CompoundList
Sign in
Murcko scaffold

Ring system with 3 rings and 20 atoms

31 chemicals on CompoundList share this ring system.

Rings
3
Scaffold atoms
20
Chemicals
31
With full pages
10
Scaffold SMILES

O=C(C=Cc1ccccc1)c1ccc2c(c1)C=CCO2

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C(C=Cc1ccccc1)c1ccc2c(c1)C=CCO2

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 31 of 31 chemicals

Bavachromene chemical structure, C20H18O4, CAS 41743-38-8
Bavachromene
CAS 41743-38-8C20H18O4
4-Hydroxylonchocarpin chemical structure, C20H18O4, CAS 56083-03-5
4-Hydroxylonchocarpin
CAS 56083-03-5C20H18O4
Lonchocarpin chemical structure, C20H18O3, CAS 31501-55-0
Lonchocarpin
CAS 31501-55-0C20H18O3
Demethylpraecanson B chemical structure, C21H20O5, CAS 74517-66-1
Demethylpraecanson B
CAS 74517-66-1C21H20O5
Praecansone B chemical structure, C22H22O5, CAS 74517-75-2
Praecansone B
CAS 74517-75-2C22H22O5
Xanthohumol C chemical structure, C21H20O5, CAS 189299-05-6
Xanthohumol C
CAS 189299-05-6C21H20O5
Munsericin chemical structure, C20H18O4, CAS 158991-21-0
Munsericin
CAS 158991-21-0C20H18O4
4-Methoxylonchocarpin chemical structure, C21H20O4, CAS 51589-67-4
4-Methoxylonchocarpin
CAS 51589-67-4C21H20O4
Pongachalcone I chemical structure, C21H20O4, CAS 41724-53-2
Pongachalcone I
CAS 41724-53-2C21H20O4
Flemichapparin A chemical structure, C20H18O4, CAS 32507-61-2
Flemichapparin A
CAS 32507-61-2C20H18O4
(2E)-3-(2,4-Dihydroxyphenyl)-1-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-2-propen-1-one chemical structure, C20H18O5, CAS 882305-50-2
(2E)-3-(2,4-Dihydroxyphenyl)-1-(5-hydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)-2-propen-1-one
CAS 882305-50-2C20H18O5
Mallotus A chemical structure, C20H18O5, CAS 116107-14-3
Mallotus A
CAS 116107-14-3C20H18O5
Ponganone I chemical structure, C22H22O5, CAS 137031-54-0
Ponganone I
CAS 137031-54-0C22H22O5
Ponganone VI chemical structure, C23H24O6, CAS 142608-92-2
Ponganone VI
CAS 142608-92-2C23H24O6
Glychalcone A chemical structure, C22H22O5, CAS 143885-75-0
Glychalcone A
CAS 143885-75-0C22H22O5
Glychalcone B chemical structure, C23H24O6, CAS 143885-76-1
Glychalcone B
CAS 143885-76-1C23H24O6
3,4-Dimethoxylonchocarpin chemical structure, C22H22O5, CAS 179003-85-1
3,4-Dimethoxylonchocarpin
CAS 179003-85-1C22H22O5
Oaxacacin chemical structure, C21H20O4, CAS 88509-90-4
Oaxacacin
CAS 88509-90-4C21H20O4
Flemingin A chemical structure, C25H26O5, CAS 18296-58-7
Flemingin A
CAS 18296-58-7C25H26O5
Flemingin B chemical structure, C25H26O6, CAS 18361-42-7
Flemingin B
CAS 18361-42-7C25H26O6
Flemingin C chemical structure, C25H26O6, CAS 18296-60-1
Flemingin C
CAS 18296-60-1C25H26O6
Orotinichalcone chemical structure, C26H28O6, CAS 108864-19-3
Orotinichalcone
CAS 108864-19-3C26H28O6
Lespeol chemical structure, C25H26O4, CAS 74174-28-0
Lespeol
CAS 74174-28-0C25H26O4
Boesenbergin B chemical structure, C26H28O4, CAS 93208-46-9
Boesenbergin B
CAS 93208-46-9C26H28O4