CompoundList
Sign in
Murcko scaffold

Uric acid scaffold

47 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
12
Chemicals
47
With full pages
15
Scaffold SMILES

O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Uric acid page
Murcko scaffold O=c1[nH]c(=O)c2[nH]c(=O)[nH]c2[nH]1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 47 of 47 chemicals

Uric acid chemical structure, C5H4N4O3, CAS 69-93-2
Uric acid
CAS 69-93-2C5H4N4O3
3-Methyluric acid chemical structure, C6H6N4O3, CAS 605-99-2
3-Methyluric acid
CAS 605-99-2C6H6N4O3
7-Methyluric acid chemical structure, C6H6N4O3, CAS 612-37-3
7-Methyluric acid
CAS 612-37-3C6H6N4O3
1-Methyluric acid chemical structure, C6H6N4O3, CAS 708-79-2
1-Methyluric acid
CAS 708-79-2C6H6N4O3
1,3-Dimethyluric acid chemical structure, C7H8N4O3, CAS 944-73-0
1,3-Dimethyluric acid
CAS 944-73-0C7H8N4O3
Theacrine chemical structure, C9H12N4O3, CAS 2309-49-1
Theacrine
CAS 2309-49-1C9H12N4O3
1,3,7-Trimethyluric acid chemical structure, C8H10N4O3, CAS 5415-44-1
1,3,7-Trimethyluric acid
CAS 5415-44-1C8H10N4O3
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, ammonium salt (1:1) chemical structure, C5H7N5O3, CAS 6009-66-1
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, ammonium salt (1:1)
CAS 6009-66-1C5H7N5O3
7,9-Dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione chemical structure, C8H10N4O3, CAS 7464-93-9
7,9-Dihydro-1,3,9-trimethyl-1H-purine-2,6,8(3H)-trione
CAS 7464-93-9C8H10N4O3
3,7-Dimethyluric acid chemical structure, C7H8N4O3, CAS 13087-49-5
3,7-Dimethyluric acid
CAS 13087-49-5C7H8N4O3
7,9-Dihydro-7,9-dimethyl-1H-purine-2,6,8(3H)-trione chemical structure, C7H8N4O3, CAS 19039-41-9
7,9-Dihydro-7,9-dimethyl-1H-purine-2,6,8(3H)-trione
CAS 19039-41-9C7H8N4O3
1,7-Dimethyluric acid chemical structure, C7H8N4O3, CAS 33868-03-0
1,7-Dimethyluric acid
CAS 33868-03-0C7H8N4O3
9-Ethyl-1,3,7-trimethyluric acid chemical structure, C10H14N4O3, CAS 6287-59-8
9-Ethyl-1,3,7-trimethyluric acid
CAS 6287-59-8C10H14N4O3
9-Allyl-1,3,7-trimethyluric acid chemical structure, C11H14N4O3, CAS 6287-61-2
9-Allyl-1,3,7-trimethyluric acid
CAS 6287-61-2C11H14N4O3
1,9-Dimethyluric acid chemical structure, C7H8N4O3, CAS 55441-62-8
1,9-Dimethyluric acid
CAS 55441-62-8C7H8N4O3
7,9-Dihydro-3,9-dimethyl-1H-purine-2,6,8(3H)-trione chemical structure, C7H8N4O3, CAS 55441-63-9
7,9-Dihydro-3,9-dimethyl-1H-purine-2,6,8(3H)-trione
CAS 55441-63-9C7H8N4O3
9-Methyluric acid chemical structure, C6H6N4O3, CAS 55441-71-9
9-Methyluric acid
CAS 55441-71-9C6H6N4O3
7,9-Dihydro-3,7,9-trimethyl-1H-purine-2,6,8(3H)-trione chemical structure, C8H10N4O3, CAS 55441-72-0
7,9-Dihydro-3,7,9-trimethyl-1H-purine-2,6,8(3H)-trione
CAS 55441-72-0C8H10N4O3
1H-Purine-2,6,8(3H)-trione, 7,9-dihydrotris(hydroxymethyl)- chemical structure, C8H10N4O6, CAS 73905-11-0
1H-Purine-2,6,8(3H)-trione, 7,9-dihydrotris(hydroxymethyl)-
CAS 73905-11-0C8H10N4O6
1H-Purine-2,6,8(3H)-trione, 7,9-dihydrobis(hydroxymethyl)- chemical structure, C7H8N4O5, CAS 71042-81-4
1H-Purine-2,6,8(3H)-trione, 7,9-dihydrobis(hydroxymethyl)-
CAS 71042-81-4C7H8N4O5
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-1,3,7,9-tetrakis(hydroxymethyl)- chemical structure, C9H12N4O7, CAS 71042-92-7
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-1,3,7,9-tetrakis(hydroxymethyl)-
CAS 71042-92-7C9H12N4O7
3-Hydroxyuric acid chemical structure, C5H4N4O4, CAS 22151-75-3
3-Hydroxyuric acid
CAS 22151-75-3C5H4N4O4
1,3-Dimethyl-7-(3-methylbutyl)-9H-purine-2,6,8-trione chemical structure, C12H18N4O3, CAS 662155-21-7
1,3-Dimethyl-7-(3-methylbutyl)-9H-purine-2,6,8-trione
CAS 662155-21-7C12H18N4O3
1,7,9-Trimethyl-3H-purine-2,6,8-trione chemical structure, C8H10N4O3, CAS 55441-64-0
1,7,9-Trimethyl-3H-purine-2,6,8-trione
CAS 55441-64-0C8H10N4O3