CompoundList
Sign in
Murcko scaffold

Ring system with 4 rings and 20 atoms

27 chemicals on CompoundList share this ring system.

Rings
4
Scaffold atoms
20
Chemicals
27
With full pages
6
Scaffold SMILES

O=C1CC2CCC(=O)C2C2=C1C1CCCCC1CC2=O

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold O=C1CC2CCC(=O)C2C2=C1C1CCCCC1CC2=O

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 27 of 27 chemicals

Ganoderic acid C chemical structure, C30H42O7, CAS 95311-97-0
Ganoderic acid C
CAS 95311-97-0C30H42O7
(3beta,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid chemical structure, C30H42O7, CAS 294674-09-2
(3beta,23S,24E)-3,23-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid
CAS 294674-09-2C30H42O7
20-Hydroxylucidenic acid E2 chemical structure, C29H40O9, CAS 852567-75-0
20-Hydroxylucidenic acid E2
CAS 852567-75-0C29H40O9
Chol-8-en-24-oic acid, 3-hydroxy-4-(hydroxymethyl)-4,14-dimethyl-7,11,15-trioxo-, (3beta,4alpha,5alpha)- chemical structure, C27H38O7, CAS 110241-27-5
Chol-8-en-24-oic acid, 3-hydroxy-4-(hydroxymethyl)-4,14-dimethyl-7,11,15-trioxo-, (3beta,4alpha,5alpha)-
CAS 110241-27-5C27H38O7
(E)-6-(3-Hydroxy-4,4,10,13,14-pentamethyl-7,11,15-trioxo-1,2,3,5,6,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid chemical structure, C30H40O7
(E)-6-(3-Hydroxy-4,4,10,13,14-pentamethyl-7,11,15-trioxo-1,2,3,5,6,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid
C30H40O7
Ganoderenic acid H chemical structure, C30H40O7
Ganoderenic acid H
C30H40O7
Ganoderic acid theta chemical structure, C30H42O8, CAS 294674-15-0
Ganoderic acid theta
CAS 294674-15-0C30H42O8
Methyl ganoderate H chemical structure, C33H46O9, CAS 98665-11-3
Methyl ganoderate H
CAS 98665-11-3C33H46O9
Methyl lucidenate E2 chemical structure, C30H42O8, CAS 98665-12-4
Methyl lucidenate E2
CAS 98665-12-4C30H42O8
Methyl ganoderate C6 chemical structure, C31H44O8, CAS 105742-81-2
Methyl ganoderate C6
CAS 105742-81-2C31H44O8
Lucidenic acid E chemical structure, C29H40O8, CAS 98665-17-9
Lucidenic acid E
CAS 98665-17-9C29H40O8
Methyl lucidenate L chemical structure, C28H40O7, CAS 110267-46-4
Methyl lucidenate L
CAS 110267-46-4C28H40O7
Ganoderic acid Am1 chemical structure, C30H42O7, CAS 149507-55-1
Ganoderic acid Am1
CAS 149507-55-1C30H42O7
Ganoderenic acid H chemical structure, C30H40O7, CAS 120462-48-8
Ganoderenic acid H
CAS 120462-48-8C30H40O7
Ganoderic acid H chemical structure, C32H44O9, CAS 98665-19-1
Ganoderic acid H
CAS 98665-19-1C32H44O9
Ganoderenic acid H chemical structure, C30H40O7
Ganoderenic acid H
C30H40O7
Ganoderic acid C6 chemical structure, C30H42O8, CAS 105742-76-5
Ganoderic acid C6
CAS 105742-76-5C30H42O8
Lucidenic acid L chemical structure, C27H38O7
Lucidenic acid L
C27H38O7
Ganoderenic acid C2 chemical structure, C30H40O8, CAS 1961358-00-8
Ganoderenic acid C2
CAS 1961358-00-8C30H40O8
Lucidenic acid L chemical structure, C27H38O7, CAS 110267-45-3
Lucidenic acid L
CAS 110267-45-3C27H38O7
Lucidenic acid L chemical structure, C27H38O7
Lucidenic acid L
C27H38O7
3,20-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid chemical structure, C30H42O7, CAS 150033-91-3
3,20-Dihydroxy-7,11,15-trioxolanosta-8,24-dien-26-oic acid
CAS 150033-91-3C30H42O7
Ganoderenic acid H chemical structure, C30H40O7
Ganoderenic acid H
C30H40O7
12beta-Acetoxy-3beta-hydroxy-7,11,15,23-tetraoxo-lanost-8,20-diene-26-oic acid chemical structure, C32H42O9, CAS 1085338-75-5
12beta-Acetoxy-3beta-hydroxy-7,11,15,23-tetraoxo-lanost-8,20-diene-26-oic acid
CAS 1085338-75-5C32H42O9