CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 19 atoms

22 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
19
Chemicals
22
With full pages
7
Scaffold SMILES

O=C1C(=O)c2c(ccc3c2CCCC3)-c2occc21

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C1C(=O)c2c(ccc3c2CCCC3)-c2occc21

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 22 of 22 chemicals

Tanshinone iia sulfonic acid chemical structure, C19H18O6S, CAS 105937-56-2
Tanshinone iia sulfonic acid
CAS 105937-56-2C19H18O6S
Tanshinol B chemical structure, C18H16O4, CAS 189290-30-0
Tanshinol B
CAS 189290-30-0C18H16O4
Tanshindiol C chemical structure, C18H16O5, CAS 97465-71-9
Tanshindiol C
CAS 97465-71-9C18H16O5
Przewaquinone F chemical structure, C18H16O5, CAS 96839-31-5
Przewaquinone F
CAS 96839-31-5C18H16O5
Tanshinone iia chemical structure, C19H18O3, CAS 568-72-9
Tanshinone iia
CAS 568-72-9C19H18O3
Phenanthro(1,2-b)furan-10,11-dione, 6,7,8,9-tetrahydro-1,6,6-trimethyl-, sodium salt (1:1) chemical structure, C19H18NaO3+, CAS 92202-52-3
Phenanthro(1,2-b)furan-10,11-dione, 6,7,8,9-tetrahydro-1,6,6-trimethyl-, sodium salt (1:1)
CAS 92202-52-3C19H18NaO3+
Tanshinone iib chemical structure, C19H18O4, CAS 17397-93-2
Tanshinone iib
CAS 17397-93-2C19H18O4
Przewaquinone A chemical structure, C19H18O4, CAS 76843-23-7
Przewaquinone A
CAS 76843-23-7C19H18O4
Methuyl tanshinonate chemical structure, C20H18O5, CAS 135355-72-5
Methuyl tanshinonate
CAS 135355-72-5C20H18O5
Hydroxytanshinone IIA chemical structure, C19H18O4, CAS 18887-18-8
Hydroxytanshinone IIA
CAS 18887-18-8C19H18O4
(±)-Tanshindiol A chemical structure, C18H16O5, CAS 143167-14-0
(±)-Tanshindiol A
CAS 143167-14-0C18H16O5
Tanshindiol B chemical structure, C18H16O5, CAS 97465-70-8
Tanshindiol B
CAS 97465-70-8C18H16O5
(6S)-6,7,8,9-Tetrahydro-6-hydroxy-6-hydroxymethyl-1-methylphenanthro(1,2-b)furan-10,11-dione chemical structure, C18H16O5, CAS 97411-46-6
(6S)-6,7,8,9-Tetrahydro-6-hydroxy-6-hydroxymethyl-1-methylphenanthro(1,2-b)furan-10,11-dione
CAS 97411-46-6C18H16O5
Methyl tanshinonate chemical structure, C20H18O5, CAS 18887-19-9
Methyl tanshinonate
CAS 18887-19-9C20H18O5
Npc137542 chemical structure, C19H18O4, CAS 97399-71-8
Npc137542
CAS 97399-71-8C19H18O4
6,7,8,9-Tetrahydro-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione chemical structure, C18H16O3, CAS 69659-81-0
6,7,8,9-Tetrahydro-1,6-dimethylphenanthro[1,2-b]furan-10,11-dione
CAS 69659-81-0C18H16O3
Tanshindiol A chemical structure, C18H16O5
Tanshindiol A
C18H16O5
Tanshinone iia sulfonate chemical structure, C19H17NaO6S, CAS 69659-80-9
Tanshinone iia sulfonate
CAS 69659-80-9C19H17NaO6S
Przewaquinone C chemical structure, C18H16O4, CAS 96839-29-1
Przewaquinone C
CAS 96839-29-1C18H16O4
Sodium methyl tanshinonate sulfonate chemical structure, C20H17NaO8S, CAS 1254107-11-3
Sodium methyl tanshinonate sulfonate
CAS 1254107-11-3C20H17NaO8S
Ganxintriol A chemical structure, C18H16O6, CAS 1354747-30-0
Ganxintriol A
CAS 1354747-30-0C18H16O6
1,6,6-Trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-carboxylic acid chemical structure, C20H18O5, CAS 937261-96-6
1,6,6-Trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-carboxylic acid
CAS 937261-96-6C20H18O5