CompoundList
Sign in
Murcko scaffold

3-(1H-Indol-3-ylmethyl)piperazine-2,5-dione scaffold

31 chemicals on CompoundList share this ring system.

Rings
3
Scaffold atoms
18
Chemicals
31
With full pages
11
Scaffold SMILES

O=C1CNC(=O)C(Cc2c[nH]c3ccccc23)N1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffoldOpen the 3-(1H-Indol-3-ylmethyl)piperazine-2,5-dione page
Murcko scaffold O=C1CNC(=O)C(Cc2c[nH]c3ccccc23)N1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 31 of 31 chemicals

Echinulin chemical structure, C29H39N3O2, CAS 1859-87-6
Echinulin
CAS 1859-87-6C29H39N3O2
3-(1H-Indol-3-ylmethyl)piperazine-2,5-dione chemical structure, C13H13N3O2, CAS 52997-35-0
3-(1H-Indol-3-ylmethyl)piperazine-2,5-dione
CAS 52997-35-0C13H13N3O2
Polanrazine B chemical structure, C18H23N3O2S2, CAS 394221-00-2
Polanrazine B
CAS 394221-00-2C18H23N3O2S2
Cyclo(L-leucyl-L-tryptophyl) chemical structure, C17H21N3O2, CAS 15136-34-2
Cyclo(L-leucyl-L-tryptophyl)
CAS 15136-34-2C17H21N3O2
Cyclo(-Gly-Trp) chemical structure, C13H13N3O2, CAS 7451-73-2
Cyclo(-Gly-Trp)
CAS 7451-73-2C13H13N3O2
Tardioxopiperazine A chemical structure, C24H31N3O2, CAS 252028-90-3
Tardioxopiperazine A
CAS 252028-90-3C24H31N3O2
Tardioxopiperazine B chemical structure, C24H31N3O2, CAS 252028-91-4
Tardioxopiperazine B
CAS 252028-91-4C24H31N3O2
Polanrazine F chemical structure, C16H19N3O4, CAS 394221-04-6
Polanrazine F
CAS 394221-04-6C16H19N3O4
Polanrazine E chemical structure, C17H21N3O4, CAS 394221-03-5
Polanrazine E
CAS 394221-03-5C17H21N3O4
Polanrazine C chemical structure, C17H21N3O3S, CAS 394221-01-3
Polanrazine C
CAS 394221-01-3C17H21N3O3S
Chetoseminudin B chemical structure, C17H21N3O3S2, CAS 658711-87-6
Chetoseminudin B
CAS 658711-87-6C17H21N3O3S2
Chetoseminudin C chemical structure, C16H19N3O3S2, CAS 658711-88-7
Chetoseminudin C
CAS 658711-88-7C16H19N3O3S2
Polanrazine D chemical structure, C17H21N3O3S, CAS 394221-02-4
Polanrazine D
CAS 394221-02-4C17H21N3O3S
3-(1H-Indol-3-ylmethyl)-6-methyl-2,5-piperazinedione chemical structure, C14H15N3O2, CAS 26384-48-5
3-(1H-Indol-3-ylmethyl)-6-methyl-2,5-piperazinedione
CAS 26384-48-5C14H15N3O2
L-Alanyl-L-tryptophan anhydride chemical structure, C14H15N3O2, CAS 17079-37-7
L-Alanyl-L-tryptophan anhydride
CAS 17079-37-7C14H15N3O2
(3S,6R)-3-(1H-Indol-3-ylmethyl)-6-methylpiperazine-2,5-dione chemical structure, C14H15N3O2, CAS 22839-22-1
(3S,6R)-3-(1H-Indol-3-ylmethyl)-6-methylpiperazine-2,5-dione
CAS 22839-22-1C14H15N3O2
Arestrictin B chemical structure, C29H39N3O2, CAS 929101-60-0
Arestrictin B
CAS 929101-60-0C29H39N3O2
(3S,6S)-3-[(1R)-1-Hydroxyethyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione chemical structure, C15H17N3O3, CAS 221336-99-8
(3S,6S)-3-[(1R)-1-Hydroxyethyl]-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione
CAS 221336-99-8C15H17N3O3
Variecolorin L chemical structure, C29H39N3O2, CAS 957780-87-9
Variecolorin L
CAS 957780-87-9C29H39N3O2
Cyclomarazine A chemical structure, C23H31N3O3, CAS 1019858-65-1
Cyclomarazine A
CAS 1019858-65-1C23H31N3O3
Preechinulin chemical structure, C19H23N3O2, CAS 21008-43-5
Preechinulin
CAS 21008-43-5C19H23N3O2
Ethyl 2-(1H-indol-3-ylmethyl)-4-methyl-3,6-dioxo-2-piperazinecarboxylate chemical structure, C17H19N3O4, CAS 1208321-02-1
Ethyl 2-(1H-indol-3-ylmethyl)-4-methyl-3,6-dioxo-2-piperazinecarboxylate
CAS 1208321-02-1C17H19N3O4
Cyclo(D-Ala-D-Trp-) chemical structure, C14H15N3O2, CAS 22839-21-0
Cyclo(D-Ala-D-Trp-)
CAS 22839-21-0C14H15N3O2
(3S,6S)-3-Butyl-6-[(1H-indol-3-yl)methyl]piperazine-2,5-dione chemical structure, C17H21N3O2, CAS 403696-41-3
(3S,6S)-3-Butyl-6-[(1H-indol-3-yl)methyl]piperazine-2,5-dione
CAS 403696-41-3C17H21N3O2