CompoundList
Sign in
Murcko scaffold

Benzoyl peroxide scaffold

84 chemicals on CompoundList share this ring system.

Rings
2
Scaffold atoms
18
Chemicals
84
With full pages
6
Scaffold SMILES

O=C(OOC(=O)c1ccccc1)c1ccccc1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the Benzoyl peroxide page
Murcko scaffold O=C(OOC(=O)c1ccccc1)c1ccccc1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 48 of 84 chemicals

Bis(4-chlorobenzoyl) peroxide chemical structure, C14H8Cl2O4, CAS 94-17-7
Bis(4-chlorobenzoyl) peroxide
CAS 94-17-7C14H8Cl2O4
Benzoyl peroxide chemical structure, C14H10O4, CAS 94-36-0
Benzoyl peroxide
CAS 94-36-0C14H10O4
2,4-Dichlorobenzoyl peroxide chemical structure, C14H6Cl4O4, CAS 133-14-2
2,4-Dichlorobenzoyl peroxide
CAS 133-14-2C14H6Cl4O4
Bis(2-chlorobenzoyl) peroxide chemical structure, C14H8Cl2O4, CAS 3033-73-6
Bis(2-chlorobenzoyl) peroxide
CAS 3033-73-6C14H8Cl2O4
Peroxide, bis(2-methylbenzoyl) chemical structure, C16H14O4, CAS 3034-79-5
Peroxide, bis(2-methylbenzoyl)
CAS 3034-79-5C16H14O4
Bis(4-methylbenzoyl) peroxide chemical structure, C16H14O4, CAS 895-85-2
Bis(4-methylbenzoyl) peroxide
CAS 895-85-2C16H14O4
Katoxyn chemical structure, C14H10AgO4, CAS 99827-21-1
Katoxyn
CAS 99827-21-1C14H10AgO4
Bis(3-chlorobenzoyl) peroxide chemical structure, C14H8Cl2O4, CAS 845-30-7
Bis(3-chlorobenzoyl) peroxide
CAS 845-30-7C14H8Cl2O4
Benzoic acid, 2,2'-(dioxydicarbonyl)bis- chemical structure, C16H10O8, CAS 37051-42-6
Benzoic acid, 2,2'-(dioxydicarbonyl)bis-
CAS 37051-42-6C16H10O8
Bis(4-nitrophenyl)peroxyanhydride chemical structure, C14H8N2O8, CAS 1712-84-1
Bis(4-nitrophenyl)peroxyanhydride
CAS 1712-84-1C14H8N2O8
Peroxide, bis[4-(1,1-dimethylethyl)benzoyl] chemical structure, C22H26O4, CAS 1712-79-4
Peroxide, bis[4-(1,1-dimethylethyl)benzoyl]
CAS 1712-79-4C22H26O4
Peroxide, bis(2,5-dichlorobenzoyl) chemical structure, C14H6Cl4O4, CAS 20358-16-1
Peroxide, bis(2,5-dichlorobenzoyl)
CAS 20358-16-1C14H6Cl4O4
Bis(4-ethylbenzoyl) Peroxide chemical structure, C18H18O4, CAS 625831-11-0
Bis(4-ethylbenzoyl) Peroxide
CAS 625831-11-0C18H18O4
Bis(4-butylbenzoyl) Peroxide chemical structure, C22H26O4, CAS 625831-13-2
Bis(4-butylbenzoyl) Peroxide
CAS 625831-13-2C22H26O4
Bis(4-methoxybenzoyl) peroxide chemical structure, C16H14O6, CAS 849-83-2
Bis(4-methoxybenzoyl) peroxide
CAS 849-83-2C16H14O6
Bis(4-bromobenzoyl) peroxide chemical structure, C14H8Br2O4, CAS 1712-82-9
Bis(4-bromobenzoyl) peroxide
CAS 1712-82-9C14H8Br2O4
Bis(4-fluorobenzoyl) peroxide chemical structure, C14H8F2O4, CAS 582-92-3
Bis(4-fluorobenzoyl) peroxide
CAS 582-92-3C14H8F2O4
Bis(3,5-dinitrobenzoyl) Peroxide chemical structure, C14H6N4O12, CAS 15866-24-7
Bis(3,5-dinitrobenzoyl) Peroxide
CAS 15866-24-7C14H6N4O12
Bis[2-(trifluoromethyl)benzoyl] Peroxide chemical structure, C16H8F6O4, CAS 1764-36-9
Bis[2-(trifluoromethyl)benzoyl] Peroxide
CAS 1764-36-9C16H8F6O4
Bis[3-(trifluoromethyl)benzoyl] Peroxide chemical structure, C16H8F6O4, CAS 1764-35-8
Bis[3-(trifluoromethyl)benzoyl] Peroxide
CAS 1764-35-8C16H8F6O4
Bis[4-(trifluoromethyl)benzoyl] peroxide chemical structure, C16H8F6O4, CAS 1647-85-4
Bis[4-(trifluoromethyl)benzoyl] peroxide
CAS 1647-85-4C16H8F6O4
Bis[4-(trifluoromethoxy)benzoyl] Peroxide chemical structure, C16H8F6O6, CAS 79865-49-9
Bis[4-(trifluoromethoxy)benzoyl] Peroxide
CAS 79865-49-9C16H8F6O6
Bis(m-brombenzoyl)-peroxyd chemical structure, C14H8Br2O4, CAS 1829-88-5
Bis(m-brombenzoyl)-peroxyd
CAS 1829-88-5C14H8Br2O4
Peroxide, bis(pentafluorobenzoyl) chemical structure, C14F10O4, CAS 22236-19-7
Peroxide, bis(pentafluorobenzoyl)
CAS 22236-19-7C14F10O4