C20H25N3O2
(8alpha)-9,10-Didehydro-8-hydroxy-6-methylergoline-8-methanol chemical structure, C16H18N2O2, CAS 519-13-1
(8alpha)-9,10-Didehydro-8-hydroxy-6-methylergoline-8-methanol
CAS 519-13-1C16H18N2O2
N(1)-methyl-2-iodo-lysergic acid diethylamide chemical structure, C21H26IN3O, CAS 97165-34-9
N(1)-methyl-2-iodo-lysergic acid diethylamide
CAS 97165-34-9C21H26IN3O
2-Butyllysergamide chemical structure, C20H25N3O, CAS 137765-82-3
2-Butyllysergamide
CAS 137765-82-3C20H25N3O
Lysergic acid alpha-hydroxyethylamide chemical structure, C18H21N3O2, CAS 3343-15-5
Lysergic acid alpha-hydroxyethylamide
CAS 3343-15-5C18H21N3O2
1-Methyllysergol methyl ether chemical structure, C18H22N2O, CAS 87633-43-0
1-Methyllysergol methyl ether
CAS 87633-43-0C18H22N2O
2-Iodolysergic acid diethylamide chemical structure, C20H24IN3O, CAS 3712-25-2
2-Iodolysergic acid diethylamide
CAS 3712-25-2C20H24IN3O
1-Methyllysergic acid butanolamide chemical structure, C21H27N3O2, CAS 4238-82-8
1-Methyllysergic acid butanolamide
CAS 4238-82-8C21H27N3O2
Lysergic acid diethylamide tartrate chemical structure, C24H31N3O7, CAS 113-41-7
Lysergic acid diethylamide tartrate
CAS 113-41-7C24H31N3O7
Lek 8804 chemical structure, C20H21N3O, CAS 153415-44-2
Lek 8804
CAS 153415-44-2C20H21N3O
Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-1,6-dimethyl-, (8beta)- chemical structure, C21H27N3O, CAS 4238-85-1
Ergoline-8-carboxamide, 9,10-didehydro-N,N-diethyl-1,6-dimethyl-, (8beta)-
CAS 4238-85-1C21H27N3O
N-Demethyl-LSD chemical structure, C19H23N3O, CAS 35779-43-2
N-Demethyl-LSD
CAS 35779-43-2C19H23N3O
N(1)-Methyl-2-bromo-lysergic acid diethylamide chemical structure, C21H26BrN3O, CAS 50484-98-5
N(1)-Methyl-2-bromo-lysergic acid diethylamide
CAS 50484-98-5C21H26BrN3O
Ergoline-8-methanol, 2-bromo-9,10-didehydro-6-methyl-, (8beta)- chemical structure, C16H17BrN2O, CAS 101769-98-6
Ergoline-8-methanol, 2-bromo-9,10-didehydro-6-methyl-, (8beta)-
CAS 101769-98-6C16H17BrN2O