CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 21 atoms

21 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
21
Chemicals
21
With full pages
12
Scaffold SMILES

O=C1c2ccccc2C(=O)c2c1ccc1c2C(=O)CCC1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C1c2ccccc2C(=O)c2c1ccc1c2C(=O)CCC1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 21 of 21 chemicals

Fujianmycin A chemical structure, C19H14O5, CAS 96695-57-7
Fujianmycin A
CAS 96695-57-7C19H14O5
(3s,4r)-4-Hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione chemical structure, C20H16O5, CAS 96695-58-8
(3s,4r)-4-Hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione
CAS 96695-58-8C20H16O5
2,3,8-Trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione chemical structure, C19H14O6, CAS 102674-89-5
2,3,8-Trihydroxy-3-methyl-2,4-dihydrobenzo[a]anthracene-1,7,12-trione
CAS 102674-89-5C19H14O6
Hatomarubigin B chemical structure, C20H16O5, CAS 139501-91-0
Hatomarubigin B
CAS 139501-91-0C20H16O5
Hatomarubigin A chemical structure, C20H16O5, CAS 139562-86-0
Hatomarubigin A
CAS 139562-86-0C20H16O5
3,4-Dihydro-3,8-dihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione chemical structure, C19H14O5, CAS 188399-35-1
3,4-Dihydro-3,8-dihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione
CAS 188399-35-1C19H14O5
3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione chemical structure, C19H14O6, CAS 155748-62-2
3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione
CAS 155748-62-2C19H14O6
(-)-3,4-Dihydro-3,6-dihydroxy-8-methoxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione chemical structure, C20H16O6, CAS 117620-88-9
(-)-3,4-Dihydro-3,6-dihydroxy-8-methoxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione
CAS 117620-88-9C20H16O6
Sta-21 chemical structure, C19H14O4, CAS 111540-00-2
Sta-21
CAS 111540-00-2C19H14O4
(3R)-3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione chemical structure, C19H14O6, CAS 28399-50-0
(3R)-3,4-Dihydro-3,6,8-trihydroxy-3-methylbenz(a)anthracene-1,7,12(2H)-trione
CAS 28399-50-0C19H14O6
Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-8-methoxy-3-methyl- chemical structure, C20H16O4, CAS 56630-78-5
Benz[a]anthracene-1,7,12(2H)-trione, 3,4-dihydro-8-methoxy-3-methyl-
CAS 56630-78-5C20H16O4
Rubiginone A2 chemical structure, C20H16O5
Rubiginone A2
C20H16O5
8-O-Methyltetrangomycin chemical structure, C20H16O5, CAS 117620-87-8
8-O-Methyltetrangomycin
CAS 117620-87-8C20H16O5
YM 181741 chemical structure, C19H14O5, CAS 320385-54-4
YM 181741
CAS 320385-54-4C19H14O5
Rubiginone D2 chemical structure, C20H16O6, CAS 274913-71-2
Rubiginone D2
CAS 274913-71-2C20H16O6
6-Hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione chemical structure, C20H16O5, CAS 179949-47-4
6-Hydroxy-8-methoxy-3-methyl-3,4-dihydrotetraphene-1,7,12(2H)-trione
CAS 179949-47-4C20H16O5
Rubiginone B2 chemical structure, C20H16O4, CAS 130548-10-6
Rubiginone B2
CAS 130548-10-6C20H16O4
Fujianmycin B chemical structure, C20H16O5, CAS 130548-09-3
Fujianmycin B
CAS 130548-09-3C20H16O5
(-)-Tetrangomycin chemical structure, C19H14O5, CAS 7351-08-8
(-)-Tetrangomycin
CAS 7351-08-8C19H14O5
Ochromycinone chemical structure, C19H14O4, CAS 28882-53-3
Ochromycinone
CAS 28882-53-3C19H14O4
Fujianmycin C chemical structure, C20H16O6, CAS 1338554-02-1
Fujianmycin C
CAS 1338554-02-1C20H16O6