CompoundList
Sign in
Murcko scaffold

Dibenzyl pentanedioate scaffold

30 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
23
Chemicals
30
With full pages
4
Scaffold SMILES

O=C(CCCC(=O)OCc1ccccc1)OCc1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Dibenzyl pentanedioate page
Murcko scaffold O=C(CCCC(=O)OCc1ccccc1)OCc1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 30 of 30 chemicals

(S)-Dibenzyl 2-aminopentanedioate hydrochloride chemical structure, C19H22ClNO4, CAS 4561-10-8
(S)-Dibenzyl 2-aminopentanedioate hydrochloride
CAS 4561-10-8C19H22ClNO4
Dibenzyl 2-aminopentanedioate chemical structure, C19H21NO4, CAS 69408-26-0
Dibenzyl 2-aminopentanedioate
CAS 69408-26-0C19H21NO4
L-Glutamic acid dibenzyl ester chemical structure, C19H21NO4, CAS 2768-50-5
L-Glutamic acid dibenzyl ester
CAS 2768-50-5C19H21NO4
Dibenzyl pentanedioate chemical structure, C19H20O4, CAS 56977-08-3
Dibenzyl pentanedioate
CAS 56977-08-3C19H20O4
(R)-Dibenzyl 2-aminopentanedioate chemical structure, C19H21NO4, CAS 47376-46-5
(R)-Dibenzyl 2-aminopentanedioate
CAS 47376-46-5C19H21NO4
1,5-Dibenzyl (2S)-2-(methylamino)pentanedioate chemical structure, C20H23NO4, CAS 146963-41-9
1,5-Dibenzyl (2S)-2-(methylamino)pentanedioate
CAS 146963-41-9C20H23NO4
L-Glutamic acid dibenzyl ester tosylate chemical structure, C26H29NO7S, CAS 2791-84-6
L-Glutamic acid dibenzyl ester tosylate
CAS 2791-84-6C26H29NO7S
H-Glu(obzl)-obzl P-tosylate chemical structure, C26H29NO7S, CAS 227205-81-4
H-Glu(obzl)-obzl P-tosylate
CAS 227205-81-4C26H29NO7S
Boc-L-glutamic acid dibenzyl ester chemical structure, C24H29NO6, CAS 80963-14-0
Boc-L-glutamic acid dibenzyl ester
CAS 80963-14-0C24H29NO6
Dibenzyl 2,4-dibromoglutarate chemical structure, C19H18Br2O4, CAS 121050-01-9
Dibenzyl 2,4-dibromoglutarate
CAS 121050-01-9C19H18Br2O4
4-(Benzyloxy)-2-[2-(benzyloxy)-2-oxoethyl]-4-oxo-2-(phosphonooxy)butanoic acid chemical structure, C20H21O10P, CAS 161912-07-8
4-(Benzyloxy)-2-[2-(benzyloxy)-2-oxoethyl]-4-oxo-2-(phosphonooxy)butanoic acid
CAS 161912-07-8C20H21O10P
1,5-Dibenzyl 2-aminopentanedioate hydrochloride chemical structure, C19H22ClNO4, CAS 2828432-29-5
1,5-Dibenzyl 2-aminopentanedioate hydrochloride
CAS 2828432-29-5C19H22ClNO4
H-D-Glu(obzl)-obzl P-tosylate chemical structure, C26H29NO7S, CAS 19898-41-0
H-D-Glu(obzl)-obzl P-tosylate
CAS 19898-41-0C26H29NO7S
(R)-Dibenzyl 2-aminopentanedioate hydrochloride chemical structure, C19H22ClNO4, CAS 146844-02-2
(R)-Dibenzyl 2-aminopentanedioate hydrochloride
CAS 146844-02-2C19H22ClNO4
Dibenzyl N-(N-hexadecanoyl-L-valyl)-L-glutamate chemical structure, C40H60N2O6, CAS 88556-80-3
Dibenzyl N-(N-hexadecanoyl-L-valyl)-L-glutamate
CAS 88556-80-3C40H60N2O6
Dibenzyl N-(N-triacontanoyl-L-valyl)-L-glutamate chemical structure, C54H88N2O6, CAS 88556-84-7
Dibenzyl N-(N-triacontanoyl-L-valyl)-L-glutamate
CAS 88556-84-7C54H88N2O6
Dibenzyl N-(N-butanoyl-L-valyl)-L-glutamate chemical structure, C28H36N2O6, CAS 88556-76-7
Dibenzyl N-(N-butanoyl-L-valyl)-L-glutamate
CAS 88556-76-7C28H36N2O6
Dibenzyl N-(N-docosanoyl-L-valyl)-L-glutamate chemical structure, C46H72N2O6, CAS 88556-82-5
Dibenzyl N-(N-docosanoyl-L-valyl)-L-glutamate
CAS 88556-82-5C46H72N2O6
Dibenzyl N-(N-octanoyl-L-valyl)-L-glutamate chemical structure, C32H44N2O6, CAS 88556-78-9
Dibenzyl N-(N-octanoyl-L-valyl)-L-glutamate
CAS 88556-78-9C32H44N2O6
Dibenzyl L-alanyl-L-glutamate chemical structure, C22H26N2O5, CAS 87063-91-0
Dibenzyl L-alanyl-L-glutamate
CAS 87063-91-0C22H26N2O5
Dibenzyl N-(4,5-dihydroxypentanoyl)-L-glutamate chemical structure, C24H29NO7, CAS 915193-98-5
Dibenzyl N-(4,5-dihydroxypentanoyl)-L-glutamate
CAS 915193-98-5C24H29NO7
Dibenzyl N-pent-4-enoyl-L-glutamate chemical structure, C24H27NO5, CAS 915193-97-4
Dibenzyl N-pent-4-enoyl-L-glutamate
CAS 915193-97-4C24H27NO5
Citric acid 1,3-dibenzylester chemical structure, C20H20O7, CAS 101996-62-7
Citric acid 1,3-dibenzylester
CAS 101996-62-7C20H20O7
Dibenzyl L-glutamate hydrate chemical structure, C19H23NO5, CAS 2324871-39-6
Dibenzyl L-glutamate hydrate
CAS 2324871-39-6C19H23NO5