CompoundList
Sign in
Murcko scaffold

Ring system with 3 rings and 20 atoms

212 chemicals on CompoundList share this ring system.

Rings
3
Scaffold atoms
20
Chemicals
212
With full pages
48
Scaffold SMILES

C1CCC(OC2CCCC(OC3CCCCO3)C2)OC1

A Bemis-Murcko scaffold is what remains of a molecule when every side chain is removed: the rings and the chains that link them. Chemicals that share a scaffold often belong to the same compound series, which helps when you look for analogues, alternative suppliers or related building blocks.

Substructure search with this scaffold
Murcko scaffold C1CCC(OC2CCCC(OC3CCCCO3)C2)OC1

Computed from the structures of the chemicals listed here. Stereo and charges are removed before the scaffold is taken.

Chemicals with this scaffold

Open one to see its structure, properties and suppliers.

Showing 1 to 48 of 212 chemicals

Gentamicin chemical structure, C21H43N5O7, CAS 1403-66-3
Gentamicin
CAS 1403-66-3C21H43N5O7
Tobracin chemical structure, C18H37N5O9, CAS 1173106-27-8
Tobracin
CAS 1173106-27-8C18H37N5O9
Kanamycin chemical structure, C18H36N4O11, CAS 8063-07-8
Kanamycin
CAS 8063-07-8C18H36N4O11
Tobramycin chemical structure, C18H37N5O9, CAS 32986-56-4
Tobramycin
CAS 32986-56-4C18H37N5O9
Amikacin chemical structure, C22H43N5O13, CAS 37517-28-5
Amikacin
CAS 37517-28-5C22H43N5O13
Antibiotic XK 62-3 chemical structure, C20H41N5O7, CAS 69375-05-9
Antibiotic XK 62-3
CAS 69375-05-9C20H41N5O7
Arbekacin chemical structure, C22H44N6O10, CAS 51025-85-5
Arbekacin
CAS 51025-85-5C22H44N6O10
Gentamicin C1 chemical structure, C21H43N5O7, CAS 25876-10-2
Gentamicin C1
CAS 25876-10-2C21H43N5O7
Gentamicin C1A chemical structure, C19H39N5O7, CAS 26098-04-4
Gentamicin C1A
CAS 26098-04-4C19H39N5O7
Gentamicin C2 chemical structure, C20H41N5O7, CAS 25876-11-3
Gentamicin C2
CAS 25876-11-3C20H41N5O7
4,6-Diamino-3-((3-deoxy-3-(methylamino)pentopyranosyl)oxy)-2-hydroxycyclohexyl 2-amino-2-deoxyhexopyranoside chemical structure, C18H36N4O10, CAS 11001-13-1
4,6-Diamino-3-((3-deoxy-3-(methylamino)pentopyranosyl)oxy)-2-hydroxycyclohexyl 2-amino-2-deoxyhexopyranoside
CAS 11001-13-1C18H36N4O10
4,6-Diamino-2-hydroxy-3-(pentopyranosyloxy)cyclohexyl 2-amino-2-deoxyhexopyranoside chemical structure, C17H33N3O11, CAS 55715-66-7
4,6-Diamino-2-hydroxy-3-(pentopyranosyloxy)cyclohexyl 2-amino-2-deoxyhexopyranoside
CAS 55715-66-7C17H33N3O11
Gentamicin A3 chemical structure, C18H36N4O10, CAS 55715-67-8
Gentamicin A3
CAS 55715-67-8C18H36N4O10
2-Hydroxygentamicin C1 chemical structure, C21H43N5O8, CAS 60609-40-7
2-Hydroxygentamicin C1
CAS 60609-40-7C21H43N5O8
4'-Deoxy-6'-N-methylamikacin chemical structure, C23H45N5O12, CAS 71398-14-6
4'-Deoxy-6'-N-methylamikacin
CAS 71398-14-6C23H45N5O12
Geneticin chemical structure, C20H40N4O10, CAS 49863-47-0
Geneticin
CAS 49863-47-0C20H40N4O10
N(1)-Pentadecanoyl-N(3'')-trifluoracetylkanamycin A chemical structure, C35H63F3N4O13, CAS 92396-07-1
N(1)-Pentadecanoyl-N(3'')-trifluoracetylkanamycin A
CAS 92396-07-1C35H63F3N4O13
1-Eicosanoyl-3''-N-(trifluoroacetyl)kanamycin chemical structure, C40H73F3N4O13, CAS 96695-80-6
1-Eicosanoyl-3''-N-(trifluoroacetyl)kanamycin
CAS 96695-80-6C40H73F3N4O13
3'-Deoxy-3'-fluorokanamycin A chemical structure, C18H35FN4O10, CAS 100343-09-7
3'-Deoxy-3'-fluorokanamycin A
CAS 100343-09-7C18H35FN4O10
3'-Deoxy-3'-fluorokanamycin B chemical structure, C18H36FN5O9, CAS 100343-10-0
3'-Deoxy-3'-fluorokanamycin B
CAS 100343-10-0C18H36FN5O9
1-N-Palmitoylkanamycin A chemical structure, C34H66N4O12, CAS 106190-43-6
1-N-Palmitoylkanamycin A
CAS 106190-43-6C34H66N4O12
1-N-Palmitoyl-3''-N-(trifluoroacetyl)kanamycin A chemical structure, C36H65F3N4O13, CAS 106190-45-8
1-N-Palmitoyl-3''-N-(trifluoroacetyl)kanamycin A
CAS 106190-45-8C36H65F3N4O13
1-N-(3-Aminopropoxycarbonyl)kanamycin A chemical structure, C22H43N5O13, CAS 77987-52-1
1-N-(3-Aminopropoxycarbonyl)kanamycin A
CAS 77987-52-1C22H43N5O13
5-Deoxy-5-fluoroarbekacin chemical structure, C22H43FN6O9, CAS 119783-91-4
5-Deoxy-5-fluoroarbekacin
CAS 119783-91-4C22H43FN6O9