CompoundList
Sign in
Murcko scaffold

Dibenzyl succinate scaffold

26 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
22
Chemicals
26
With full pages
5
Scaffold SMILES

O=C(CCC(=O)OCc1ccccc1)OCc1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Dibenzyl succinate page
Murcko scaffold O=C(CCC(=O)OCc1ccccc1)OCc1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 26 of 26 chemicals

Dibenzyl succinate chemical structure, C18H18O4, CAS 103-43-5
Dibenzyl succinate
CAS 103-43-5C18H18O4
Bis((2-hydroxy-5-methoxycarbonylphenyl)methyl) butanedioate chemical structure, C22H22O10, CAS 103456-50-4
Bis((2-hydroxy-5-methoxycarbonylphenyl)methyl) butanedioate
CAS 103456-50-4C22H22O10
Bis(4-nitrobenzyl) succinate chemical structure, C18H16N2O8, CAS 58265-86-4
Bis(4-nitrobenzyl) succinate
CAS 58265-86-4C18H16N2O8
Dibenzyl N-(phosphonoacetyl)aspartate chemical structure, C20H22NO8P, CAS 70962-64-0
Dibenzyl N-(phosphonoacetyl)aspartate
CAS 70962-64-0C20H22NO8P
N-(tert-Butoxycarbonyl)-L-valyl-L-aspartic acid dibenzyl ester chemical structure, C28H36N2O7, CAS 70853-19-9
N-(tert-Butoxycarbonyl)-L-valyl-L-aspartic acid dibenzyl ester
CAS 70853-19-9C28H36N2O7
1,2-Bis(benzyloxycarbonyl)ethylammonium toluene-p-sulphonate chemical structure, C25H27NO7S, CAS 4079-62-3
1,2-Bis(benzyloxycarbonyl)ethylammonium toluene-p-sulphonate
CAS 4079-62-3C25H27NO7S
Dibenzyl 2-aminosuccinate chemical structure, C18H19NO4, CAS 4079-61-2
Dibenzyl 2-aminosuccinate
CAS 4079-61-2C18H19NO4
D-Aspartic acid, bis(phenylmethyl) ester chemical structure, C18H19NO4, CAS 4079-59-8
D-Aspartic acid, bis(phenylmethyl) ester
CAS 4079-59-8C18H19NO4
L-Aspartic acid, 1,4-bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1) chemical structure, C25H27NO7S, CAS 2886-33-1
L-Aspartic acid, 1,4-bis(phenylmethyl) ester, 4-methylbenzenesulfonate (1:1)
CAS 2886-33-1C25H27NO7S
(S)-Dibenzyl 2-aminosuccinate chemical structure, C18H19NO4, CAS 2791-79-9
(S)-Dibenzyl 2-aminosuccinate
CAS 2791-79-9C18H19NO4
Dibenzyl 2,3-dihydroxybutanedioate chemical structure, C18H18O6, CAS 93993-87-4
Dibenzyl 2,3-dihydroxybutanedioate
CAS 93993-87-4C18H18O6
5-(Benzyloxy)-3-[(benzyloxy)carbonyl]-3-hydroxy-5-oxopentanoic acid chemical structure, C20H20O7, CAS 184834-44-4
5-(Benzyloxy)-3-[(benzyloxy)carbonyl]-3-hydroxy-5-oxopentanoic acid
CAS 184834-44-4C20H20O7
(2S,3S)-Dibenzyl 2,3-dihydroxysuccinate chemical structure, C18H18O6, CAS 4136-22-5
(2S,3S)-Dibenzyl 2,3-dihydroxysuccinate
CAS 4136-22-5C18H18O6
L-Tartaric acid dibenzyl ester chemical structure, C18H18O6, CAS 622-00-4
L-Tartaric acid dibenzyl ester
CAS 622-00-4C18H18O6
Dibenzyl (2R,3S)-2,3-dihydroxybutanedioate chemical structure, C18H18O6, CAS 4079-57-6
Dibenzyl (2R,3S)-2,3-dihydroxybutanedioate
CAS 4079-57-6C18H18O6
Boc-Asp(Obzl)-Obzl chemical structure, C23H27NO6, CAS 80974-42-1
Boc-Asp(Obzl)-Obzl
CAS 80974-42-1C23H27NO6
L-Aspartic acid, N-(trimethylsilyl)-, bis(phenylmethyl) ester chemical structure, C21H27NO4Si, CAS 72776-06-8
L-Aspartic acid, N-(trimethylsilyl)-, bis(phenylmethyl) ester
CAS 72776-06-8C21H27NO4Si
Dibenzyl 2-hydroxybutanedioate chemical structure, C18H18O5, CAS 56977-10-7
Dibenzyl 2-hydroxybutanedioate
CAS 56977-10-7C18H18O5
Dibenzyl 2-isocyanobutanedioate chemical structure, C19H17NO4, CAS 89099-05-8
Dibenzyl 2-isocyanobutanedioate
CAS 89099-05-8C19H17NO4
D-Aspartic acid dibenzyl ester-p-toluenesulfonate chemical structure, C25H27NO7S, CAS 4079-64-5
D-Aspartic acid dibenzyl ester-p-toluenesulfonate
CAS 4079-64-5C25H27NO7S
H-Asp(obzl)-obzl hcl chemical structure, C18H20ClNO4
H-Asp(obzl)-obzl hcl
C18H20ClNO4
H-Asp(OBzl)-OBzl.HCl chemical structure, C18H20ClNO4, CAS 6327-59-9
H-Asp(OBzl)-OBzl.HCl
CAS 6327-59-9C18H20ClNO4
Sodium, [2-[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]-2-oxoethyl]phosphonic acid chemical structure, C20H22NNaO8P+, CAS 71259-18-2
Sodium, [2-[[1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]-2-oxoethyl]phosphonic acid
CAS 71259-18-2C20H22NNaO8P+
Dibenzyl (2S)-2-formamidobutanedioate chemical structure, C19H19NO5, CAS 89099-20-7
Dibenzyl (2S)-2-formamidobutanedioate
CAS 89099-20-7C19H19NO5