CompoundList
Sign in
Murcko scaffold

Diphenylphosphine oxide scaffold

439 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
14
Chemicals
439
With full pages
34
Scaffold SMILES

O=[PH](c1ccccc1)c1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Diphenylphosphine oxide page
Murcko scaffold O=[PH](c1ccccc1)c1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 48 of 439 chemicals

Diphenylphosphinic acid chemical structure, C12H11O2P, CAS 1707-03-5
Diphenylphosphinic acid
CAS 1707-03-5C12H11O2P
Gidifen chemical structure, C14H15N2O2P, CAS 16543-10-5
Gidifen
CAS 16543-10-5C14H15N2O2P
P,P-Bis(3-nitrophenyl)phosphinic acid chemical structure, C12H9N2O6P, CAS 18593-20-9
P,P-Bis(3-nitrophenyl)phosphinic acid
CAS 18593-20-9C12H9N2O6P
Diphenylphosphinic chloride chemical structure, C12H10ClOP, CAS 1499-21-4
Diphenylphosphinic chloride
CAS 1499-21-4C12H10ClOP
Ethyldiphenylphosphine oxide chemical structure, C14H15OP, CAS 1733-57-9
Ethyldiphenylphosphine oxide
CAS 1733-57-9C14H15OP
Methyldiphenylphosphine oxide chemical structure, C13H13OP, CAS 2129-89-7
Methyldiphenylphosphine oxide
CAS 2129-89-7C13H13OP
(1-Methylethyl)diphenylphosphine oxide chemical structure, C15H17OP, CAS 2959-75-3
(1-Methylethyl)diphenylphosphine oxide
CAS 2959-75-3C15H17OP
(Methoxymethyl)diphenylphosphine oxide chemical structure, C14H15O2P, CAS 4455-77-0
(Methoxymethyl)diphenylphosphine oxide
CAS 4455-77-0C14H15O2P
Bis(m-bromophenyl)phosphinic acid chemical structure, C12H9Br2O2P, CAS 5435-75-6
Bis(m-bromophenyl)phosphinic acid
CAS 5435-75-6C12H9Br2O2P
Phosphinic acid, (m-chlorophenyl)phenyl- chemical structure, C12H10ClO2P, CAS 5435-76-7
Phosphinic acid, (m-chlorophenyl)phenyl-
CAS 5435-76-7C12H10ClO2P
Phosphinic acid, (m-nitrophenyl)phenyl- chemical structure, C12H10NO4P, CAS 5435-77-8
Phosphinic acid, (m-nitrophenyl)phenyl-
CAS 5435-77-8C12H10NO4P
Phosphinic acid, (p-nitrophenyl)phenyl- chemical structure, C12H10NO4P, CAS 5435-78-9
Phosphinic acid, (p-nitrophenyl)phenyl-
CAS 5435-78-9C12H10NO4P
P,P-Bis(4-aminophenyl)phosphinic acid chemical structure, C12H13N2O2P, CAS 26848-77-1
P,P-Bis(4-aminophenyl)phosphinic acid
CAS 26848-77-1C12H13N2O2P
2,2,2-Trichloro-1-((3-chlorophenyl)(phenyl)phosphoryl)ethan-1-ol chemical structure, C14H11Cl4O2P, CAS 73927-24-9
2,2,2-Trichloro-1-((3-chlorophenyl)(phenyl)phosphoryl)ethan-1-ol
CAS 73927-24-9C14H11Cl4O2P
3-(Diphenylphosphoryl)-N,N-dimethylpropan-1-amine chemical structure, C17H22NOP, CAS 962-95-8
3-(Diphenylphosphoryl)-N,N-dimethylpropan-1-amine
CAS 962-95-8C17H22NOP
Allyldiphenylphosphine oxide chemical structure, C15H15OP, CAS 4141-48-4
Allyldiphenylphosphine oxide
CAS 4141-48-4C15H15OP
Phosphinic acid, diphenyl-, 2,2-dichlorovinyl ester chemical structure, C14H11Cl2O2P, CAS 95028-66-3
Phosphinic acid, diphenyl-, 2,2-dichlorovinyl ester
CAS 95028-66-3C14H11Cl2O2P
P,P-Diphenylphosphinic azide chemical structure, C12H10N3OP, CAS 4129-17-3
P,P-Diphenylphosphinic azide
CAS 4129-17-3C12H10N3OP
Phosphine oxide, butyldiphenyl- chemical structure, C16H19OP, CAS 4233-13-0
Phosphine oxide, butyldiphenyl-
CAS 4233-13-0C16H19OP
Phosphine oxide, diphenylpropyl- chemical structure, C15H17OP, CAS 4252-88-4
Phosphine oxide, diphenylpropyl-
CAS 4252-88-4C15H17OP
Phosphinic acid, bis(4-chlorophenyl)- chemical structure, C12H9Cl2O2P, CAS 13119-01-2
Phosphinic acid, bis(4-chlorophenyl)-
CAS 13119-01-2C12H9Cl2O2P
Phosphine oxide, diphenyl(3-methylbutyl)- chemical structure, C17H21OP, CAS 46941-66-6
Phosphine oxide, diphenyl(3-methylbutyl)-
CAS 46941-66-6C17H21OP
Phosphine oxide, diphenyloctyl- chemical structure, C20H27OP, CAS 29701-85-7
Phosphine oxide, diphenyloctyl-
CAS 29701-85-7C20H27OP
Phosphine oxide, (diethoxymethyl)diphenyl- chemical structure, C17H21O3P, CAS 20570-20-1
Phosphine oxide, (diethoxymethyl)diphenyl-
CAS 20570-20-1C17H21O3P